|
|
Line 1: |
Line 1: |
- | <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
| |
- | <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en" dir="ltr">
| |
- | <head>
| |
- | <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
| |
- | <meta name="generator" content="MediaWiki 1.16.5" />
| |
- | <link rel="alternate" type="application/x-wiki" title="Edit" href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=edit" />
| |
- | <link rel="edit" title="Edit" href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=edit" />
| |
- | <link rel="shortcut icon" href="/favicon.ico" />
| |
- | <link rel="search" type="application/opensearchdescription+xml" href="/wiki/opensearch_desc.php" title="2014.igem.org (en)" />
| |
- | <link title="Creative Commons" type="application/rdf+xml" href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=creativecommons" rel="meta" />
| |
- | <link rel="copyright" href="http://creativecommons.org/licenses/by/3.0/" />
| |
- | <link rel="alternate" type="application/atom+xml" title="2014.igem.org Atom feed" href="/wiki/index.php?title=Special:RecentChanges&feed=atom" /> <title>Team:TU Darmstadt/Results/Open Hardware - 2014.igem.org</title>
| |
- | <style type="text/css" media="screen, projection">/*<![CDATA[*/
| |
- | @import "/wiki/skins/common/shared.css?270";
| |
- | @import "/wiki/skins/igem/main.css?270";
| |
- | /*]]>*/</style>
| |
- | <link rel="stylesheet" type="text/css" media="print" href="/wiki/skins/common/commonPrint.css?270" />
| |
- | <!--[if lt IE 5.5000]><style type="text/css">@import "/wiki/skins/igem/IE50Fixes.css?270";</style><![endif]-->
| |
- | <!--[if IE 5.5000]><style type="text/css">@import "/wiki/skins/igem/IE55Fixes.css?270";</style><![endif]-->
| |
- | <!--[if IE 6]><style type="text/css">@import "/wiki/skins/igem/IE60Fixes.css?270";</style><![endif]-->
| |
- | <!--[if IE 7]><style type="text/css">@import "/wiki/skins/igem/IE70Fixes.css?270";</style><![endif]-->
| |
- | <!--[if lt IE 7]><script type="text/javascript" src="/wiki/skins/common/IEFixes.js?270"></script>
| |
- | <meta http-equiv="imagetoolbar" content="no" /><![endif]-->
| |
- |
| |
- | <script>
| |
- | var skin="igem",
| |
- | stylepath="/wiki/skins",
| |
- | wgUrlProtocols="http\\:\\/\\/|https\\:\\/\\/|ftp\\:\\/\\/|irc\\:\\/\\/|gopher\\:\\/\\/|telnet\\:\\/\\/|nntp\\:\\/\\/|worldwind\\:\\/\\/|mailto\\:|news\\:|svn\\:\\/\\/",
| |
- | wgArticlePath="/$1",
| |
- | wgScriptPath="/wiki",
| |
- | wgScriptExtension=".php",
| |
- | wgScript="/wiki/index.php",
| |
- | wgVariantArticlePath=false,
| |
- | wgActionPaths={},
| |
- | wgServer="https://2014.igem.org",
| |
- | wgCanonicalNamespace="",
| |
- | wgCanonicalSpecialPageName=false,
| |
- | wgNamespaceNumber=0,
| |
- | wgPageName="Team:TU_Darmstadt/Results/Open_Hardware",
| |
- | wgTitle="Team:TU Darmstadt/Results/Open Hardware",
| |
- | wgAction="view",
| |
- | wgArticleId=34557,
| |
- | wgIsArticle=true,
| |
- | wgUserName="SvenR",
| |
- | wgUserGroups=["*", "user", "autoconfirmed"],
| |
- | wgUserLanguage="en",
| |
- | wgContentLanguage="en",
| |
- | wgBreakFrames=false,
| |
- | wgCurRevisionId=285174,
| |
- | wgVersion="1.16.5",
| |
- | wgEnableAPI=true,
| |
- | wgEnableWriteAPI=true,
| |
- | wgSeparatorTransformTable=["", ""],
| |
- | wgDigitTransformTable=["", ""],
| |
- | wgMainPageTitle="Main Page",
| |
- | wgFormattedNamespaces={"-2": "Media", "-1": "Special", "0": "", "1": "Talk", "2": "User", "3": "User talk", "4": "2014.igem.org", "5": "2014.igem.org talk", "6": "File", "7": "File talk", "8": "MediaWiki", "9": "MediaWiki talk", "10": "Template", "11": "Template talk", "12": "Help", "13": "Help talk", "14": "Category", "15": "Category talk"},
| |
- | wgNamespaceIds={"media": -2, "special": -1, "": 0, "talk": 1, "user": 2, "user_talk": 3, "2014.igem.org": 4, "2014.igem.org_talk": 5, "file": 6, "file_talk": 7, "mediawiki": 8, "mediawiki_talk": 9, "template": 10, "template_talk": 11, "help": 12, "help_talk": 13, "category": 14, "category_talk": 15, "image": 6, "image_talk": 7},
| |
- | wgSiteName="2014.igem.org",
| |
- | wgCategories=[],
| |
- | wgMWSuggestTemplate="https://2014.igem.org/wiki/api.php?action=opensearch\x26search={searchTerms}\x26namespace={namespaces}\x26suggest",
| |
- | wgDBname="2014_igem_org",
| |
- | wgSearchNamespaces=[0],
| |
- | wgMWSuggestMessages=["with suggestions", "no suggestions"],
| |
- | wgRestrictionEdit=[],
| |
- | wgRestrictionMove=[],
| |
- | wgAjaxWatch={"watchMsg": "Watch", "unwatchMsg": "Unwatch", "watchingMsg": "Watching...", "unwatchingMsg": "Unwatching...", "tooltip-ca-watchMsg": "Add this page to your watchlist", "tooltip-ca-unwatchMsg": "Remove this page from your watchlist"};
| |
- | </script>
| |
- | <script type="text/javascript" src="/wiki/skins/common/wikibits.js?270"><!-- wikibits js --></script>
| |
- | <!-- Head Scripts -->
| |
- | <script src="/wiki/skins/common/ajax.js?270"></script>
| |
- | <script src="/wiki/skins/common/ajaxwatch.js?270"></script>
| |
- | <script src="/wiki/skins/common/mwsuggest.js?270"></script>
| |
- | <script type="text/javascript" src="/wiki/index.php?title=-&action=raw&smaxage=0&gen=js&useskin=igem"><!-- site js --></script>
| |
- | <!-- jQuery Javascript -->
| |
- | <script type='text/javascript' src ='/common/jquery-latest.min.js'></script>
| |
- | <script type='text/javascript' src ='/common/tablesorter/jquery.tablesorter.min.js'></script>
| |
- | <link rel='stylesheet' type='text/css' href='/common/tablesorter/themes/groupparts/style.css' />
| |
- | <link rel='stylesheet' type='text/css' href='/common/table_styles.css' />
| |
- | <link rel='stylesheet' type='text/css' href='/forum/forum_styles.css' />
| |
- | <script type='text/javascript' src ='/forum/forum_scripts.js'></script>
| |
- | </head>
| |
- |
| |
- | <body class="mediawiki ltr ns-0 ns-subject page-Team_TU_Darmstadt_Results_Open_Hardware">
| |
- | <div id="globalWrapper">
| |
- |
| |
- | <div id="top-section">
| |
- | <div id="p-logo">
| |
- | <a href="/Main_Page"
| |
- | title="Main Page">
| |
- | <img src='https://2014.igem.org/images/wiki.png'>"
| |
- | </a>
| |
- | </div> <!-- end p-logo -->
| |
- | <script type="text/javascript"> if (window.isMSIE55) fixalpha(); </script>
| |
- |
| |
- |
| |
- |
| |
- | <div id="menubar" class='left-menu noprint'>
| |
- | <ul>
| |
- | <li
| |
- | class='selected' ><a href="/Team:TU_Darmstadt/Results/Open_Hardware">Page </a></li>
| |
- | <li
| |
- | class='new' ><a href="/wiki/index.php?title=Talk:Team:TU_Darmstadt/Results/Open_Hardware&action=edit&redlink=1">Discussion </a></li>
| |
- | <li
| |
- | ><a href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=edit">Edit </a></li>
| |
- | <li
| |
- | ><a href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=history">History </a></li>
| |
- | <li
| |
- | ><a href="/Special:MovePage/Team:TU_Darmstadt/Results/Open_Hardware">Move </a></li>
| |
- | <li
| |
- | ><a href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&action=watch">Watch </a></li>
| |
- | <li style='color:white;cursor:default'>teams</li>
| |
- | </ul>
| |
- | </div> <!-- end menubar (left) -->
| |
- |
| |
- | <div class="right-menu noprint" id="menubar">
| |
- | <ul>
| |
- | <li id="pt-userpage"><a href="/User:SvenR" title="Your user page [.]" accesskey="." class="new">SvenR</a></li> <li id='pt-preferences'><a href='https://igem.org/User_Information' title='My account'>My account</a></li>
| |
- | <li id="pt-logout"><a href="/wiki/index.php?title=Special:UserLogout&returnto=Team:TU_Darmstadt/Results/Open_Hardware" title="Log out">Log out</a></li> </ul>
| |
- | </div><!-- end right menubar -->
| |
- |
| |
- | <div id="search-controls" class="noprint">
| |
- | <form action="/Special:Search" id="searchform">
| |
- | <input id="searchInput" name="search" type="text" title="Search 2014.igem.org [f]" accesskey="f" value="" />
| |
- | <input type='submit' name="go" class="searchButton" id="searchGoButton" value="Go" title="Go to a page with this exact name if exists" />
| |
- | <input type='submit' name="fulltext" class="searchButton" id="mw-searchButton" value="Search" title="Search the pages for this text" />
| |
- | </form>
| |
- | </div> <!-- close search controls -->
| |
- | </div> <!-- close top-section-->
| |
- | <div id="content">
| |
- | <a name="top" id="top"></a>
| |
- | <h1 class="firstHeading">Team:TU Darmstadt/Results/Open Hardware</h1>
| |
- | <div id="bodyContent">
| |
- | <h3 id="siteSub" class='noprint'>From 2014.igem.org</h3>
| |
- | <div id="contentSub"></div>
| |
- | <!--
| |
- | <div id="jump-to-nav">Jump to: <a href="#column-one">navigation</a>, <a href="#searchInput">search</a></div>-->
| |
- | <!-- start content -->
| |
- | <p>
| |
- | <style type="text/css">
| |
- |
| |
- |
| |
- |
| |
- | /*
| |
- |
| |
- | Created by SJ
| |
- |
| |
- |
| |
- | */
| |
- |
| |
- | #contentSub, #footer-box, #catlinks, #search-controls, #p-logo, .printfooter, .visualClear {display: none;}
| |
- |
| |
- | /*-- hides default wiki settings --*/
| |
- |
| |
- | .firstHeading {
| |
- | width: 0px;
| |
- | margin: 0px auto;
| |
- | padding-top: 0px;
| |
- | margin-top: 100px;
| |
- | margin-bottom: 0px;
| |
- | font-family: Georgia, Times, "Times New Roman", serif;
| |
- | display:none;
| |
- | }
| |
- |
| |
- |
| |
- | #top-section { /*-- styling for default menu bar (edit, page, history, etc.) --*/
| |
- | background-color: #383838;
| |
- | border: 0 none;
| |
- | height: 0px;
| |
- | z-index: 100;
| |
- | top: 10px;
| |
- | /*position: fixed;*/
| |
- | width: 975px;
| |
- | left: 50%;
| |
- | margin-left: -487px;
| |
- | }
| |
- |
| |
- | #top-section-bar { /*-- styling full width bar which hides behind default menu bar (edit, page, history, etc.) --*/
| |
- | background-color: #383838;
| |
- | height: 0px;
| |
- | display: block;
| |
- | z-index: 10;
| |
- | position: fixed;
| |
- | width: 100%;
| |
- | top: 0px;
| |
- | }
| |
- |
| |
- | #menubar a:link, #menubar a:active, #menubar a:visited, #menubar a:hover, #menubar:hover { /*-- styling for default menu bar links (edit, page, history, etc.) --*/
| |
- | color: #727272;
| |
- | text-decoration: none;
| |
- | background-color: transparent;
| |
- | }
| |
- |
| |
- | body {
| |
- | background-color: #727272;
| |
- |
| |
- | }
| |
- |
| |
- | #globalWrapper, #content { /*-- changes default wiki settings --*/
| |
- | width: 100%;
| |
- | height: 100%;
| |
- | border: 0px;
| |
- | background-color: transparent;
| |
- | margin: 0px;
| |
- | padding: 0px;
| |
- | }
| |
- |
| |
- |
| |
- | /*
| |
- |
| |
- | Created by MT
| |
- |
| |
- |
| |
- | */
| |
- |
| |
- | /* default styles for extension "tx_felogin_pi1" */
| |
- | .tx-felogin-pi1 label {
| |
- | display: block;
| |
- | }
| |
- | /* default styles for extension "tt_news" */
| |
- |
| |
- |
| |
- |
| |
- | .news-single-rightbox,
| |
- | .news-single-imgcaption,
| |
- | .news-latest-date,
| |
- | .news-latest-morelink,
| |
- | .news-latest-category,
| |
- | .news-list-category,
| |
- | .news-list-author,
| |
- | .news-list-imgcaption,
| |
- | .news-list-date,
| |
- | .news-list-browse,
| |
- | .news-amenu-container,
| |
- | .news-catmenu {
| |
- | font-size:10px;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | /*----------------------------------- clearer -----------------------------------*/
| |
- | /* prevent floated images from overlapping the div-containers they are wrapped in */
| |
- |
| |
- | .news-latest-container HR.clearer,
| |
- | .news-list-container HR.clearer,
| |
- | .news-list2-container HR.clearer,
| |
- | .news-list3-container HR.clearer,
| |
- | .news-single-item HR.cl-left,
| |
- | .news-single-item HR.cl-right
| |
- | {
| |
- | clear:right;
| |
- | height:1px;
| |
- | border:none;
| |
- | padding:0;
| |
- | margin:0;
| |
- | }
| |
- | .news-list2-container HR.clearer,
| |
- | .news-list3-container HR.clearer {
| |
- | clear:both;
| |
- | }
| |
- |
| |
- | .news-single-item HR.cl-left {
| |
- | clear:left;
| |
- | }
| |
- |
| |
- | /*----------------------------------- tt_news LATEST view -----------------------------------*/
| |
- |
| |
- | .news-latest-container {
| |
- | padding:10px;
| |
- | }
| |
- |
| |
- | .news-latest-gotoarchive {
| |
- | padding:3px;
| |
- | margin:3px;
| |
- | background-color:#f3f3f3;
| |
- | }
| |
- |
| |
- |
| |
- | .news-latest-container H2 {
| |
- | padding: 0 0 2px 0;
| |
- | margin:0;
| |
- | }
| |
- |
| |
- | .news-latest-item {
| |
- | padding:3px;
| |
- | margin:0;
| |
- | }
| |
- |
| |
- | .news-latest-item IMG {
| |
- |
| |
- | margin: 0 5px 5px 0;
| |
- | float:left;
| |
- | border: none;
| |
- | }
| |
- | .news-latest-category IMG {
| |
- | float: none;
| |
- | border:none;
| |
- | margin:0px;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | .news-latest-item > p {
| |
- | margin:0;
| |
- | padding:0;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | /*--------------------------------- tt_news LIST view -----------------------------------*/
| |
- | .news-list-container {
| |
- | padding: 10px 0;
| |
- |
| |
- | }
| |
- | .news-list-item {
| |
- | padding: 0 0 10px 0;
| |
- | }
| |
- |
| |
- | .news-list-container H2 {
| |
- | margin: 0px;
| |
- | }
| |
- |
| |
- | .news-list-date {
| |
- | float: right;
| |
- | display:block;
| |
- | padding-left:10px;
| |
- | }
| |
- |
| |
- | .news-list-imgcaption {
| |
- | padding:3px 3px 0 0;
| |
- |
| |
- | }
| |
- |
| |
- | .news-list-container IMG {
| |
- | float: right;
| |
- | margin:0 2px 5px 5px;
| |
- | border: none;
| |
- |
| |
- | }
| |
- |
| |
- | .news-list-category IMG {
| |
- | float: none;
| |
- | border:none;
| |
- | margin:0px;
| |
- | }
| |
- |
| |
- | .news-list-morelink {
| |
- | padding-left:5px;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | /*--------------------------------- LIST2 / 3 ---------------------------------*/
| |
- |
| |
- | .news-list2-container,
| |
- | .news-list3-container {
| |
- | padding: 0 0 10px 0;
| |
- | }
| |
- |
| |
- |
| |
- | .news-list2-container,
| |
- | .news-list3-container {
| |
- | background:#e5e5e5;
| |
- | }
| |
- |
| |
- | .news-list3-item,
| |
- | .list2-subdiv-hdr {
| |
- | background:#f1f1f1;
| |
- | }
| |
- | .news-list2-container .hdr-left,
| |
- | .news-list2-container .hdr-right,
| |
- | .news-list3-container .list3-left,
| |
- | .news-list3-container .list3-right {
| |
- | width:48%;
| |
- | float:left;
| |
- | padding:5px;
| |
- | }
| |
- |
| |
- | .news-list2-container .sub-left,
| |
- | .news-list2-container .sub-middle,
| |
- | .news-list2-container .sub-right {
| |
- | width:31%;
| |
- | float:left;
| |
- | padding:5px;
| |
- | }
| |
- |
| |
- | .news-list3-item {
| |
- | padding:5px;
| |
- | }
| |
- |
| |
- | .news-list3-item,
| |
- | .list3-subdiv,
| |
- | .list2-subdiv {
| |
- | border-top:5px solid #fff;
| |
- | }
| |
- |
| |
- |
| |
- | .news-list2-container IMG {
| |
- | float: right;
| |
- | margin:0 2px 5px 5px;
| |
- | border: none;
| |
- |
| |
- | }
| |
- | .news-list3-container IMG {
| |
- | float: left;
| |
- | margin:0 5px 5px 2px;
| |
- | border: none;
| |
- |
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | /*--------------------------------- tt_news Page-Browser ---------------------------------*/
| |
- |
| |
- | .news-list-browse {
| |
- | text-align:center;
| |
- | margin-bottom:20px;
| |
- | }
| |
- |
| |
- | .activeLinkWrap {
| |
- | font-weight:bold;
| |
- | }
| |
- | .disabledLinkWrap {
| |
- | color: #999;
| |
- | }
| |
- | .disabledLinkWrap,
| |
- | .browseLinksWrap a,
| |
- | .activeLinkWrap {
| |
- | padding:0 1px;
| |
- | }
| |
- |
| |
- | /*--------------------------------- tt_news SINGLE view ---------------------------------*/
| |
- |
| |
- |
| |
- | .news-single-item {
| |
- | padding:5px;
| |
- | margin-bottom:5px;
| |
- |
| |
- |
| |
- | }
| |
- |
| |
- | .news-single-img {
| |
- | float: right;
| |
- | margin:10px 0 0 10px;
| |
- | padding:0;
| |
- | }
| |
- |
| |
- | .news-single-img img {
| |
- | border:none;
| |
- | }
| |
- |
| |
- | .news-single-imgcaption {
| |
- | padding: 1px 0 3px 0;
| |
- | margin:0;
| |
- | }
| |
- |
| |
- | .news-single-rightbox {
| |
- | float: right;
| |
- | width:160px;
| |
- | text-align:right;
| |
- | clear:both;
| |
- | }
| |
- | .news-single-backlink {
| |
- | padding: 10px;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | .news-single-additional-info {
| |
- | margin-top: 15px;
| |
- | padding:3px;
| |
- | clear:both;
| |
- | }
| |
- |
| |
- | .news-single-related,
| |
- | .news-single-files,
| |
- | .news-single-links {
| |
- | margin: 0;
| |
- | margin-bottom: 3px;
| |
- | padding: 3px;
| |
- | }
| |
- |
| |
- | .news-single-related DD,
| |
- | .news-single-links DD,
| |
- | .news-single-files DD {
| |
- | margin-left: 20px;
| |
- | }
| |
- |
| |
- | .news-single-related DT,
| |
- | .news-single-links DT,
| |
- | .news-single-files DT {
| |
- | font-weight: bold;
| |
- | margin-left: 5px;
| |
- | }
| |
- |
| |
- | .news-single-files DD A {
| |
- | padding:0 3px;
| |
- | }
| |
- |
| |
- |
| |
- | /*--------------------------------- SINGLE2 ---------------------------------*/
| |
- |
| |
- |
| |
- | .sv-img-big img,
| |
- | .sv-img-small img {
| |
- | border:none;
| |
- | }
| |
- |
| |
- | .sv-img-big {
| |
- | float: right;
| |
- | padding: 10px 0 2px 10px;
| |
- | }
| |
- | .sv-img-small-wrapper {
| |
- | padding:15px 0;
| |
- | }
| |
- | .sv-img-small {
| |
- | float: left;
| |
- | padding: 0 10px 10px 0;
| |
- | }
| |
- |
| |
- |
| |
- | /*--------------------------------- tt_news Archivemenu (AMENU) --------------------------------- */
| |
- | .news-amenu-container {
| |
- | width:165px;
| |
- | padding:0;
| |
- | margin-left:10px;
| |
- | }
| |
- | .news-amenu-container LI {
| |
- | padding-bottom:1px;
| |
- |
| |
- | }
| |
- | .news-amenu-container LI:hover {
| |
- | background-color: #f3f3f3;
| |
- |
| |
- | }
| |
- |
| |
- | .news-amenu-container UL {
| |
- | padding:0;
| |
- | margin:0;
| |
- | margin-top:5px;
| |
- |
| |
- | list-style-type: none;
| |
- | }
| |
- |
| |
- | .news-amenu-item-year {
| |
- | font-weight: bold;
| |
- | margin-top:10px;
| |
- | padding: 2px;
| |
- | background-color: #f3f3f3;
| |
- |
| |
- | }
| |
- |
| |
- |
| |
- | .amenu-act {
| |
- | background:#fff;
| |
- | font-weight:bold;
| |
- | }
| |
- |
| |
- | /*--------------------------------- tt_news Categorymenu (CATMENU) --------------------------------- */
| |
- |
| |
- | .news-catmenu {
| |
- | padding:10px;
| |
- |
| |
- | }
| |
- |
| |
- | ul.tree {
| |
- | list-style: none;
| |
- | margin: 0;
| |
- | padding: 0;
| |
- | clear: both;
| |
- | }
| |
- |
| |
- | ul.tree A {
| |
- | text-decoration: none;
| |
- | }
| |
- |
| |
- | ul.tree A.pm {
| |
- | cursor: pointer;
| |
- | }
| |
- |
| |
- | ul.tree img {
| |
- | vertical-align: middle;
| |
- | }
| |
- |
| |
- | ul.tree ul {
| |
- | list-style: none;
| |
- | margin: 0;
| |
- | padding: 0;
| |
- | padding-left: 17px;
| |
- | }
| |
- |
| |
- | ul.tree ul li {
| |
- | list-style: none;
| |
- | margin: 0;
| |
- | padding: 0;
| |
- | line-height: 10px;
| |
- | white-space: nowrap;
| |
- | }
| |
- |
| |
- | ul.tree ul li.expanded ul {
| |
- | background: transparent url('../typo3/gfx/ol/line.gif') repeat-y top left;
| |
- | }
| |
- |
| |
- | ul.tree ul li.last > ul {
| |
- | background: none;
| |
- | }
| |
- |
| |
- | ul.tree li.active, ul.tree ul li.active {
| |
- | background-color: #ebebeb !important;
| |
- | }
| |
- |
| |
- | ul.tree li.active ul, ul.tree ul li.active ul {
| |
- | background-color: #f7f3ef;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | /* Styles for catmenu mode "nestedWraps" */
| |
- | .level1 {
| |
- | padding:1px;
| |
- | padding-left:10px;
| |
- | background-color:#ebf8bf;
| |
- | border-left:1px solid #666;
| |
- | border-top:1px solid #666;
| |
- | }
| |
- | .level2 {
| |
- | padding:1px;
| |
- | padding-left:10px;
| |
- | background-color:#ddf393;
| |
- | border-left:1px solid #666;
| |
- | }
| |
- | .level3 {
| |
- | padding:1px;
| |
- | padding-left:10px;
| |
- | background-color:#cae46e;
| |
- | border-left:1px solid #666;
| |
- | border-top:1px solid #666;
| |
- |
| |
- | }
| |
- | .level4 {
| |
- | padding:1px;
| |
- | padding-left:10px;
| |
- | background-color:#b0cb51;
| |
- | border-left:1px solid #666;
| |
- | }
| |
- |
| |
- |
| |
- | /* default styles for extension "tx_cssstyledcontent" */
| |
- | /* Headers */
| |
- | .csc-header-alignment-center { text-align: center; }
| |
- | .csc-header-alignment-right { text-align: right; }
| |
- | .csc-header-alignment-left { text-align: left; }
| |
- |
| |
- | div.csc-textpic-responsive, div.csc-textpic-responsive * { -moz-box-sizing: border-box; -webkit-box-sizing: border-box; box-sizing: border-box; }
| |
- |
| |
- | /* Clear floats after csc-textpic and after csc-textpic-imagerow */
| |
- | div.csc-textpic, div.csc-textpic div.csc-textpic-imagerow, ul.csc-uploads li { overflow: hidden; }
| |
- |
| |
- | /* Set padding for tables */
| |
- | div.csc-textpic .csc-textpic-imagewrap table { border-collapse: collapse; border-spacing: 0; }
| |
- | div.csc-textpic .csc-textpic-imagewrap table tr td { padding: 0; vertical-align: top; }
| |
- |
| |
- | /* Settings for figure and figcaption (HTML5) */
| |
- | div.csc-textpic .csc-textpic-imagewrap figure, div.csc-textpic figure.csc-textpic-imagewrap { margin: 0; display: table; }
| |
- |
| |
- | /* Captions */
| |
- | figcaption.csc-textpic-caption { display: table-caption; }
| |
- | .csc-textpic-caption { text-align: left; caption-side: bottom; }
| |
- | div.csc-textpic-caption-c .csc-textpic-caption, .csc-textpic-imagewrap .csc-textpic-caption-c { text-align: center; }
| |
- | div.csc-textpic-caption-r .csc-textpic-caption, .csc-textpic-imagewrap .csc-textpic-caption-r { text-align: right; }
| |
- | div.csc-textpic-caption-l .csc-textpic-caption, .csc-textpic-imagewrap .csc-textpic-caption-l { text-align: left; }
| |
- |
| |
- | /* Float the columns */
| |
- | div.csc-textpic div.csc-textpic-imagecolumn { float: left; }
| |
- |
| |
- | /* Border just around the image */
| |
- | div.csc-textpic-border div.csc-textpic-imagewrap img {
| |
- | border: 2px solid black;
| |
- | padding: 0px 0px;
| |
- |
| |
- | }
| |
- |
| |
- | .csc-textpic-imagewrap img {
| |
- | border-radius: 20px; border 2px solid black;
| |
- | }
| |
- |
| |
- |
| |
- | div.csc-textpic .csc-textpic-imagewrap img { border: none; display: block; border: 1px solid black;}
| |
- |
| |
- | /* Space below each image (also in-between rows) */
| |
- | div.csc-textpic .csc-textpic-imagewrap .csc-textpic-image { margin-bottom: 10px; }
| |
- | div.csc-textpic .csc-textpic-imagewrap .csc-textpic-imagerow-last .csc-textpic-image { margin-bottom: 0; }
| |
- |
| |
- | /* colSpace around image columns, except for last column */
| |
- | div.csc-textpic-imagecolumn, td.csc-textpic-imagecolumn .csc-textpic-image { margin-right: 10px; }
| |
- | div.csc-textpic-imagecolumn.csc-textpic-lastcol, td.csc-textpic-imagecolumn.csc-textpic-lastcol .csc-textpic-image { margin-right: 0; }
| |
- |
| |
- | /* Add margin from image-block to text (in case of "Text & Images") */
| |
- | div.csc-textpic-intext-left .csc-textpic-imagewrap,
| |
- | div.csc-textpic-intext-left-nowrap .csc-textpic-imagewrap {
| |
- | margin-right: 10px;
| |
- | }
| |
- | div.csc-textpic-intext-right .csc-textpic-imagewrap,
| |
- | div.csc-textpic-intext-right-nowrap .csc-textpic-imagewrap {
| |
- | margin-left: 10px;
| |
- | }
| |
- |
| |
- | /* Positioning of images: */
| |
- |
| |
- | /* Center (above or below) */
| |
- | div.csc-textpic-center .csc-textpic-imagewrap, div.csc-textpic-center figure.csc-textpic-imagewrap { overflow: hidden; }
| |
- | div.csc-textpic-center .csc-textpic-center-outer { position: relative; float: right; right: 50%; }
| |
- | div.csc-textpic-center .csc-textpic-center-inner { position: relative; float: right; right: -50%; }
| |
- |
| |
- | /* Right (above or below) */
| |
- | div.csc-textpic-right .csc-textpic-imagewrap { float: right; }
| |
- | div.csc-textpic-right div.csc-textpic-text { clear: right; }
| |
- |
| |
- | /* Left (above or below) */
| |
- | div.csc-textpic-left .csc-textpic-imagewrap { float: left; }
| |
- | div.csc-textpic-left div.csc-textpic-text { clear: left; }
| |
- |
| |
- | /* Left (in text) */
| |
- | div.csc-textpic-intext-left .csc-textpic-imagewrap { float: left; }
| |
- |
| |
- | /* Right (in text) */
| |
- | div.csc-textpic-intext-right .csc-textpic-imagewrap { float: right; }
| |
- |
| |
- | /* Right (in text, no wrap around) */
| |
- | div.csc-textpic-intext-right-nowrap .csc-textpic-imagewrap { float: right; }
| |
- |
| |
- | /* Left (in text, no wrap around) */
| |
- | div.csc-textpic-intext-left-nowrap .csc-textpic-imagewrap { float: left; }
| |
- |
| |
- | div.csc-textpic div.csc-textpic-imagerow-last, div.csc-textpic div.csc-textpic-imagerow-none div.csc-textpic-last { margin-bottom: 0; }
| |
- |
| |
- | /* Browser fixes: */
| |
- |
| |
- | /* Fix for unordered and ordered list with image "In text, left" */
| |
- | .csc-textpic-intext-left ol, .csc-textpic-intext-left ul { padding-left: 40px; overflow: auto; }
| |
- |
| |
- | /* File Links */
| |
- | ul.csc-uploads { padding: 0; }
| |
- | ul.csc-uploads li { list-style: none outside none; margin: 1em 0; }
| |
- | ul.csc-uploads img { float: left; padding-right: 1em; vertical-align: top; }
| |
- | ul.csc-uploads span { display: block; }
| |
- | ul.csc-uploads span.csc-uploads-fileName { text-decoration: underline; }
| |
- |
| |
- | /* Table background colors: */
| |
- |
| |
- | table.contenttable-color-1 { background-color: #EDEBF1; }
| |
- | table.contenttable-color-2 { background-color: #F5FFAA; }
| |
- | table.contenttable-color-240 { background-color: black; }
| |
- | table.contenttable-color-241 { background-color: white; }
| |
- | table.contenttable-color-242 { background-color: #333333; }
| |
- | table.contenttable-color-243 { background-color: gray; }
| |
- | table.contenttable-color-244 { background-color: silver; }
| |
- | /* specific page styles for extension "tx_cssstyledcontent" */
| |
- | .csc-textpic-intext-right-nowrap .csc-textpic-text { margin-right: 310px; }
| |
- | .csc-textpic-intext-left-nowrap .csc-textpic-text { margin-left: 310px; }
| |
- | /* default styles for extension "tx_form" */
| |
- | div.csc-mailform ol,
| |
- | div.csc-mailform ol li {
| |
- | margin: 0;
| |
- | padding: 0;
| |
- | }
| |
- |
| |
- | div.csc-mailform ol li {
| |
- | overflow: hidden;
| |
- | }
| |
- |
| |
- | div.csc-mailform fieldset {
| |
- | margin: 0;
| |
- | padding: 0;
| |
- | position: relative;
| |
- | }
| |
- |
| |
- | div.csc-mailform legend {
| |
- | margin-left: 1em;
| |
- | color: #000000;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | div.csc-mailform fieldset ol {
| |
- | padding: 1em 1em 0 1em;
| |
- | }
| |
- |
| |
- | div.csc-mailform fieldset li {
| |
- | padding: 0.5em;
| |
- | margin-bottom: 0.5em;
| |
- | list-style: none;
| |
- | }
| |
- |
| |
- | div.csc-mailform fieldset.submit {
| |
- | border-style: none;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Normal label
| |
- | * Left aligned, in front of input
| |
- | */
| |
- | div.csc-mailform li label {
| |
- | float: left;
| |
- | width: 13em;
| |
- | margin-right: 1em;
| |
- | vertical-align: baseline;
| |
- | }
| |
- |
| |
- | div.csc-mailform li input + label,
| |
- | div.csc-mailform li textarea + label,
| |
- | div.csc-mailform li select + label {
| |
- | float: none;
| |
- | width: auto;
| |
- | margin-right: 0;
| |
- | margin-left: 1em;
| |
- | }
| |
- |
| |
- | div.csc-mailform li textarea + label {
| |
- | vertical-align: top;
| |
- | }
| |
- |
| |
- | label em,
| |
- | legend em {
| |
- | display: block;
| |
- | color: #060;
| |
- | font-size: 85%;
| |
- | font-style: normal;
| |
- | text-transform: uppercase;
| |
- | }
| |
- |
| |
- | legend em {
| |
- | position: absolute;
| |
- | }
| |
- |
| |
- | label strong,
| |
- | legend strong {
| |
- | display: block;
| |
- | color: #C00;
| |
- | font-size: 85%;
| |
- | font-weight: normal;
| |
- | text-transform: uppercase;
| |
- | }
| |
- |
| |
- | legend strong {
| |
- | position: absolute;
| |
- | top: 1.4em;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Labels alignment right
| |
- | */
| |
- | .labels-alignment-right label,
| |
- | .labels-alignment-right .fieldset-subgroup legend,
| |
- | .labels-alignment-right.fieldset-subgroup legend {
| |
- | text-align: right;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Horizontal fieldset
| |
- | */
| |
- | fieldset.fieldset-horizontal {
| |
- | border-width: 0;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-horizontal ol {
| |
- | padding: 0;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-horizontal li {
| |
- | float: left;
| |
- | padding: 0;
| |
- | margin-right: 1em;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-horizontal.label-below label {
| |
- | display: block;
| |
- | margin-left: 0;
| |
- | margin-top: 0.2em;
| |
- | font-size: 90%;
| |
- | color: #999999;
| |
- | text-align: left;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-horizontal label em {
| |
- | display: inline;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Subgroup fieldset
| |
- | */
| |
- | fieldset.fieldset-subgroup {
| |
- | margin-bottom: -2em;
| |
- | border-style: none;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-subgroup legend {
| |
- | margin-left: 0;
| |
- | padding: 0;
| |
- | font-weight: normal;
| |
- | width: 13em;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-subgroup ol {
| |
- | position: relative;
| |
- | top: -1.4em;
| |
- | margin: 0 0 0 14em;
| |
- | padding: 0;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-subgroup li {
| |
- | padding: 0;
| |
- | }
| |
- |
| |
- | fieldset.fieldset-subgroup input + label {
| |
- | float: none;
| |
- | width: auto;
| |
- | display: inline;
| |
- | margin: 0 0 0 1em;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Labels as block
| |
- | * Labels displayed above or below the input fields
| |
- | */
| |
- | .labels-block label {
| |
- | display: block;
| |
- | float: none;
| |
- | margin: 0 0 0.5em;
| |
- | width: auto;
| |
- | }
| |
- |
| |
- | .labels-block input + label,
| |
- | .labels-block textarea + label {
| |
- | margin: 0.5em 0 0;
| |
- | }
| |
- |
| |
- | .labels-block fieldset.fieldset-subgroup,
| |
- | fieldset.labels-block.fieldset-subgroup {
| |
- | margin-bottom: 0;
| |
- | }
| |
- |
| |
- | .labels-block .fieldset-subgroup legend,
| |
- | .labels-block.fieldset-subgroup legend {
| |
- | width: auto;
| |
- | }
| |
- |
| |
- | .labels-block .fieldset-subgroup legend em,
| |
- | .labels-block.fieldset-subgroup legend em {
| |
- | position: relative;
| |
- | }
| |
- |
| |
- | .labels-block .fieldset-subgroup legend strong,
| |
- | .labels-block.fieldset-subgroup legend strong {
| |
- | position: relative;
| |
- | top: 0;
| |
- | }
| |
- |
| |
- | .labels-block .fieldset-subgroup ol,
| |
- | .labels-block.fieldset-subgroup ol {
| |
- | top: 0;
| |
- | margin: 0;
| |
- | padding: 0.5em 0 0;
| |
- | }
| |
- | /* default styles for extension "tx_ptextbase" */
| |
- |
| |
- | .tx-extbase-highlight {
| |
- | font-weight:bold;
| |
- | color: #003399;
| |
- | }
| |
- |
| |
- | .pt-extbase-groupselector {
| |
- | border: 1px solid #7C7C7C;
| |
- | padding:5px;
| |
- | }
| |
- |
| |
- | /* default styles for extension "tx_ptextlist" */
| |
- |
| |
- | /* List */
| |
- | .tx-ptextlist-list-standard {
| |
- | border-collapse: collapse;
| |
- | border-spacing: 0;
| |
- | font-size: 12px;
| |
- | width: 100%;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-list-standard th {
| |
- | background: #AAA;
| |
- | border: 1px solid #bfbfbf;
| |
- | padding: 4px;
| |
- | white-space: nowrap;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-list-standard td {
| |
- | border: 1px solid #bfbfbf;
| |
- | margin: 0px;
| |
- | padding: 2px 4px 2px 4px;
| |
- | vertical-align: top;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-list-standard tr.odd {
| |
- | background-color: #ffffff;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-list-standard tr.even {
| |
- | background-color: #F5F5F5;
| |
- | }
| |
- |
| |
- |
| |
- | /* Listheader */
| |
- | .tx-ptextlist-list-header a {
| |
- | text-decoration: none;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-list-header img {
| |
- | border: none;
| |
- | }
| |
- |
| |
- |
| |
- | /* Aggregates */
| |
- | .tx-ptextlist-aggregaterow {
| |
- | background-color: #DDDDDD;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | /* Export */
| |
- |
| |
- | .tx-ptextlist-list-exportLink {
| |
- | margin: 5px;
| |
- | }
| |
- |
| |
- | /* Column selector */
| |
- | .tx-ptextlist-columnSelector{
| |
- | border: 1px solid #BFBFBF;
| |
- | margin-bottom: 20px;
| |
- | padding: 5px;
| |
- | overflow: hidden;
| |
- | background-color: #eee;
| |
- | }
| |
- |
| |
- |
| |
- | /* Filters */
| |
- | .tx-ptextlist-filterbox {
| |
- | border: 1px solid #BFBFBF;
| |
- | margin-bottom: 20px;
| |
- | padding: 5px;
| |
- | overflow: hidden;
| |
- | background-color: #eee;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-filterboxcontrols {
| |
- | /* float: left; */
| |
- | clear: both;
| |
- | padding: 18px 0 0 10px;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-filters {
| |
- | list-style-type: none;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-filter {
| |
- | float: left;
| |
- | margin: 20px;
| |
- | padding: 10px;
| |
- | list-style-type: none;
| |
- | background-color: #ccc;
| |
- | border: 1px solid #AFAFAF;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | /* Filters | Firstletter */
| |
- | .tx-ptextlist-filter-firstLetter{
| |
- | float: left;
| |
- | padding: 3px;
| |
- | list-style-type: none;
| |
- | }
| |
- |
| |
- | .type-button .reset {
| |
- | margin-left: 1em;
| |
- | }
| |
- |
| |
- | /* Filters | TagClud */
| |
- | .tx-ptextlist-filter-tagCloud-list li {
| |
- | float: left;
| |
- | list-style: none outside none;
| |
- | margin-right: 6px;
| |
- | margin-top: 3px;
| |
- |
| |
- | }
| |
- |
| |
- | .tx-ptextlist-filter-tagCloud-list li a:hover {
| |
- | text-decoration: underline;
| |
- | }
| |
- |
| |
- | /* Pager */
| |
- | .tx-ptextlist-pager-wrapper {
| |
- | border: 1px solid #BFBFBF;
| |
- | margin-top: 20px;
| |
- | padding: 5px;
| |
- | overflow: hidden;
| |
- | background-color: #eee;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-pager {
| |
- | margin-left: 0;
| |
- | text-align: center;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-pager li {
| |
- | display: inline;
| |
- | }
| |
- |
| |
- | .tx-ptextlist-pager-item-display {
| |
- | color: #777;
| |
- | }
| |
- | /* Next Section XXX */
| |
- |
| |
- | .tx-powermail{width:640px;color:#444}.tx-powermail .clear{clear:both}.tx-powermail *{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.tx-powermail *.hide{display:none}.tx-powermail .powermail_fieldset{clear:left;border:1px solid #bbb;padding:10px;margin:0 0 20px 0;background:#eee}.tx-powermail .powermail_fieldset .powermail_legend{color:#bbb;float:right;margin:3px 0 10px 0;font-size:200%;white-space:normal}.tx-powermail .powermail_fieldset .powermail_label{display:block;width:200px;float:left;clear:left;font-weight:bold}.tx-powermail .powermail_fieldset .powermail_label[title]{cursor:help}.tx-powermail .powermail_fieldset .powermail_label[title]:after{content:'i';display:inline-block;-webkit-border-radius:100px;-moz-border-radius:100px;-ms-border-radius:100px;-o-border-radius:100px;border-radius:100px;height:16px;width:16px;background-color:#aaa;margin:0 0 0 2px;font-size:14px;line-height:16px;text-align:center;color:white;font-family:arial;font-weight:bold}.tx-powermail .powermail_fieldset .powermail_label[title][title=""]{cursor:inherit}.tx-powermail .powermail_fieldset .powermail_label[title][title=""]:after{display:none}.tx-powermail .powermail_fieldset .powermail_fieldwrap{margin:0 0 0.5em 0;clear:both;overflow:hidden}.tx-powermail .powermail_fieldset .powermail_field{width:400px;padding:5px;margin:0;border:1px solid #bbb;color:#444;float:right;font-size:inherit}.tx-powermail .powermail_fieldset .powermail_field.powermail_submit,.tx-powermail .powermail_fieldset .powermail_field.powermail_reset{margin:5px 0 0 0;padding:5px 20px;color:white;font-weight:bold;cursor:pointer;background-color:#1e5799;border:1px solid #eee}.tx-powermail .powermail_fieldset .powermail_field.powermail_reset{background-color:#ffca4b}.tx-powermail .powermail_fieldset .powermail_field.powermail_captcha{width:100%}.tx-powermail .powermail_fieldset .powermail_captchaimage{width:100%;margin-top:10px}.tx-powermail .powermail_fieldset .powermail_fieldwrap_radio legend,.tx-powermail .powermail_fieldset .powermail_fieldwrap_check legend{padding:0}.tx-powermail .powermail_fieldset .powermail_fieldwrap_radio fieldset,.tx-powermail .powermail_fieldset .powermail_fieldwrap_check fieldset{border:0;padding:0;margin:0}.tx-powermail .powermail_fieldset .powermail_radio_outer,.tx-powermail .powermail_fieldset .powermail_captcha_outer,.tx-powermail .powermail_fieldset .powermail_check_outer,.tx-powermail .powermail_fieldset .powermail_fieldwrap_text,.tx-powermail .powermail_fieldset .powermail_fieldwrap_file_inner ul{background-color:white;border:1px solid #bbb;float:right;padding:3px;width:400px;list-style:none;margin:0}.tx-powermail .powermail_fieldset .powermail_radio_outer>li,.tx-powermail .powermail_fieldset .powermail_captcha_outer>li,.tx-powermail .powermail_fieldset .powermail_check_outer>li,.tx-powermail .powermail_fieldset .powermail_fieldwrap_text>li,.tx-powermail .powermail_fieldset .powermail_fieldwrap_file_inner ul>li{margin:5px}.tx-powermail .powermail_fieldset .powermail_radio_outer>li .deleteAllFiles,.tx-powermail .powermail_fieldset .powermail_captcha_outer>li .deleteAllFiles,.tx-powermail .powermail_fieldset .powermail_check_outer>li .deleteAllFiles,.tx-powermail .powermail_fieldset .powermail_fieldwrap_text>li .deleteAllFiles,.tx-powermail .powermail_fieldset .powermail_fieldwrap_file_inner ul>li .deleteAllFiles{color:#bbb;cursor:pointer}.tx-powermail .powermail_fieldset .powermail_radio_outer>li .deleteAllFiles:hover,.tx-powermail .powermail_fieldset .powermail_captcha_outer>li .deleteAllFiles:hover,.tx-powermail .powermail_fieldset .powermail_check_outer>li .deleteAllFiles:hover,.tx-powermail .powermail_fieldset .powermail_fieldwrap_text>li .deleteAllFiles:hover,.tx-powermail .powermail_fieldset .powermail_fieldwrap_file_inner ul>li .deleteAllFiles:hover{text-decoration:underline}.tx-powermail .powermail_fieldset .parsley-errors-list{display:none;margin:5px 0 20px 0;padding:0;list-style-type:none;background-color:#f2dede;border:1px solid #ebccd1;width:400px;float:right;clear:left}.tx-powermail .powermail_fieldset .parsley-errors-list.filled{display:block}.tx-powermail .powermail_fieldset .parsley-errors-list>li{color:#a94442;padding:5px 10px}.tx-powermail .powermail_fieldset .powermail_field_error,.tx-powermail .powermail_fieldset .parsley-error,.tx-powermail .powermail_fieldset .powermail_form .parsley-error:focus,.tx-powermail .powermail_fieldset div.error{background-color:#ebccd1;border:1px solid #a94442;color:#a94442}.tx-powermail .powermail_fieldset .powermail_field_error_container .parsley-errors-list{width:100%;margin-bottom:0;background-color:#ebccd1;border:none}.tx-powermail .powermail_fieldset .powermail_field_error_container .parsley-errors-list>li{padding-left:5px}.tx-powermail .powermail_create,.tx-powermail .powermail_confirmation{border:1px solid #bbb;padding:10px;margin:0 0 20px 0;background:#eee;overflow:hidden}.tx-powermail .powermail_create .powermail_confirmation_submit,.tx-powermail .powermail_create .powermail_confirmation_form,.tx-powermail .powermail_confirmation .powermail_confirmation_submit,.tx-powermail .powermail_confirmation .powermail_confirmation_form{margin:20px 0 0 0;padding:5px 20px;color:white;font-weight:bold;cursor:pointer;float:right;background-color:#1e5799;border:1px solid #eee}.tx-powermail .powermail_create .powermail_confirmation_form,.tx-powermail .powermail_confirmation .powermail_confirmation_form{float:left;clear:left;background-color:#bbb}.tx-powermail .powermail_progressbar{width:400px;height:5px;float:right;border:1px solid #EEEEEE;clear:both}.tx-powermail .powermail_progressbar.disable{display:none}.tx-powermail .powermail_progressbar>.powermail_progress{background:#1e5799;width:0%;max-width:100%;-webkit-animation:progress 5s 1 forwards;-moz-animation:progress 5s 1 forwards;-ms-animation:progress 5s 1 forwards;animation:progress 5s 1 forwards}.tx-powermail .powermail_progressbar>.powermail_progress>.powermail_progess_inner{height:5px;width:100%;overflow:hidden;background:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_loading.gif") repeat-x;-moz-opacity:0.25;-khtml-opacity:0.25;opacity:0.25;-ms-filter:progid:DXImageTransform.Microsoft.Alpha(Opacity=25);filter:progid:DXImageTransform.Microsoft.Alpha(opacity=25);filter:alpha(opacity=25)}.tx-powermail .powermail_confirmation .powermail_progressbar{width:100%}.tx-powermail .powermail_all>dt{width:200px;float:left;clear:left;font-weight:bold}.tx-powermail .powermail_all>dd{width:400px;float:left;margin:0}.tx-powermail .powermail_message{padding:5px 0 10px 20px;min-height:65px;background-color:#ebccd1;border:1px solid #a94442;background-position:98% 10px;background-repeat:no-repeat;list-style:circle}.tx-powermail .powermail_message li{padding:5px 50px 0 0}.tx-powermail .powermail_message.powermail_message_ok{background-image:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_ok.png");background-color:#cdeaca;border:1px solid #3b7826}.tx-powermail .powermail_message.powermail_message_ok li{color:#3b7826}.tx-powermail .powermail_message.powermail_message_error{background-image:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_error.png")}.tx-powermail .powermail_message.powermail_message_error li{color:#a94442}.tx-powermail .powermail_message.powermail_message_note{background-image:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_ok.png");background-color:#fcf8e3;border:1px solid #ffca4b}.tx-powermail .powermail_message.powermail_message_note li{color:#ffca4b}.tx-powermail .powermail_tabmenu{list-style:none;margin:0;padding:0}.tx-powermail .powermail_tabmenu>li{display:inline-block;padding:5px 10px;cursor:pointer;background:#eee;border-top:1px solid #bbb;border-left:1px solid #bbb;border-right:1px solid #bbb;color:#aaa}.tx-powermail .powermail_tabmenu>li.act{color:#444}.tx-powermail .powermail_tabmenu>li.parsley-error{background-color:#ebccd1}.tx-powermail .powermail_fieldset .powermail_tab_navigation{margin-top:2em}.tx-powermail .powermail_fieldset .powermail_tab_navigation .powermail_tab_navigation_next,.tx-powermail .powermail_fieldset .powermail_tab_navigation .powermail_tab_navigation_previous{background-color:#aaa;display:inline-block;padding:5px 30px;text-decoration:none;color:white;border:1px solid #bbb;font-weight:bold}.tx-powermail .powermail_fieldset .powermail_tab_navigation .powermail_tab_navigation_next{background-color:#1e5799;float:right}@-webkit-keyframes progress{to{width:100%}}@-moz-keyframes progress{to{width:100%}}@-ms-keyframes progress{to{width:100%}}@keyframes progress{to{width:100%}}.powermail_frontend{clear:left;margin:0 0 20px 0;background:#eee;overflow:auto}.powermail_frontend table.powermail_frontend_list{width:100%;font-size:0.8em;border:1px solid #444;margin-top:15px;border-spacing:0;border-collapse:separate}.powermail_frontend table.powermail_frontend_list tr th{color:white;font-weight:bold;padding:7px 3px;text-align:left;background:#444}.powermail_frontend table.powermail_frontend_list tr td{padding:3px}.powermail_frontend table.powermail_frontend_list tr:nth-child(even){background:#bbb}.powermail_frontend .powermail_frontend_filter{background:#bbb;padding:10px 0}.powermail_frontend .powermail_frontend_filter .powermail_frontend_search_container{padding:5px 10px;clear:both}.powermail_frontend .powermail_frontend_filter .powermail_frontend_search_container label{float:left;display:block;width:200px;padding-top:3px}.powermail_frontend .powermail_frontend_filter .powermail_frontend_search_container input{width:400px;padding:5px;float:right;border:none}.powermail_frontend .powermail_frontend_filter .powermail_frontend_search_container .powermail_frontend_search_submit{color:white;cursor:pointer;background:#1e5799;clear:both}.powermail_frontend .powermail_frontend_abc,.powermail_frontend .powermail_frontend_export{width:600px;margin:10px 0}.powermail_frontend .powermail_frontend_abc .powermail_frontend_abc_inner,.powermail_frontend .powermail_frontend_abc .powermail_frontend_export_inner,.powermail_frontend .powermail_frontend_export .powermail_frontend_abc_inner,.powermail_frontend .powermail_frontend_export .powermail_frontend_export_inner{margin:0 10px}.powermail_frontend .powermail_frontend_abc .powermail_frontend_abc_inner span.abc,.powermail_frontend .powermail_frontend_abc .powermail_frontend_abc_inner span.abc a,.powermail_frontend .powermail_frontend_abc .powermail_frontend_export_inner span.abc,.powermail_frontend .powermail_frontend_abc .powermail_frontend_export_inner span.abc a,.powermail_frontend .powermail_frontend_export .powermail_frontend_abc_inner span.abc,.powermail_frontend .powermail_frontend_export .powermail_frontend_abc_inner span.abc a,.powermail_frontend .powermail_frontend_export .powermail_frontend_export_inner span.abc,.powermail_frontend .powermail_frontend_export .powermail_frontend_export_inner span.abc a{font-weight:bold;text-decoration:none}.powermail_frontend .powermail_frontend_export{width:640px}.powermail_frontend .powermail_frontend_export input{width:17px;height:16px;padding-top:2px;cursor:pointer;text-indent:-99999px;border:0;background-repeat:no-repeat;background-image:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_csv.gif")}.powermail_frontend .powermail_frontend_export input.export_icon_xls{background-image:url("/typo3conf/ext/powermail/Resources/Public/Image/icon_xls.gif")}.powermail_frontend .powermail_frontend_export .powermail_frontend_export_icon{float:right;padding-top:5px;margin-left:5px;height:19px}.powermail_frontend dl{clear:both;padding:5px 10px}.powermail_frontend dl dt{float:left;width:150px;font-weight:bold;clear:left;margin-right:10px}.powermail_frontend dl dd{float:left}.powermail_frontend .powermail_frontend_back{margin:10px;display:inline-block;padding:5px 20px;background-color:#bbb;border:1px solid #eee;color:white;text-decoration:none}.xdsoft_datetimepicker{box-shadow:0px 5px 15px -5px rgba(0,0,0,0.506);background:white;border-bottom:1px solid #bbb;border-left:1px solid #bbb;border-right:1px solid #bbb;border-top:1px solid #bbb;color:#333333;font-family:"Helvetica Neue", "Helvetica", "Arial", sans-serif;padding:8px;padding-left:0px;padding-top:2px;position:absolute;z-index:9999;-moz-box-sizing:border-box;box-sizing:border-box;display:none}.xdsoft_datetimepicker iframe{position:absolute;left:0;top:0;width:75px;height:210px;background:transparent;border:none}.xdsoft_datetimepicker button{border:none !important}.xdsoft_noselect{-webkit-touch-callout:none;-webkit-user-select:none;-khtml-user-select:none;-moz-user-select:none;-ms-user-select:none;-o-user-select:none;user-select:none}.xdsoft_noselect::selection{background:transparent}.xdsoft_noselect::-moz-selection{background:transparent}.xdsoft_datetimepicker.xdsoft_inline{display:inline-block;position:static;box-shadow:none}.xdsoft_datetimepicker *{-moz-box-sizing:border-box;box-sizing:border-box;padding:0px;margin:0px}.xdsoft_datetimepicker .xdsoft_datepicker,.xdsoft_datetimepicker .xdsoft_timepicker{display:none}.xdsoft_datetimepicker .xdsoft_datepicker.active,.xdsoft_datetimepicker .xdsoft_timepicker.active{display:block}.xdsoft_datetimepicker .xdsoft_datepicker{width:224px;float:left;margin-left:8px}.xdsoft_datetimepicker .xdsoft_timepicker{width:58px;float:left;text-align:center;margin-left:8px;margin-top:0px}.xdsoft_datetimepicker .xdsoft_datepicker.active+.xdsoft_timepicker{margin-top:8px;margin-bottom:3px}.xdsoft_datetimepicker .xdsoft_mounthpicker{position:relative;text-align:center}.xdsoft_datetimepicker .xdsoft_prev,.xdsoft_datetimepicker .xdsoft_next,.xdsoft_datetimepicker .xdsoft_today_button{background-image:url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAFoAAAAeCAYAAACsYQl4AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA2ZpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuMy1jMDExIDY2LjE0NTY2MSwgMjAxMi8wMi8wNi0xNDo1NjoyNyAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDozQjRCQjRGREU4MkNFMzExQjRDQkIyRDJDOTdBRUI1MCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDpCQjg0OUYyNTZDODAxMUUzQjMwM0IwMERBNUU0ODQ5NSIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDpCQjg0OUYyNDZDODAxMUUzQjMwM0IwMERBNUU0ODQ5NSIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ1M2IChXaW5kb3dzKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOkI5NzE3MjFBN0E2Q0UzMTFBQjJEQjgzMDk5RTNBNTdBIiBzdFJlZjpkb2N1bWVudElEPSJ4bXAuZGlkOjNCNEJCNEZERTgyQ0UzMTFCNENCQjJEMkM5N0FFQjUwIi8+IDwvcmRmOkRlc2NyaXB0aW9uPiA8L3JkZjpSREY+IDwveDp4bXBtZXRhPiA8P3hwYWNrZXQgZW5kPSJyIj8+aQvATgAAAfVJREFUeNrsmr1OwzAQxzGtkPjYEAuvVGAvfQIGRKADE49gdLwDDwBiZ2RhQUKwICQkWLsgFiRQuIBTucFJ/XFp4+hO+quqnZ4uvzj2nV2RpukCW/22yAgYNINmc7du7DcghCjrkqgOKjF1znpt6rZ0AGWQj7TvCU8d9UM+QAGDrhdyc2Bnc1WVVPBev9V8lBnY+rDwncWZThG4xk4lmxtJy2AHgoY/FySgbSBPwPZ8mEXbQx3aDERb0EbYAYFC7pcAtAvkMWwC0D3NX58S9D/YnoGC7nPWr3Dg9JTbtuHhDShBT8D2CBSK/iIEvVXxpuxSgh7DdgwUTL4iA92zmJb6lKB/YTsECmV+IgK947AGDIqgQ/LojsO135Hn51l2cWlov0JdGNrPUceueXRwilSVgkUyom9Rd6gbLfYTDeO+1v6orn0InTogYDGUkYLO3/wc9BdqqTCKP1Tfi+oTIaCBIL2TES+GTyruT9S61p6BHam+99DFEAgLFklYsIBHwSI9QY80H5ta+1rB/6ovaKihBJeEJbgLbBlQgl+j3lDPqA2tfQV1j3pVn8s+oKHGTSVJ+FqDLeR5bCqJ2E/BCycsoLZETXaKGs7rhKVt+9HZScrZNMi88V8P7LlDbvOZYaJVpMMmBCT4n0o8dTBoNgbdWPsRYACs3r7XyNfbnAAAAABJRU5ErkJggg==")}.xdsoft_datetimepicker .xdsoft_prev{float:left;background-position:-20px 0px}.xdsoft_datetimepicker .xdsoft_today_button{float:left;background-position:-70px 0px;margin-left:5px}.xdsoft_datetimepicker .xdsoft_next{float:right;background-position:0px 0px}.xdsoft_datetimepicker .xdsoft_next,.xdsoft_datetimepicker .xdsoft_prev,.xdsoft_datetimepicker .xdsoft_today_button{background-color:transparent;background-repeat:no-repeat;border:0px none currentColor;cursor:pointer;display:block;height:30px;opacity:0.5;outline:medium none currentColor;overflow:hidden;padding:0px;position:relative;text-indent:100%;white-space:nowrap;width:20px}.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_prev,.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_next{float:none;background-position:-40px -15px;height:15px;width:30px;display:block;margin-left:14px;margin-top:7px}.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_prev{background-position:-40px 0px;margin-bottom:7px;margin-top:0px}.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box{height:151px;overflow:hidden;border-bottom:1px solid #eee}.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box>div>div{background:white;border-top:1px solid #eee;color:#444;font-size:12px;text-align:center;border-collapse:collapse;cursor:pointer;border-bottom-width:0px;height:25px;line-height:25px}.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box>div>div:first-child{border-top-width:0px}.xdsoft_datetimepicker .xdsoft_today_button:hover,.xdsoft_datetimepicker .xdsoft_next:hover,.xdsoft_datetimepicker .xdsoft_prev:hover{opacity:1}.xdsoft_datetimepicker .xdsoft_label{display:inline;position:relative;z-index:9999;margin:0;padding:5px 3px;font-size:14px;line-height:20px;font-weight:bold;background-color:#fff;float:left;width:182px;text-align:center;cursor:pointer}.xdsoft_datetimepicker .xdsoft_label:hover{text-decoration:underline}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select{border:1px solid #ccc;position:absolute;right:0px;top:30px;z-index:101;display:none;background:#fff;max-height:160px;overflow-y:hidden}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select.xdsoft_monthselect{right:-7px}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select.xdsoft_yearselect{right:2px}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select>div>.xdsoft_option:hover{color:#fff;background:#a94442}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select>div>.xdsoft_option{padding:2px 10px 2px 5px}.xdsoft_datetimepicker .xdsoft_label>.xdsoft_select>div>.xdsoft_option.xdsoft_current{background:#1e5799;box-shadow:#1e5799 0px 1px 3px 0px inset;color:#fff;font-weight:700}.xdsoft_datetimepicker .xdsoft_month{width:90px;text-align:right}.xdsoft_datetimepicker .xdsoft_calendar{clear:both}.xdsoft_datetimepicker .xdsoft_year{width:56px}.xdsoft_datetimepicker .xdsoft_calendar table{border-collapse:collapse;width:100%}.xdsoft_datetimepicker .xdsoft_calendar td>div{padding-right:5px}.xdsoft_datetimepicker .xdsoft_calendar th{height:25px}.xdsoft_datetimepicker .xdsoft_calendar td,.xdsoft_datetimepicker .xdsoft_calendar th{width:14.2857142%;background:#F5F5F5;border:1px solid #DDDDDD;color:#666666;font-size:12px;text-align:right;padding:0px;border-collapse:collapse;cursor:pointer;height:25px}.xdsoft_datetimepicker .xdsoft_calendar th{background:#F1F1F1}.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_today{color:#1e5799}.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_default,.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_current,.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box>div>div.xdsoft_current{background:#1e5799;box-shadow:#1e5799 0px 1px 3px 0px inset;color:#fff;font-weight:700}.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_other_month,.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_disabled,.xdsoft_datetimepicker .xdsoft_time_box>div>div.xdsoft_disabled{opacity:0.5}.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_other_month.xdsoft_disabled{opacity:0.2}.xdsoft_datetimepicker .xdsoft_calendar td:hover,.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box>div>div:hover{color:#fff !important;background:#a94442 !important;box-shadow:none !important}.xdsoft_datetimepicker .xdsoft_calendar td.xdsoft_disabled:hover,.xdsoft_datetimepicker .xdsoft_timepicker .xdsoft_time_box>div>div.xdsoft_disabled:hover{color:inherit !important;background:inherit !important;box-shadow:inherit !important}.xdsoft_datetimepicker .xdsoft_calendar th{font-weight:700;text-align:center;color:#999;cursor:default}.xdsoft_datetimepicker .xdsoft_copyright{color:#ccc !important;font-size:10px;clear:both;float:none;margin-left:8px}.xdsoft_datetimepicker .xdsoft_copyright a{color:#eee !important}.xdsoft_datetimepicker .xdsoft_copyright a:hover{color:#aaa !important}.xdsoft_time_box{position:relative;border:1px solid #ccc}.xdsoft_scrollbar>.xdsoft_scroller{background:#ccc !important;height:20px;border-radius:3px}.xdsoft_scrollbar{position:absolute;width:7px;right:0px;top:0px;bottom:0px;cursor:pointer}.xdsoft_scroller_box{position:relative}
| |
- |
| |
- | /* Next Section XXX */
| |
- |
| |
- | a,abbr,acronym,address,applet,article,aside,audio,b,big,blockquote,body,canvas,caption,center,cite,code,dd,del,details,dfn,dialog,div,dl,dt,em,embed,fieldset,figcaption,figure,font,footer,form,h1,h2,h3,h4,h5,h6,header,hgroup,hr,html,i,iframe,img,ins,kbd,label,legend,li,mark,menu,meter,nav,object,ol,output,p,pre,progress,q,rp,rt,ruby,s,samp,section,small,span,strike,strong,sub,summary,sup,table,tbody,td,tfoot,th,thead,time,tr,tt,u,ul,var,video,xmp{border:0;margin:0;padding:0;font-size:100%}html,body{height:100%}article,aside,details,figcaption,figure,footer,header,hgroup,menu,nav,section{display:block}b,strong{font-weight:bold}img{color:transparent;font-size:0;vertical-align:middle;-ms-interpolation-mode:bicubic}ol,ul{list-style:none}li{display:list-item}table{border-collapse:collapse;border-spacing:0}th,td,caption{font-weight:normal;vertical-align:top;text-align:left}q{quotes:none}q:before,q:after{content:'';content:none}sub,sup,small{font-size:75%}sub,sup{line-height:0;position:relative;vertical-align:baseline}sub{bottom:-0.25em}sup{top:-0.5em}svg{overflow:hidden}
| |
- |
| |
- | /* Text */
| |
- | /*
| |
- | 960 Grid System ~ Text CSS.
| |
- | Learn more ~ http://960.gs/
| |
- |
| |
- | Licensed under GPL and MIT.
| |
- | */
| |
- |
| |
- | /* `Basic HTML
| |
- | ----------------------------------------------------------------------------------------------------*/
| |
- |
| |
- | body {
| |
- | font: 11px/1.5 Arial, 'Liberation Sans', FreeSans, sans-serif;
| |
- | }
| |
- |
| |
- | pre,
| |
- | code {
| |
- | font-family: 'DejaVu Sans Mono', Menlo, Consolas, monospace;
| |
- | }
| |
- |
| |
- | hr {
| |
- | border: 0 #58585a solid;
| |
- | border-top-width: 1px;
| |
- | clear: both;
| |
- | height: 0;
| |
- | }
| |
- |
| |
- | /* `Headings
| |
- | ----------------------------------------------------------------------------------------------------*/
| |
- |
| |
- | h1 {
| |
- | font-size: 18px;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | h2 {
| |
- | font-size: 18px;
| |
- | font-weight: bold;
| |
- | color: #58585a;
| |
- | }
| |
- |
| |
- | h3 {
| |
- | font-size: 15px;
| |
- | font-weight: normal;
| |
- | color: #58585a;
| |
- | }
| |
- |
| |
- | h4 {
| |
- | font-size: 14px;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | h5 {
| |
- | font-size: 13px;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | h6 {
| |
- | font-size: 12px;
| |
- | font-weight: bold;
| |
- | }
| |
- |
| |
- | /* `Spacing
| |
- | ----------------------------------------------------------------------------------------------------*/
| |
- |
| |
- | ol {
| |
- | list-style: decimal;
| |
- | }
| |
- |
| |
- | ul {
| |
- | list-style: disc;
| |
- | color:#04378b;
| |
- | }
| |
- |
| |
- | li {
| |
- | margin-left: 30px;
| |
- | }
| |
- |
| |
- | p,
| |
- | dl,
| |
- | hr,
| |
- | h1,
| |
- | h2,
| |
- | h3,
| |
- | h4,
| |
- | h5,
| |
- | h6,
| |
- | ol,
| |
- | ul,
| |
- | pre,
| |
- | table,
| |
- | address,
| |
- | fieldset,
| |
- | figure {
| |
- | margin-bottom: 20px;
| |
- | }
| |
- |
| |
- | body{min-width:960px}.container_24{margin-left:auto;margin-right:auto;width:960px}.grid_1,.grid_2,.grid_3,.grid_4,.grid_5,.grid_6,.grid_7,.grid_8,.grid_9,.grid_10,.grid_11,.grid_12,.grid_13,.grid_14,.grid_15,.grid_16,.grid_17,.grid_18,.grid_19,.grid_20,.grid_21,.grid_22,.grid_23,.grid_24{display:inline;float:left;margin-left:5px;margin-right:5px}.push_1,.pull_1,.push_2,.pull_2,.push_3,.pull_3,.push_4,.pull_4,.push_5,.pull_5,.push_6,.pull_6,.push_7,.pull_7,.push_8,.pull_8,.push_9,.pull_9,.push_10,.pull_10,.push_11,.pull_11,.push_12,.pull_12,.push_13,.pull_13,.push_14,.pull_14,.push_15,.pull_15,.push_16,.pull_16,.push_17,.pull_17,.push_18,.pull_18,.push_19,.pull_19,.push_20,.pull_20,.push_21,.pull_21,.push_22,.pull_22,.push_23,.pull_23{position:relative}.alpha{margin-left:0}.omega{margin-right:0}.container_24 .grid_1{width:30px}.container_24 .grid_2{width:70px}.container_24 .grid_3{width:110px}.container_24 .grid_4{width:150px}.container_24 .grid_5{width:190px}.container_24 .grid_6{width:230px}.container_24 .grid_7{width:270px}.container_24 .grid_8{width:310px}.container_24 .grid_9{width:350px}.container_24 .grid_10{width:390px}.container_24 .grid_11{width:430px}.container_24 .grid_12{width:470px}.container_24 .grid_13{width:510px}.container_24 .grid_14{width:550px}.container_24 .grid_15{width:590px}.container_24 .grid_16{width:630px}.container_24 .grid_17{width:670px}.container_24 .grid_18{width:710px}.container_24 .grid_19{width:750px}.container_24 .grid_20{width:790px}.container_24 .grid_21{width:830px}.container_24 .grid_22{width:870px}.container_24 .grid_23{width:910px}.container_24 .grid_24{width:950px}.container_24 .prefix_1{padding-left:40px}.container_24 .prefix_2{padding-left:80px}.container_24 .prefix_3{padding-left:120px}.container_24 .prefix_4{padding-left:160px}.container_24 .prefix_5{padding-left:200px}.container_24 .prefix_6{padding-left:240px}.container_24 .prefix_7{padding-left:280px}.container_24 .prefix_8{padding-left:320px}.container_24 .prefix_9{padding-left:360px}.container_24 .prefix_10{padding-left:400px}.container_24 .prefix_11{padding-left:440px}.container_24 .prefix_12{padding-left:480px}.container_24 .prefix_13{padding-left:520px}.container_24 .prefix_14{padding-left:560px}.container_24 .prefix_15{padding-left:600px}.container_24 .prefix_16{padding-left:640px}.container_24 .prefix_17{padding-left:680px}.container_24 .prefix_18{padding-left:720px}.container_24 .prefix_19{padding-left:760px}.container_24 .prefix_20{padding-left:800px}.container_24 .prefix_21{padding-left:840px}.container_24 .prefix_22{padding-left:880px}.container_24 .prefix_23{padding-left:920px}.container_24 .suffix_1{padding-right:40px}.container_24 .suffix_2{padding-right:80px}.container_24 .suffix_3{padding-right:120px}.container_24 .suffix_4{padding-right:160px}.container_24 .suffix_5{padding-right:200px}.container_24 .suffix_6{padding-right:240px}.container_24 .suffix_7{padding-right:280px}.container_24 .suffix_8{padding-right:320px}.container_24 .suffix_9{padding-right:360px}.container_24 .suffix_10{padding-right:400px}.container_24 .suffix_11{padding-right:440px}.container_24 .suffix_12{padding-right:480px}.container_24 .suffix_13{padding-right:520px}.container_24 .suffix_14{padding-right:560px}.container_24 .suffix_15{padding-right:600px}.container_24 .suffix_16{padding-right:640px}.container_24 .suffix_17{padding-right:680px}.container_24 .suffix_18{padding-right:720px}.container_24 .suffix_19{padding-right:760px}.container_24 .suffix_20{padding-right:800px}.container_24 .suffix_21{padding-right:840px}.container_24 .suffix_22{padding-right:880px}.container_24 .suffix_23{padding-right:920px}.container_24 .push_1{left:40px}.container_24 .push_2{left:80px}.container_24 .push_3{left:120px}.container_24 .push_4{left:160px}.container_24 .push_5{left:200px}.container_24 .push_6{left:240px}.container_24 .push_7{left:280px}.container_24 .push_8{left:320px}.container_24 .push_9{left:360px}.container_24 .push_10{left:400px}.container_24 .push_11{left:440px}.container_24 .push_12{left:480px}.container_24 .push_13{left:520px}.container_24 .push_14{left:560px}.container_24 .push_15{left:600px}.container_24 .push_16{left:640px}.container_24 .push_17{left:680px}.container_24 .push_18{left:720px}.container_24 .push_19{left:760px}.container_24 .push_20{left:800px}.container_24 .push_21{left:840px}.container_24 .push_22{left:880px}.container_24 .push_23{left:920px}.container_24 .pull_1{left:-40px}.container_24 .pull_2{left:-80px}.container_24 .pull_3{left:-120px}.container_24 .pull_4{left:-160px}.container_24 .pull_5{left:-200px}.container_24 .pull_6{left:-240px}.container_24 .pull_7{left:-280px}.container_24 .pull_8{left:-320px}.container_24 .pull_9{left:-360px}.container_24 .pull_10{left:-400px}.container_24 .pull_11{left:-440px}.container_24 .pull_12{left:-480px}.container_24 .pull_13{left:-520px}.container_24 .pull_14{left:-560px}.container_24 .pull_15{left:-600px}.container_24 .pull_16{left:-640px}.container_24 .pull_17{left:-680px}.container_24 .pull_18{left:-720px}.container_24 .pull_19{left:-760px}.container_24 .pull_20{left:-800px}.container_24 .pull_21{left:-840px}.container_24 .pull_22{left:-880px}.container_24 .pull_23{left:-920px}.clear{clear:both;display:block;overflow:hidden;visibility:hidden;width:0;height:0}.clearfix:before,.clearfix:after,.container_24:before,.container_24:after{content:'.';display:block;overflow:hidden;visibility:hidden;font-size:0;line-height:0;width:0;height:0}.clearfix:after,.container_24:after{clear:both}.clearfix,.container_24{zoom:1}
| |
- |
| |
- | /*
| |
- | @import url(http://fonts.googleapis.com/css?family=Open+Sans:400,600,700,600italic,400italic,700italic);
| |
- |
| |
- |
| |
- | hellrot #fc0110
| |
- | dunkelrot #9c1006
| |
- | hellgrau #b2b2b2
| |
- | dunkelgrau #333
| |
- | orang #ffa800
| |
- |
| |
- |
| |
- | */
| |
- |
| |
- |
| |
- |
| |
- | html,body {margin:0;padding:0;}
| |
- | body {font-family:/* Tahoma,*/ Arial, sans-serif; background-color:#fff;color:#333; /*background: url(../images/vibations_final.png) no-repeat fixed;
| |
- | /*-ms-filter:"progid:DXImageTransform.Microsoft.AlphaImageLoader(src='../images/vibations_final.jpg.jpg',sizingMethod='scale')";*/
| |
- | -webkit-background-size: cover;
| |
- | -moz-background-size: cover;
| |
- | -o-background-size: cover;
| |
- | background-size: cover;
| |
- | background-position: 50%;
| |
- | height:100%;}
| |
- | a {margin-bottom:0px;text-decoration:none;color:#333;}
| |
- | a:hover{color:#fc0110;}
| |
- | p {font-size:14px;margin-bottom:10px;}
| |
- | h1 {font-size:16px;margin-bottom:10px;}
| |
- | h2 {font-size:14px;margin-bottom:10px;}
| |
- | h3 {font-size:14px;margin-bottom:10px;}
| |
- | h4 {font-size:14px;margin-bottom:10px;}
| |
- | .container_24 {margin-left: auto; margin-right: auto; width: 960px !important;}
| |
- | img {color: transparent; font-size: 0; margin-bottom: 0; vertical-align: middle;}
| |
- |
| |
- | .csc-textpic-image {margin-bottom: 0px;}
| |
- | .csc-textpic-imagewrap{margin-right:5px !important;margin-bottom:14px;}
| |
- | .csc-textpic-text {margin-bottom:10px;}
| |
- | .csc-textpic {margin-top:20px;}
| |
- | #c19 .csc-textpic {margin-top:0px;}
| |
- |
| |
- | #allWrap {height:100%;margin-bottom:0px !important; position: relative;}
| |
- |
| |
- | #headerBG{width:auto;height:auto;background-color:#555;border-bottom:4px solid #fc0110;padding-top: 24px;margin-bottom: 20px;}
| |
- | #headerWrap{background-color: none;}
| |
- | #logo{height:101px;padding-top:5px;}
| |
- | #claim{height:70px;text-align:right;}
| |
- | #claim p {/*padding:10px 5px;margin:5px 0;*/color:#fff;font-size:14px;line-height:18px;text-transform:uppercase;font-weight:bold;letter-spacing:0.2px;}
| |
- | #topBar{width: 100%;}
| |
- | #topBar ul {float:right;}
| |
- | #topBar ul li {float:left;margin-left:13px;list-style:none;}
| |
- | #topBar ul li.active a{color:#fff;}
| |
- | #topBar ul li a {font-size:17px !important;color:#c3c3c3;font-weight:bold;}
| |
- | #topBar ul li a:hover {color:#fff;}
| |
- | #searchBar.grid_6 {height:31px;}
| |
- | #searchBar {height:31px;}
| |
- | #searchBar form { position: relative; top:5px;left:0px;}
| |
- | #searchBar input[type="text"] {border: 1px solid #999; box-sizing: content-box;color: #999; padding-left:20px;width:208px;}
| |
- | #searchBar input[type="submit"] {font-size: 0em;background: url('../images/suchen.jpg') no-repeat; width: 14px;height: 14px;border: none;left: 3px;top:3px;position:absolute;cursor: pointer;}
| |
- |
| |
- | #topWrap{background-color: #fff;}
| |
- | #mainMenu{background-color:none;position:relative;float:left;z-index:10;height:31px;}
| |
- | #mainMenu ul.tabs {height: auto;list-style:none;margin: 0 auto;display: block;position: relative;}
| |
- | #mainMenu ul.tabs > li {z-index: 50;margin: 0;display: block;position: relative;float:left;}
| |
- | #mainMenu ul.tabs > li:hover {color:#fc0110;}
| |
- | #mainMenu ul.tabs > li.first{margin-left:0px !important;}
| |
- | #mainMenu ul.tabs > li.first a{padding:3px 17px 4px 17px !important;}
| |
- | #mainMenu ul.tabs > li.active {margin-top: 0px;z-index: 70;}
| |
- |
| |
- | #mainMenu ul.tabs > li a {color: #333;font-size:16px;background-color:#fff;padding: 3px 8px 4px;display:block;}
| |
- | #mainMenu ul.tabs > li:hover a,
| |
- | #mainMenu ul.tabs > li.active a {color: #fff;background-color:#fc0110; }
| |
- |
| |
- | #mainMenu ul.tabs > li.last{float:right;margin-right:0px !important;}
| |
- | #mainMenu ul.tabs > li.last a{padding:3px 13px 4px 17px !important;}
| |
- | .tabLeft {display:none;}
| |
- | .tabRight{display:none;}
| |
- | .tabContent {}
| |
- |
| |
- |
| |
- | #space{background-color:red;}
| |
- |
| |
- | #slider{
| |
- |
| |
- | height:300px;background-color:#333;overflow: hidden;position: relative;margin-left: 5px;border:none;border-radius: 0;
| |
- | box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -webkit-box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-border-radius: 15px;
| |
- | border-radius: 15px;
| |
- | margin-top: 3px;
| |
- | }
| |
- | #slider li {margin: 0;}
| |
- | #slider .flex-control-nav {background-color:transparent; bottom: 20px; right: 20px; width: auto;}
| |
- | #slider .flex-control-nav li {margin-left: 7px;}
| |
- | #slider .flex-control-paging li a {border-radius:0px;background-color: #333;box-shadow: none; border: none; height: 10px; width: 10px; font-weight: bold; color: #fff; font-size: 105%;position:relative;z-index:1000;}
| |
- | #slider .flex-control-paging li a.flex-active {background-color: #999; border: none; color: #333;}
| |
- | #slider ul.slides {margin:0;}
| |
- | #slider ul.slides li {margin:0;list-style: none;display: none;}
| |
- | #slider ul.slides li:first-child {display: block;}
| |
- | #slider .flex-direction-nav a {position:absolute; background-image: url(https://static.igem.org/mediawiki/parts/c/c2/TUD_navigation.png);height:32px;margin-top:-10px;}
| |
- | #slider .flex-direction-nav .flex-prev {opacity: 1;left: 5px;}
| |
- | #slider .flex-direction-nav .flex-prev:hover {background-position: 0 100%; opacity: 1;left: 5px;}
| |
- | #slider .flex-direction-nav .flex-next {background-position: 100% 0;opacity: 1;right: 5px;}
| |
- | #slider .flex-direction-nav .flex-next:hover {background-position: 100% 100%;opacity: 1;right: 5px;}
| |
- | #slider .flex-control-nav {display:block;}
| |
- | #slider .flex-control-paging li{}
| |
- | #slider .flex-control-paging .flex-active{background-color:#777;}
| |
- | #slider .flex-control-paging li a:hover{background-color:#fc0110;}
| |
- |
| |
- |
| |
- | #promoWrap{
| |
- | background-color:#999;
| |
- | height:305px;
| |
- | box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -webkit-box-shadow: 0px 0px 6px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-border-radius: 15px;
| |
- | border-radius: 15px;
| |
- |
| |
- | }
| |
- | #promoWrap a p {text-align: center; font-weight: bold;}
| |
- | #promoWrap a {padding:10px 0;}
| |
- | #promoWrap a:hover {text-decoration: none;}
| |
- | #promoWrap h1 {margin-bottom:10px;margin-top:10px;padding:0px 10px;text-align:center;}
| |
- |
| |
- | /*#promoWrap a h1 {margin-bottom:10px;margin-top:10px;padding:0px 10px;text-align:center;}*/
| |
- | #promoWrap a h1 {
| |
- | margin-bottom: 0px;
| |
- | margin-top: 0px;
| |
- | padding: 20px 10px 10px 10px;
| |
- | text-align: center;
| |
- | color:lightblue;
| |
- | }
| |
- |
| |
- | .grid_6.promo1,.grid_6.promo2,.grid_6.promo3 {
| |
- |
| |
- | height: 100px;
| |
- | border: 1px solid transparent;
| |
- | margin-left:0;margin-right:0;height:100px !important;color:#333;
| |
- | -moz-border-radius: 15px;
| |
- | border-radius: 15px;
| |
- | text-align: center;
| |
- | }
| |
- |
| |
- |
| |
- | .grid_6.promo1:hover, .grid_6.promo2:hover, .grid_6.promo3:hover {
| |
- | background-color:grey; opacity: 0.4; margin-left:0;margin-right:0;
| |
- | height:100px !important;color: #FC0110;
| |
- | box-shadow: 0px 0px 1px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-box-shadow: 0px 0px 1px 1px rgba(119, 119, 119, 0.6);
| |
- | -webkit-box-shadow: 0px 1px 1px 1px rgba(119, 119, 119, 0.6);
| |
- | -moz-border-radius: 15px;
| |
- | border-radius: 15px;
| |
- | }
| |
- |
| |
- | .grid_6.promo1:hover a, .grid_6.promo2:hover a, .grid_6.promo3:hover a {
| |
- | color:#fc0110;
| |
- | text-decoration: none;
| |
- | }
| |
- | */
| |
- |
| |
- |
| |
- |
| |
- | #contentWrap{background-color: #fff;margin-top: 20px;}
| |
- | #breadcrumbs{height:30px;background-color:none;color:#333;font-size:12px;margin-bottom:15px;}
| |
- | #breadcrumbs p{color:#333;font-size:12px;font-weight:bold;padding:6px 5px;margin-bottom:0;}
| |
- | #breadcrumbs a{color:#333;font-size:12px;font-weight:normal;margin-bottom:0;}
| |
- | #breadcrumbs a:hover{color:#fc0110;font-size:12px;}
| |
- |
| |
- | #leftNavi{height:auto;background-color:none;}
| |
- | #leftNavi .menuTitle {font-size: 16px;color:#333;font-weight:bold;}
| |
- | #leftNavi ul.menu{margin-left:0px;font-weight:normal;margin-bottom:15px;padding:0px 5px;list-style:none;font-size: 16px;color:#333;}
| |
- | #leftNavi ul.menu li ul.menu2 li a{font-weight:normal; margin-bottom:0px;padding:0px 5px;
| |
- | list-style:none;font-size: 14px;color:#444;}
| |
- | #leftNavi ul.menu li ul.menu2 li.active a{font-weight:bold; margin-bottom:0px;padding:0px 5px;
| |
- | list-style:none;font-size: 14px;color:#444;}
| |
- | #leftNavi ul.menu > li {margin-left:0px;}
| |
- | #leftNavi ul.menu li a{margin-left:0px;font-size:16px;display:block;}
| |
- |
| |
- | #leftNavi nav {padding-bottom: 10px;background-color:none;}
| |
- | #leftNavi nav > ul {font-size: 14px;margin-top:0px;list-style:none;}
| |
- | #leftNavi nav > ul a {color: #333;}
| |
- | #leftNavi nav > ul a:hover {color: #fc0110;}
| |
- | #leftNavi nav > ul > li {padding: 3px 5px;margin-left:0px;border-bottom:1px solid #c3c3c3;}
| |
- | #leftNavi nav > ul > li.last{border-bottom:1px solid #c3c3c3;}
| |
- | #leftNavi nav > ul > li.active {padding-top:0px;list-style-type:none;font-weight:bold;color:#fc0110; }
| |
- | #leftNavi nav > ul > li.active:first-child { text-decoration:none;}
| |
- | #leftNavi nav > ul > li.active > a {font-weight: bold;font-size:16px;color:#fc0110;}
| |
- | #leftNavi ul.menu2 {margin-bottom:10px;}
| |
- | #leftNavi nav > ul > li.active + li {}
| |
- | #leftNavi nav ul ul li {padding-left: 5px;padding-top:3px;list-style:none;font-size:14px;
| |
- | margin-left:0px;}
| |
- | #leftNavi ul.menu li ul.menu2 li a:hover {color:#fc0110;}
| |
- | #leftNavi nav ul ul li.active a {color: #fc0110 !important;}
| |
- |
| |
- | #leftNavi ul.menu3 li{color:#777;}
| |
- | #leftNavi ul.menu3 li.active {color:#fc0110 !important;}
| |
- | #leftNavi ul.menu li ul.menu2 li ul.menu3 a{font-weight:normal; margin-bottom:0px;padding:2px 0 0 10px;
| |
- | list-style:none;font-size: 13px;color:#777;}
| |
- | #leftNavi ul.menu3 {margin-bottom:5px;}
| |
- | #leftNavi ul.menu li ul.menu2 li ul.menu3 li a {color:#777 !important;line-height:15px;margin-bottom:4px;}
| |
- | #leftNavi ul.menu li ul.menu2 li ul.menu3 li a:hover {color:#fc0110 !important;}
| |
- | #leftNavi ul.menu li ul.menu2 li ul.menu3 li.active a{color:#fc0110 !important;}
| |
- | }
| |
- |
| |
- | #wikicontent{height:auto;background-color:none;padding:0px 5px;width:740px;margin-bottom:30px;color:#333 ;}
| |
- | #content h1{color:#fc0110;}
| |
- | #content p {text-align:justify;}
| |
- | #content a {color:#666;}
| |
- | #content a:hover {color:#fc0110;}
| |
- |
| |
- |
| |
- | #c276 img { color: transparent; font-size: 0; width:100%;height: 100%; vertical-align: middle;margin-bottom:20px;}
| |
- | #c276 h1 {font-size: 14px;margin-bottom: 10px;color:#c3c3c3;font-weight:normal;text-align:left;}
| |
- | #c276 .banner {width: 27%;float: left;text-align: center;height: auto;padding: 0 20px;}
| |
- | #c276 .tx-sf-banners {padding: 0 5px;width: 730px;}
| |
- |
| |
- | #c274 img { color: transparent; font-size: 0; width:100%;height: 100%; vertical-align: middle;margin-bottom:20px;}
| |
- | #c274 h1 {font-size: 14px;margin-bottom: 10px;color:#c3c3c3;font-weight:normal;text-align:left;}
| |
- | #c274 .banner {width: 27%;float: left;text-align: center;height: auto;padding: 0 20px;}
| |
- | #c274 .tx-sf-banners {padding: 0 5px;width: 730px;}
| |
- |
| |
- | #c268 img { color: transparent; font-size: 0; width:100%;height: 100%; vertical-align: middle;margin-bottom:20px;}
| |
- | #c268 h1 {font-size: 14px;margin-bottom: 10px;color:#c3c3c3;font-weight:normal;text-align:left;}
| |
- | #c268 .banner {width: 27%;float: left;text-align: center;height: auto;padding: 0 20px;}
| |
- | #c268 .tx-sf-banners {padding: 0 5px;width: 730px;}
| |
- |
| |
- | #c45 img { color: transparent; font-size: 0; width:100%;height: 100%; vertical-align: middle;margin-bottom:20px;}
| |
- | #c45 h1 {font-size: 14px;margin-bottom: 10px;color:#c3c3c3;font-weight:normal;text-align:left;}
| |
- | #c45 .banner {width: 27%;float: left;text-align: center;height: auto;padding: 0 20px;}
| |
- | #c45 .tx-sf-banners {padding: 0 5px;width: 730px;}
| |
- |
| |
- | .csc-textpic .csc-textpic-imagewrap img {border: medium none;display: block; height: auto; max-width: 740px;
| |
- |
| |
- |
| |
- | }
| |
- |
| |
- | #news {
| |
- | /*background-color:#999;*/
| |
- | height:auto;
| |
- | min-height:300px;
| |
- | float:right;
| |
- | text-align:right;
| |
- | padding-bottom:5px;
| |
- | margin-bottom:20px;
| |
- | }
| |
- | #news .menuTitle {
| |
- | font-size: 16px;
| |
- | padding:0 10px;
| |
- | color:#fc0110;
| |
- | font-weight:bold;
| |
- | margin-bottom:10px;
| |
- | }
| |
- | .latest-news {padding:0 5px}
| |
- | .latest-news p{font-size:12px;margin-bottom:3px;}
| |
- | .news-list-item {float:none; border-top:1px solid #999;padding-top:10px;padding-right:5px;margin-top:10px;}
| |
- | .news-list-item:first-child {border-top: none;padding-top:0px;}
| |
- | #c27 .news-list-item {text-align:justify;}
| |
- | .news-readmore {}
| |
- | .news-title a{color:#333;}
| |
- | .news-title a:hover{color:#333 !important;}
| |
- | .news-text {font-size:14px !important;position:relative;top:4px;}
| |
- | .news-text a{color:#333;}
| |
- | .news-text a:hover{color:#333 !important;}
| |
- | .news-readmore a{color:#333;font-size:11px;}
| |
- | .news-readmore a:hover{color:#fc0110;}
| |
- | .news-date {color:#333;}
| |
- | #news .further {color:#333;font-weight:bold;padding-right:10px;}
| |
- | #news a:hover {color:#fc0110;}
| |
- | #news h4 {font-size: 14px;margin-bottom:0px;}
| |
- |
| |
- | #c28 h1.csc-firstHeader {display:none;}
| |
- | #c28 .news-single-item .news-title {color:#fc0110 !important;font-weight:bold;margin-bottom:10px;font-size:16px;}
| |
- |
| |
- | #c18 .news-list-item {padding-right:0px !important;font-size:11px; color:#333;}
| |
- | .news-list-container {padding: 0px 0;margin-bottom:20px;}
| |
- | .news-list-date {color:#333;;font-size:11px !important;}
| |
- | .news-list-item h2 a{font-size:14px; color:#333 !important;font-weight:bold;}
| |
- | .news-list-item h2 a:hover{font-size:14px; color:#fc0110 !important;font-weight:bold;}
| |
- |
| |
- | .news-single-item{padding:0px !important;}
| |
- | .news-single-date {margin-top:5px;font-size:11px !important;color:#333 !important;float:right;}
| |
- | .news-title {font-size:14px;font-weight:bold;color:#333 !important;}
| |
- | .news-sub h2 {font-size:13px !important; color:#333 !important;}
| |
- | .news-sub a:hover {color:#333;}
| |
- |
| |
- | .news-single-backlink {padding:10px 0px;color:#333 !important;font-size:11px !important;}
| |
- | .news-single-backlink a{color:#333 !important;font-size:11px !important;}
| |
- | .news-single-backlink a:hover{color:#e30613 !important;}
| |
- | .news-more{position:relative;top:10px;}
| |
- | .news-more a{color:#333 !important;padding-bottom:5px;font-size:11px !important;}
| |
- | .news-more a:hover{color:#e30613 !important;}
| |
- |
| |
- | .news-text-latest {font-size:12px !important;}
| |
- | .news-text-latest a{color:#333;}
| |
- | .news-text-latest a:hover{color:#333 !important;}
| |
- |
| |
- | #sponsoren{padding:10px 0 10px 0;background-color:none;border-top:2px solid #fc0110;
| |
- | height: 200px;
| |
- | width:960px;
| |
- | position: relative;
| |
- | margin-left: auto;
| |
- | margin-right: auto;
| |
- |
| |
- | }
| |
- |
| |
- | #sponsoren ul { list-style-type: none; display: inline; }
| |
- | #sponsoren li { display: inline; margin: 0px 20px 0 20px; }
| |
- |
| |
- | hr {border: 0 #c3c3c3 solid;border-top-width: 1px;clear: both;height: 0;margin-bottom:10px;}
| |
- |
| |
- |
| |
- | #footerBG{
| |
- | position:absolute;
| |
- | bottom: -430px;
| |
- | left: 0px;
| |
- | width:100%;
| |
- | }
| |
- |
| |
- | #footerInner{width:100%;min-height:120px;background-color:#333;border-top:4px solid #fc0110}
| |
- |
| |
- | #footerWrap{background-color:none;margin-bottom:0px;height:auto;color:#c3c3c3;}
| |
- | #footerWrap ul.menu {list-style:none;margin-top:8px;margin-bottom:15px;}
| |
- | #footerWrap ul.menu li {font-size:12px;}
| |
- | #footerWrap ul.menu li.first {font-size:13px;font-weight:bold;}
| |
- | #footerWrap ul.menu li a {color:#c3c3c3;}
| |
- | #footerWrap ul.menu li a:hover {color:#fff !important;}
| |
- | #footerContent h1{margin-bottom:3px;margin-top:8px;}
| |
- |
| |
- | #copy{position:relative;}
| |
- | #copy p{padding:10px 0 5px;margin-bottom:0px;font-size:11px;color:#fff;}
| |
- |
| |
- | /*SITEMAP*/
| |
- | ul.list.deep0{margin-bottom:10px;}
| |
- | ul.list.deep1{margin-bottom:10px;}
| |
- | ul.list.deep2{margin-bottom:10px;}
| |
- | .tx-flseositemap-pi1 a{font-size:14px;color:#333;}
| |
- | .tx-flseositemap-pi1 a:hover{font-size:14px;color:#fc0110;}
| |
- | .tx-flseositemap-pi1 li {list-style:disc;color:#fc0110;}
| |
- | /*gallery*/
| |
- | .tx-yag-breadcrumbcomtainer{
| |
- | border-top: 1px solid #333;
| |
- | border-bottom: 1px solid #333;
| |
- | margin: 3px 0 7px 0;
| |
- | padding: 5px 0 3px 0;
| |
- | }
| |
- | .tx-yag-breadcrumb{color:#333 !important;}
| |
- | .tx-yag-breadcrumb a{color:#333 !important;}
| |
- | .tx-yag-breadcrumb a:hover{color:#fc0110 !important;}
| |
- | .tx-yag-gallery-galleryinfo, .tx-yag-album-albuminfo {color:#333 !important;font-size:12px !important;margin-left:0px !important;width:190px;padding:5px;}
| |
- | .tx-yag-album-albuminfo a{color:#333 !important;font-weight:bold;}
| |
- | .tx-yag-album-albuminfo a:hover{color:#fc0110 !important;}
| |
- | .tx-yag-gallery-thumb-innerframe, .tx-yag-album-thumb-innerframe {float:none;}
| |
- |
| |
- | .tx-ptextlist-pager {border-bottom: 1px solid #333;margin: 3px 0 7px 0;padding: 5px 0 15px 0;}
| |
- | .tx-ptextlist-pager li {border:1px solid #20266d;padding:3px 3px 3px 5px;}
| |
- | .tx-ptextlist-pager li.first {margin-left:0px;}
| |
- | .tx-ptextlist-pager a:hover{color:#f90 !important;}
| |
- | .tx-ptextlist-pager .active a {color:#333 !important;font-weight:bold;}
| |
- | .tx-ptextlist-pager-item-display {color:#333 !important;}
| |
- |
| |
- | .tx-yag-items {padding:10px 0 10px 20px;}
| |
- | .yag-item-thumb-innerframe img {width:150px;height:150px;}
| |
- | .tx-yag-thumb-innerframe.tx-yag-album-thumb-innerframe img {width:230px;height:230px;}
| |
- |
| |
- | /*SUCHE*/
| |
- | .tx-ttnews-browsebox, .tx-indexedsearch-browsebox {text-align: center;margin-bottom: 20px;}
| |
- | .tx-ttnews-browsebox, .tx-indexedsearch-browsebox p {text-align:left;margin-bottom:20px;}
| |
- | .tx-ttnews-browsebox ul, .tx-indexedsearch-browsebox ul {margin-bottom: 0;}
| |
- | .tx-ttnews-browsebox ul li, .tx-indexedsearch-browsebox ul li {border:1px solid #999;padding:2px 7px;display:inline;margin-left: 5px;}
| |
- | .tx-ttnews-browsebox ul li a, .tx-indexedsearch-browsebox ul li a {color:#333;}
| |
- | .tx-ttnews-browsebox ul li.first, .tx-ttnews-browsebox ul.menu li.last, .tx-indexedsearch-browsebox ul li.first, .tx-indexedsearch-browsebox ul li.last{border:none;}
| |
- | .tx-ttnews-browsebox ul li.active, .tx-indexedsearch-browsebox ul li.tx-indexedsearch-browselist-currentPage {color:#333;border-color: #999;}
| |
- | .tx-indexedsearch-browsebox ul li a {text-decoration: none !important;}
| |
- | .tx-indexedsearch-browsebox ul li a:hover{color:#fc0110;}
| |
- | .tx-indexedsearch-browsebox ul li.tx-indexedsearch-browselist-currentPage a {color: #fc0110;}
| |
- | .tx-indexedsearch-res {min-height: inherit;color:#333 !important; font-size:14px !important;}
| |
- | .tx-indexedsearch-searchbox {display:none;}
| |
- | .tx-readmore {font-size: 11px;}
| |
- |
| |
- |
| |
- |
| |
- | .sick-input label {
| |
- | position: absolute;
| |
- | left: 4px;
| |
- | top: 0;
| |
- | cursor: text;
| |
- | pointer-events: none;
| |
- | color: #87888A;
| |
- | }
| |
- |
| |
- | .sick-input.populated label {
| |
- |
| |
- | }
| |
- |
| |
- | .sick-input.focused label {
| |
- | color: #ccc;
| |
- | transition: color .2s linear 0;
| |
- | -webkit-transition: color .2s linear 0;
| |
- | -moz-transition: color .2s linear 0;
| |
- | }
| |
- |
| |
- | #tx_indexedsearch {}
| |
- | .tx-indexedsearch-whatis {font-size:14px;color:#333;}
| |
- | .tx-indexedsearch-sw {font-size:14px; font-weight:bold;color:#fc0110;}
| |
- | .tx-indexedsearch-res {margin-bottom:20px;}
| |
- |
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | iframe {
| |
- | display: none !important;
| |
- | }
| |
- | #MathJax_Message {
| |
- | display: none !important;
| |
- | }
| |
- | /*
| |
- | * jQuery FlexSlider v2.2.0
| |
- | * http://www.woothemes.com/flexslider/
| |
- | *
| |
- | * Copyright 2012 WooThemes
| |
- | * Free to use under the GPLv2 license.
| |
- | * http://www.gnu.org/licenses/gpl-2.0.html
| |
- | *
| |
- | * Contributing author: Tyler Smith (@mbmufffin)
| |
- | */
| |
- |
| |
- |
| |
- | /* Browser Resets
| |
- | *********************************/
| |
- | .flex-container a:active,
| |
- | .flexslider a:active,
| |
- | .flex-container a:focus,
| |
- | .flexslider a:focus {outline: none;}
| |
- | .slides,
| |
- | .flex-control-nav,
| |
- | .flex-direction-nav {margin: 0; padding: 0; list-style: none;}
| |
- |
| |
- | /* Icon Fonts
| |
- | *********************************/
| |
- | /* Font-face Icons */
| |
- | @font-face {
| |
- | font-family: 'flexslider-icon';
| |
- | src:url('fonts/flexslider-icon.eot');
| |
- | src:url('fonts/flexslider-icon.eot?#iefix') format('embedded-opentype'),
| |
- | url('fonts/flexslider-icon.woff') format('woff'),
| |
- | url('fonts/flexslider-icon.ttf') format('truetype'),
| |
- | url('fonts/flexslider-icon.svg#flexslider-icon') format('svg');
| |
- | font-weight: normal;
| |
- | font-style: normal;
| |
- | }
| |
- |
| |
- | /* FlexSlider Necessary Styles
| |
- | *********************************/
| |
- | .flexslider {margin: 0; padding: 0;}
| |
- | .flexslider .slides > li {display: none; -webkit-backface-visibility: hidden;} /* Hide the slides before the JS is loaded. Avoids image jumping */
| |
- | .flexslider .slides img {width: 100%; display: block;}
| |
- | .flex-pauseplay span {text-transform: capitalize;}
| |
- |
| |
- | /* Clearfix for the .slides element */
| |
- | .slides:after {content: "."; display: block; clear: both; visibility: hidden; line-height: 0; height: 0;}
| |
- | html[xmlns] .slides {display: block;}
| |
- | * html .slides {height: 1%;}
| |
- |
| |
- | /* No JavaScript Fallback */
| |
- | /* If you are not using another script, such as Modernizr, make sure you
| |
- | * include js that eliminates this class on page load */
| |
- | .no-js .slides > li:first-child {display: block;}
| |
- |
| |
- | /* FlexSlider Default Theme
| |
- | *********************************/
| |
- | .flexslider { margin: 0 0 60px; background: #fff; border: 4px solid #fff; position: relative; -webkit-border-radius: 4px; -moz-border-radius: 4px; -o-border-radius: 4px; border-radius: 4px; -webkit-box-shadow: 0 1px 4px rgba(0,0,0,.2); -moz-box-shadow: 0 1px 4px rgba(0,0,0,.2); -o-box-shadow: 0 1px 4px rgba(0,0,0,.2); box-shadow: 0 1px 4px rgba(0,0,0,.2); zoom: 1; }
| |
- | .flex-viewport { max-height: 2000px; -webkit-transition: all 1s ease; -moz-transition: all 1s ease; -o-transition: all 1s ease; transition: all 1s ease; }
| |
- | .loading .flex-viewport { max-height: 300px; }
| |
- | .flexslider .slides { zoom: 1; }
| |
- | .carousel li { margin-right: 5px; }
| |
- |
| |
- | /* Direction Nav */
| |
- | .flex-direction-nav {*height: 0;}
| |
- | .flex-direction-nav a { display: block; width: 40px; height: 40px; margin: -20px 0 0; position: absolute; top: 50%; z-index: 10; overflow: hidden; opacity: 0; cursor: pointer; color: rgba(0,0,0,0.8); text-shadow: 1px 1px 0 rgba(255,255,255,0.3); /*-webkit-transition: all .3s ease; -moz-transition: all .3s ease; transition: all .3s ease;*/}
| |
- | .flex-direction-nav .flex-prev { left: -50px; }
| |
- | .flex-direction-nav .flex-next { right: -50px; text-align: right; }
| |
- | .flexslider:hover .flex-prev { opacity: 0.7; left: 10px; }
| |
- | .flexslider:hover .flex-next { opacity: 0.7; right: 10px; }
| |
- | .flexslider:hover .flex-next:hover, .flexslider:hover .flex-prev:hover { opacity: 1; }
| |
- | .flex-direction-nav .flex-disabled { opacity: 0!important; filter:alpha(opacity=0); cursor: default; }
| |
- | .flex-direction-nav a:before { font-family: "flexslider-icon"; font-size: 40px; display: inline-block; content: '.'; }
| |
- | .flex-direction-nav a.flex-next:before { content: '.'; }
| |
- |
| |
- | /* Pause/Play */
| |
- | .flex-pauseplay a { display: block; width: 20px; height: 20px; position: absolute; bottom: 5px; left: 10px; opacity: 0.8; z-index: 10; overflow: hidden; cursor: pointer; color: #000; }
| |
- | .flex-pauseplay a:before { font-family: "flexslider-icon"; font-size: 20px; display: inline-block; content: '.'; }
| |
- | .flex-pauseplay a:hover { opacity: 1; }
| |
- | .flex-pauseplay a.flex-play:before { content: '.'; }
| |
- |
| |
- | /* Control Nav */
| |
- | .flex-control-nav {width: 100%; position: absolute; bottom: -40px; text-align: center;}
| |
- | .flex-control-nav li {margin: 0 6px; display: inline-block; zoom: 1; *display: inline;}
| |
- | .flex-control-paging li a {width: 11px; height: 11px; display: block; background: #666; background: rgba(0,0,0,0.5); cursor: pointer; text-indent: -9999px; border-radius: 10px; -webkit-border-radius: 10px; -moz-border-radius: 10px; behavior:url(/fileadmin/gaveg/templates/css/PIE/PIE.htc); -webkit-box-shadow: inset 0 0 3px rgba(0,0,0,0.3); -moz-box-shadow: inset 0 0 3px rgba(0,0,0,0.3); -o-box-shadow: inset 0 0 3px rgba(0,0,0,0.3); box-shadow: inset 0 0 3px rgba(0,0,0,0.3); }
| |
- | .flex-control-paging li a:hover { background: #333; background: rgba(0,0,0,0.7); }
| |
- | .flex-control-paging li a.flex-active { background: #000; background: rgba(0,0,0,0.9); cursor: default; }
| |
- |
| |
- | .flex-control-thumbs {margin: 5px 0 0; position: static; overflow: hidden;}
| |
- | .flex-control-thumbs li {width: 25%; float: left; margin: 0;}
| |
- | .flex-control-thumbs img {width: 100%; display: block; opacity: .7; cursor: pointer;}
| |
- | .flex-control-thumbs img:hover {opacity: 1;}
| |
- | .flex-control-thumbs .flex-active {opacity: 1; cursor: default;}
| |
- |
| |
- | @media screen and (max-width: 860px) {
| |
- | .flex-direction-nav .flex-prev { opacity: 1; left: 10px;}
| |
- | .flex-direction-nav .flex-next { opacity: 1; right: 10px;}
| |
- | }
| |
- |
| |
- | </style>
| |
- | <style>
| |
- | <!--
| |
- | PIE: CSS3 rendering for IE
| |
- | Version 1.0.0
| |
- | http://css3pie.com
| |
- | Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
| |
- | -->
| |
- | <PUBLIC:COMPONENT lightWeight="true">
| |
- | <!-- saved from url=(0014)about:internet -->
| |
- | <PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
| |
- | <PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
| |
- | <PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
| |
- |
| |
- | <script type="text/javascript">
| |
- | var doc = element.document;var f=window.PIE;
| |
- | if(!f){f=window.PIE={F:"-pie-",nb:"Pie",La:"pie_",Ac:{TD:1,TH:1},cc:{TABLE:1,THEAD:1,TBODY:1,TFOOT:1,TR:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,IMG:1,HR:1},fc:{A:1,INPUT:1,TEXTAREA:1,SELECT:1,BUTTON:1},Gd:{submit:1,button:1,reset:1},aa:function(){}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(aa){}for(var ba=4,Z=doc.createElement("div"),ca=Z.getElementsByTagName("i"),ga;Z.innerHTML="<!--[if gt IE "+ ++ba+"]><![endif]--\>",ca[0];);f.O=ba;if(ba===6)f.F=f.F.replace(/^-/,"");f.ja=
| |
- | doc.documentMode||f.O;Z.innerHTML='<v:shape adj="1"/>';ga=Z.firstChild;ga.style.behavior="url(#default#VML)";f.zc=typeof ga.adj==="object";(function(){var a,b=0,c={};f.p={Za:function(d){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+d)},Ba:function(d){return d&&d._pieId||(d._pieId="_"+ ++b)},Eb:function(d){var e,g,j,i,h=arguments;e=1;for(g=h.length;e<g;e++){i=h[e];for(j in i)if(i.hasOwnProperty(j))d[j]=i[j]}return d},
| |
- | Rb:function(d,e,g){var j=c[d],i,h;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([e,g]):e.call(g,j);else{h=c[d]=[[e,g]];i=new Image;i.onload=function(){j=c[d]={h:i.width,f:i.height};for(var k=0,n=h.length;k<n;k++)h[k][0].call(h[k][1],j);i.onload=null};i.src=d}}}})();f.Na={gc:function(a,b,c,d){function e(){k=j>=90&&j<270?b:0;n=j<180?c:0;m=b-k;p=c-n}function g(){for(;j<0;)j+=360;j%=360}var j=d.sa;d=d.zb;var i,h,k,n,m,p,r,t;if(d){d=d.coords(a,b,c);i=d.x;h=d.y}if(j){j=j.jd();g();e();
| |
- | if(!d){i=k;h=n}d=f.Na.tc(i,h,j,m,p);a=d[0];d=d[1]}else if(d){a=b-i;d=c-h}else{i=h=a=0;d=c}r=a-i;t=d-h;if(j===void 0){j=!r?t<0?90:270:!t?r<0?180:0:-Math.atan2(t,r)/Math.PI*180;g();e()}return{sa:j,xc:i,yc:h,td:a,ud:d,Wd:k,Xd:n,rd:m,sd:p,kd:r,ld:t,rc:f.Na.dc(i,h,a,d)}},tc:function(a,b,c,d,e){if(c===0||c===180)return[d,b];else if(c===90||c===270)return[a,e];else{c=Math.tan(-c*Math.PI/180);a=c*a-b;b=-1/c;d=b*d-e;e=b-c;return[(d-a)/e,(c*d-b*a)/e]}},dc:function(a,b,c,d){a=c-a;b=d-b;return Math.abs(a===0?
| |
- | b:b===0?a:Math.sqrt(a*a+b*b))}};f.ea=function(){this.Gb=[];this.oc={}};f.ea.prototype={ba:function(a){var b=f.p.Ba(a),c=this.oc,d=this.Gb;if(!(b in c)){c[b]=d.length;d.push(a)}},Ha:function(a){a=f.p.Ba(a);var b=this.oc;if(a&&a in b){delete this.Gb[b[a]];delete b[a]}},xa:function(){for(var a=this.Gb,b=a.length;b--;)a[b]&&a[b]()}};f.Oa=new f.ea;f.Oa.Rd=function(){var a=this,b;if(!a.Sd){b=doc.documentElement.currentStyle.getAttribute(f.F+"poll-interval")||250;(function c(){a.xa();setTimeout(c,b)})();
| |
- | a.Sd=1}};(function(){function a(){f.L.xa();window.detachEvent("onunload",a);window.PIE=null}f.L=new f.ea;window.attachEvent("onunload",a);f.L.ta=function(b,c,d){b.attachEvent(c,d);this.ba(function(){b.detachEvent(c,d)})}})();f.Qa=new f.ea;f.L.ta(window,"onresize",function(){f.Qa.xa()});(function(){function a(){f.mb.xa()}f.mb=new f.ea;f.L.ta(window,"onscroll",a);f.Qa.ba(a)})();(function(){function a(){c=f.kb.md()}function b(){if(c){for(var d=0,e=c.length;d<e;d++)f.attach(c[d]);c=0}}var c;if(f.ja<9){f.L.ta(window,
| |
- | "onbeforeprint",a);f.L.ta(window,"onafterprint",b)}})();f.lb=new f.ea;f.L.ta(doc,"onmouseup",function(){f.lb.xa()});f.he=function(){function a(h){this.Y=h}var b=doc.createElement("length-calc"),c=doc.body||doc.documentElement,d=b.style,e={},g=["mm","cm","in","pt","pc"],j=g.length,i={};d.position="absolute";d.top=d.left="-9999px";for(c.appendChild(b);j--;){d.width="100"+g[j];e[g[j]]=b.offsetWidth/100}c.removeChild(b);d.width="1em";a.prototype={Kb:/(px|em|ex|mm|cm|in|pt|pc|%)$/,ic:function(){var h=
| |
- | this.Jd;if(h===void 0)h=this.Jd=parseFloat(this.Y);return h},yb:function(){var h=this.ae;if(!h)h=this.ae=(h=this.Y.match(this.Kb))&&h[0]||"px";return h},a:function(h,k){var n=this.ic(),m=this.yb();switch(m){case "px":return n;case "%":return n*(typeof k==="function"?k():k)/100;case "em":return n*this.xb(h);case "ex":return n*this.xb(h)/2;default:return n*e[m]}},xb:function(h){var k=h.currentStyle.fontSize,n,m;if(k.indexOf("px")>0)return parseFloat(k);else if(h.tagName in f.cc){m=this;n=h.parentNode;
| |
- | return f.n(k).a(n,function(){return m.xb(n)})}else{h.appendChild(b);k=b.offsetWidth;b.parentNode===h&&h.removeChild(b);return k}}};f.n=function(h){return i[h]||(i[h]=new a(h))};return a}();f.Ja=function(){function a(e){this.X=e}var b=f.n("50%"),c={top:1,center:1,bottom:1},d={left:1,center:1,right:1};a.prototype={zd:function(){if(!this.ac){var e=this.X,g=e.length,j=f.v,i=j.qa,h=f.n("0");i=i.na;h=["left",h,"top",h];if(g===1){e.push(new j.ob(i,"center"));g++}if(g===2){i&(e[0].k|e[1].k)&&e[0].d in c&&
| |
- | e[1].d in d&&e.push(e.shift());if(e[0].k&i)if(e[0].d==="center")h[1]=b;else h[0]=e[0].d;else if(e[0].W())h[1]=f.n(e[0].d);if(e[1].k&i)if(e[1].d==="center")h[3]=b;else h[2]=e[1].d;else if(e[1].W())h[3]=f.n(e[1].d)}this.ac=h}return this.ac},coords:function(e,g,j){var i=this.zd(),h=i[1].a(e,g);e=i[3].a(e,j);return{x:i[0]==="right"?g-h:h,y:i[2]==="bottom"?j-e:e}}};return a}();f.Ka=function(){function a(b,c){this.h=b;this.f=c}a.prototype={a:function(b,c,d,e,g){var j=this.h,i=this.f,h=c/d;e=e/g;if(j===
| |
- | "contain"){j=e>h?c:d*e;i=e>h?c/e:d}else if(j==="cover"){j=e<h?c:d*e;i=e<h?c/e:d}else if(j==="auto"){i=i==="auto"?g:i.a(b,d);j=i*e}else{j=j.a(b,c);i=i==="auto"?j/e:i.a(b,d)}return{h:j,f:i}}};a.Kc=new a("auto","auto");return a}();f.Ec=function(){function a(b){this.Y=b}a.prototype={Kb:/[a-z]+$/i,yb:function(){return this.ad||(this.ad=this.Y.match(this.Kb)[0].toLowerCase())},jd:function(){var b=this.Vc,c;if(b===undefined){b=this.yb();c=parseFloat(this.Y,10);b=this.Vc=b==="deg"?c:b==="rad"?c/Math.PI*180:
| |
- | b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();f.Jc=function(){function a(c){this.Y=c}var b={};a.Qd=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.Fb={aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",
| |
- | cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",
| |
- | forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",
| |
- | lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",
| |
- | navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",
| |
- | slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ua){var c=this.Y,d;if(d=c.match(a.Qd)){this.Ua="rgb("+d[1]+","+d[2]+","+d[3]+")";this.Yb=parseFloat(d[4])}else{if((d=c.toLowerCase())in a.Fb)c="#"+a.Fb[d];this.Ua=c;this.Yb=c==="transparent"?0:
| |
- | 1}}},U:function(c){this.parse();return this.Ua==="currentColor"?c.currentStyle.color:this.Ua},fa:function(){this.parse();return this.Yb}};f.ha=function(c){return b[c]||(b[c]=new a(c))};return a}();f.v=function(){function a(c){this.$a=c;this.ch=0;this.X=[];this.Ga=0}var b=a.qa={Ia:1,Wb:2,z:4,Lc:8,Xb:16,na:32,K:64,oa:128,pa:256,Ra:512,Tc:1024,URL:2048};a.ob=function(c,d){this.k=c;this.d=d};a.ob.prototype={Ca:function(){return this.k&b.K||this.k&b.oa&&this.d==="0"},W:function(){return this.Ca()||this.k&
| |
- | b.Ra}};a.prototype={de:/\s/,Kd:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,nc:/^\-?[_a-z][\w-]*/i,Yd:/^("([^"]*)"|'([^']*)')/,Bd:/^#([\da-f]{6}|[\da-f]{3})/i,be:{px:b.K,em:b.K,ex:b.K,mm:b.K,cm:b.K,"in":b.K,pt:b.K,pc:b.K,deg:b.Ia,rad:b.Ia,grad:b.Ia},fd:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function d(p,r){p=new a.ob(p,r);if(!c){k.X.push(p);k.Ga++}return p}function e(){k.Ga++;return null}var g,j,i,h,k=this;if(this.Ga<this.X.length)return this.X[this.Ga++];for(;this.de.test(this.$a.charAt(this.ch));)this.ch++;
| |
- | if(this.ch>=this.$a.length)return e();j=this.ch;g=this.$a.substring(this.ch);i=g.charAt(0);switch(i){case "#":if(h=g.match(this.Bd)){this.ch+=h[0].length;return d(b.z,h[0])}break;case '"':case "'":if(h=g.match(this.Yd)){this.ch+=h[0].length;return d(b.Tc,h[2]||h[3]||"")}break;case "/":case ",":this.ch++;return d(b.pa,i);case "u":if(h=g.match(this.url)){this.ch+=h[0].length;return d(b.URL,h[2]||h[3]||h[4]||"")}}if(h=g.match(this.Kd)){i=h[0];this.ch+=i.length;if(g.charAt(i.length)==="%"){this.ch++;
| |
- | return d(b.Ra,i+"%")}if(h=g.substring(i.length).match(this.nc)){i+=h[0];this.ch+=h[0].length;return d(this.be[h[0].toLowerCase()]||b.Lc,i)}return d(b.oa,i)}if(h=g.match(this.nc)){i=h[0];this.ch+=i.length;if(i.toLowerCase()in f.Jc.Fb||i==="currentColor"||i==="transparent")return d(b.z,i);if(g.charAt(i.length)==="("){this.ch++;if(i.toLowerCase()in this.fd){g=function(p){return p&&p.k&b.oa};h=function(p){return p&&p.k&(b.oa|b.Ra)};var n=function(p,r){return p&&p.d===r},m=function(){return k.next(1)};
| |
- | if((i.charAt(0)==="r"?h(m()):g(m()))&&n(m(),",")&&h(m())&&n(m(),",")&&h(m())&&(i==="rgb"||i==="hsa"||n(m(),",")&&g(m()))&&n(m(),")"))return d(b.z,this.$a.substring(j,this.ch));return e()}return d(b.Xb,i)}return d(b.na,i)}this.ch++;return d(b.Wb,i)},D:function(){return this.X[this.Ga-- -2]},all:function(){for(;this.next(););return this.X},ma:function(c,d){for(var e=[],g,j;g=this.next();){if(c(g)){j=true;this.D();break}e.push(g)}return d&&!j?null:e}};return a}();var ha=function(a){this.e=a};ha.prototype=
| |
- | {Z:0,Od:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Td:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.h!==b.h||a.f!==b.f)},hc:function(){var a=this.e,b=a.getBoundingClientRect(),c=f.ja===9,d=f.O===7,e=b.right-b.left;return{x:b.left,y:b.top,h:c||d?a.offsetWidth:e,f:c||d?a.offsetHeight:b.bottom-b.top,Hd:d&&e?a.offsetWidth/e:1}},o:function(){return this.Z?this.Va||(this.Va=this.hc()):this.hc()},Ad:function(){return!!this.qb},cb:function(){++this.Z},hb:function(){if(!--this.Z){if(this.Va)this.qb=
| |
- | this.Va;this.Va=null}}};(function(){function a(b){var c=f.p.Ba(b);return function(){if(this.Z){var d=this.$b||(this.$b={});return c in d?d[c]:(d[c]=b.call(this))}else return b.call(this)}}f.B={Z:0,ka:function(b){function c(d){this.e=d;this.Zb=this.ia()}f.p.Eb(c.prototype,f.B,b);c.$c={};return c},j:function(){var b=this.ia(),c=this.constructor.$c;return b?b in c?c[b]:(c[b]=this.la(b)):null},ia:a(function(){var b=this.e,c=this.constructor,d=b.style;b=b.currentStyle;var e=this.wa,g=this.Fa,j=c.Yc||(c.Yc=
| |
- | f.F+e);c=c.Zc||(c.Zc=f.nb+g.charAt(0).toUpperCase()+g.substring(1));return d[c]||b.getAttribute(j)||d[g]||b.getAttribute(e)}),i:a(function(){return!!this.j()}),H:a(function(){var b=this.ia(),c=b!==this.Zb;this.Zb=b;return c}),va:a,cb:function(){++this.Z},hb:function(){--this.Z||delete this.$b}}})();f.Sb=f.B.ka({wa:f.F+"background",Fa:f.nb+"Background",cd:{scroll:1,fixed:1,local:1},fb:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},sc:{"padding-box":1,"border-box":1,"content-box":1},Pd:{top:1,right:1,
| |
- | bottom:1,left:1,center:1},Ud:{contain:1,cover:1},eb:{Ma:"backgroundClip",z:"backgroundColor",da:"backgroundImage",Pa:"backgroundOrigin",S:"backgroundPosition",T:"backgroundRepeat",Sa:"backgroundSize"},la:function(a){function b(s){return s&&s.W()||s.k&k&&s.d in t}function c(s){return s&&(s.W()&&f.n(s.d)||s.d==="auto"&&"auto")}var d=this.e.currentStyle,e,g,j,i=f.v.qa,h=i.pa,k=i.na,n=i.z,m,p,r=0,t=this.Pd,v,l,q={M:[]};if(this.wb()){e=new f.v(a);for(j={};g=e.next();){m=g.k;p=g.d;if(!j.P&&m&i.Xb&&p===
| |
- | "linear-gradient"){v={ca:[],P:p};for(l={};g=e.next();){m=g.k;p=g.d;if(m&i.Wb&&p===")"){l.color&&v.ca.push(l);v.ca.length>1&&f.p.Eb(j,v);break}if(m&n){if(v.sa||v.zb){g=e.D();if(g.k!==h)break;e.next()}l={color:f.ha(p)};g=e.next();if(g.W())l.db=f.n(g.d);else e.D()}else if(m&i.Ia&&!v.sa&&!l.color&&!v.ca.length)v.sa=new f.Ec(g.d);else if(b(g)&&!v.zb&&!l.color&&!v.ca.length){e.D();v.zb=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&h&&p===","){if(l.color){v.ca.push(l);l={}}}else break}}else if(!j.P&&
| |
- | m&i.URL){j.Ab=p;j.P="image"}else if(b(g)&&!j.$){e.D();j.$=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&k)if(p in this.fb&&!j.bb)j.bb=p;else if(p in this.sc&&!j.Wa){j.Wa=p;if((g=e.next())&&g.k&k&&g.d in this.sc)j.ub=g.d;else{j.ub=p;e.D()}}else if(p in this.cd&&!j.bc)j.bc=p;else return null;else if(m&n&&!q.color)q.color=f.ha(p);else if(m&h&&p==="/"&&!j.Xa&&j.$){g=e.next();if(g.k&k&&g.d in this.Ud)j.Xa=new f.Ka(g.d);else if(g=c(g)){m=c(e.next());if(!m){m=g;e.D()}j.Xa=new f.Ka(g,m)}else return null}else if(m&
| |
- | h&&p===","&&j.P){j.Hb=a.substring(r,e.ch-1);r=e.ch;q.M.push(j);j={}}else return null}if(j.P){j.Hb=a.substring(r);q.M.push(j)}}else this.Bc(f.ja<9?function(){var s=this.eb,o=d[s.S+"X"],u=d[s.S+"Y"],x=d[s.da],y=d[s.z];if(y!=="transparent")q.color=f.ha(y);if(x!=="none")q.M=[{P:"image",Ab:(new f.v(x)).next().d,bb:d[s.T],$:new f.Ja((new f.v(o+" "+u)).all())}]}:function(){var s=this.eb,o=/\s*,\s*/,u=d[s.da].split(o),x=d[s.z],y,z,B,E,D,C;if(x!=="transparent")q.color=f.ha(x);if((E=u.length)&&u[0]!=="none"){x=
| |
- | d[s.T].split(o);y=d[s.S].split(o);z=d[s.Pa].split(o);B=d[s.Ma].split(o);s=d[s.Sa].split(o);q.M=[];for(o=0;o<E;o++)if((D=u[o])&&D!=="none"){C=s[o].split(" ");q.M.push({Hb:D+" "+x[o]+" "+y[o]+" / "+s[o]+" "+z[o]+" "+B[o],P:"image",Ab:(new f.v(D)).next().d,bb:x[o],$:new f.Ja((new f.v(y[o])).all()),Wa:z[o],ub:B[o],Xa:new f.Ka(C[0],C[1])})}}});return q.color||q.M[0]?q:null},Bc:function(a){var b=f.ja>8,c=this.eb,d=this.e.runtimeStyle,e=d[c.da],g=d[c.z],j=d[c.T],i,h,k,n;if(e)d[c.da]="";if(g)d[c.z]="";if(j)d[c.T]=
| |
- | "";if(b){i=d[c.Ma];h=d[c.Pa];n=d[c.S];k=d[c.Sa];if(i)d[c.Ma]="";if(h)d[c.Pa]="";if(n)d[c.S]="";if(k)d[c.Sa]=""}a=a.call(this);if(e)d[c.da]=e;if(g)d[c.z]=g;if(j)d[c.T]=j;if(b){if(i)d[c.Ma]=i;if(h)d[c.Pa]=h;if(n)d[c.S]=n;if(k)d[c.Sa]=k}return a},ia:f.B.va(function(){return this.wb()||this.Bc(function(){var a=this.e.currentStyle,b=this.eb;return a[b.z]+" "+a[b.da]+" "+a[b.T]+" "+a[b.S+"X"]+" "+a[b.S+"Y"]})}),wb:f.B.va(function(){var a=this.e;return a.style[this.Fa]||a.currentStyle.getAttribute(this.wa)}),
| |
- | qc:function(){var a=0;if(f.O<7){a=this.e;a=""+(a.style[f.nb+"PngFix"]||a.currentStyle.getAttribute(f.F+"png-fix"))==="true"}return a},i:f.B.va(function(){return(this.wb()||this.qc())&&!!this.j()})});f.Vb=f.B.ka({wc:["Top","Right","Bottom","Left"],Id:{thin:"1px",medium:"3px",thick:"5px"},la:function(){var a={},b={},c={},d=false,e=true,g=true,j=true;this.Cc(function(){for(var i=this.e.currentStyle,h=0,k,n,m,p,r,t,v;h<4;h++){m=this.wc[h];v=m.charAt(0).toLowerCase();k=b[v]=i["border"+m+"Style"];n=i["border"+
| |
- | m+"Color"];m=i["border"+m+"Width"];if(h>0){if(k!==p)g=false;if(n!==r)e=false;if(m!==t)j=false}p=k;r=n;t=m;c[v]=f.ha(n);m=a[v]=f.n(b[v]==="none"?"0":this.Id[m]||m);if(m.a(this.e)>0)d=true}});return d?{J:a,Zd:b,gd:c,ee:j,hd:e,$d:g}:null},ia:f.B.va(function(){var a=this.e,b=a.currentStyle,c;a.tagName in f.Ac&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Cc(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Cc:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,
| |
- | d=b.borderColor;if(c)b.borderWidth="";if(d)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(d)b.borderColor=d;return a}});(function(){f.jb=f.B.ka({wa:"border-radius",Fa:"borderRadius",la:function(b){var c=null,d,e,g,j,i=false;if(b){e=new f.v(b);var h=function(){for(var k=[],n;(g=e.next())&&g.W();){j=f.n(g.d);n=j.ic();if(n<0)return null;if(n>0)i=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=h()){if(g){if(g.k&f.v.qa.pa&&g.d===
| |
- | "/")d=h()}else d=b;if(i&&b&&d)c={x:b,y:d}}}return c}});var a=f.n("0");a={tl:a,tr:a,br:a,bl:a};f.jb.Dc={x:a,y:a}})();f.Ub=f.B.ka({wa:"border-image",Fa:"borderImage",fb:{stretch:1,round:1,repeat:1,space:1},la:function(a){var b=null,c,d,e,g,j,i,h=0,k=f.v.qa,n=k.na,m=k.oa,p=k.Ra;if(a){c=new f.v(a);b={};for(var r=function(l){return l&&l.k&k.pa&&l.d==="/"},t=function(l){return l&&l.k&n&&l.d==="fill"},v=function(){g=c.ma(function(l){return!(l.k&(m|p))});if(t(c.next())&&!b.fill)b.fill=true;else c.D();if(r(c.next())){h++;
| |
- | j=c.ma(function(l){return!l.W()&&!(l.k&n&&l.d==="auto")});if(r(c.next())){h++;i=c.ma(function(l){return!l.Ca()})}}else c.D()};a=c.next();){d=a.k;e=a.d;if(d&(m|p)&&!g){c.D();v()}else if(t(a)&&!b.fill){b.fill=true;v()}else if(d&n&&this.fb[e]&&!b.repeat){b.repeat={f:e};if(a=c.next())if(a.k&n&&this.fb[a.d])b.repeat.Ob=a.d;else c.D()}else if(d&k.URL&&!b.src)b.src=e;else return null}if(!b.src||!g||g.length<1||g.length>4||j&&j.length>4||h===1&&j.length<1||i&&i.length>4||h===2&&i.length<1)return null;if(!b.repeat)b.repeat=
| |
- | {f:"stretch"};if(!b.repeat.Ob)b.repeat.Ob=b.repeat.f;a=function(l,q){return{t:q(l[0]),r:q(l[1]||l[0]),b:q(l[2]||l[0]),l:q(l[3]||l[1]||l[0])}};b.slice=a(g,function(l){return f.n(l.k&m?l.d+"px":l.d)});if(j&&j[0])b.J=a(j,function(l){return l.W()?f.n(l.d):l.d});if(i&&i[0])b.Da=a(i,function(l){return l.Ca()?f.n(l.d):l.d})}return b}});f.Ic=f.B.ka({wa:"box-shadow",Fa:"boxShadow",la:function(a){var b,c=f.n,d=f.v.qa,e;if(a){e=new f.v(a);b={Da:[],Bb:[]};for(a=function(){for(var g,j,i,h,k,n;g=e.next();){i=g.d;
| |
- | j=g.k;if(j&d.pa&&i===",")break;else if(g.Ca()&&!k){e.D();k=e.ma(function(m){return!m.Ca()})}else if(j&d.z&&!h)h=i;else if(j&d.na&&i==="inset"&&!n)n=true;else return false}g=k&&k.length;if(g>1&&g<5){(n?b.Bb:b.Da).push({fe:c(k[0].d),ge:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Vd:c(k[3]?k[3].d:"0"),color:f.ha(h||"currentColor")});return true}return false};a(););}return b&&(b.Bb.length||b.Da.length)?b:null}});f.Uc=f.B.ka({ia:f.B.va(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),la:function(){var a=
| |
- | this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,d;b.visibility="";d=a.visibility;b.visibility=c;return{ce:d!=="hidden",nd:a.display!=="none"}},i:function(){return false}});f.u={R:function(a){function b(c,d,e,g){this.e=c;this.s=d;this.g=e;this.parent=g}f.p.Eb(b.prototype,f.u,a);return b},Cb:false,Q:function(){return false},Ea:f.aa,Lb:function(){this.m();this.i()&&this.V()},ib:function(){this.Cb=true},Mb:function(){this.i()?this.V():this.m()},sb:function(a,b){this.vc(a);for(var c=this.ra||
| |
- | (this.ra=[]),d=a+1,e=c.length,g;d<e;d++)if(g=c[d])break;c[a]=b;this.I().insertBefore(b,g||null)},za:function(a){var b=this.ra;return b&&b[a]||null},vc:function(a){var b=this.za(a),c=this.Ta;if(b&&c){c.removeChild(b);this.ra[a]=null}},Aa:function(a,b,c,d){var e=this.rb||(this.rb={}),g=e[a];if(!g){g=e[a]=f.p.Za("shape");if(b)g.appendChild(g[b]=f.p.Za(b));if(d){c=this.za(d);if(!c){this.sb(d,doc.createElement("group"+d));c=this.za(d)}}c.appendChild(g);a=g.style;a.position="absolute";a.left=a.top=0;a.behavior=
| |
- | "url(#default#VML)"}return g},vb:function(a){var b=this.rb,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},kc:function(a){var b=this.e,c=this.s.o(),d=c.h,e=c.f,g,j,i,h,k,n;c=a.x.tl.a(b,d);g=a.y.tl.a(b,e);j=a.x.tr.a(b,d);i=a.y.tr.a(b,e);h=a.x.br.a(b,d);k=a.y.br.a(b,e);n=a.x.bl.a(b,d);a=a.y.bl.a(b,e);d=Math.min(d/(c+j),e/(i+k),d/(n+h),e/(g+a));if(d<1){c*=d;g*=d;j*=d;i*=d;h*=d;k*=d;n*=d;a*=d}return{x:{tl:c,tr:j,br:h,bl:n},y:{tl:g,tr:i,br:k,bl:a}}},ya:function(a,b,c){b=b||1;var d,e,
| |
- | g=this.s.o();e=g.h*b;g=g.f*b;var j=this.g.G,i=Math.floor,h=Math.ceil,k=a?a.Jb*b:0,n=a?a.Ib*b:0,m=a?a.tb*b:0;a=a?a.Db*b:0;var p,r,t,v,l;if(c||j.i()){d=this.kc(c||j.j());c=d.x.tl*b;j=d.y.tl*b;p=d.x.tr*b;r=d.y.tr*b;t=d.x.br*b;v=d.y.br*b;l=d.x.bl*b;b=d.y.bl*b;e="m"+i(a)+","+i(j)+"qy"+i(c)+","+i(k)+"l"+h(e-p)+","+i(k)+"qx"+h(e-n)+","+i(r)+"l"+h(e-n)+","+h(g-v)+"qy"+h(e-t)+","+h(g-m)+"l"+i(l)+","+h(g-m)+"qx"+i(a)+","+h(g-b)+" x e"}else e="m"+i(a)+","+i(k)+"l"+h(e-n)+","+i(k)+"l"+h(e-n)+","+h(g-m)+"l"+i(a)+
| |
- | ","+h(g-m)+"xe";return e},I:function(){var a=this.parent.za(this.N),b;if(!a){a=doc.createElement(this.Ya);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.sb(this.N,a)}return a},mc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,d=a.tagName,e=f.O===6,g;if(e&&(d in f.cc||d==="FIELDSET")||d==="BUTTON"||d==="INPUT"&&a.type in f.Gd){c.borderWidth="";d=this.g.w.wc;for(g=d.length;g--;){e=d[g];c["padding"+e]="";c["padding"+e]=f.n(b["padding"+e]).a(a)+f.n(b["border"+e+"Width"]).a(a)+(f.O!==
| |
- | 8&&g%2?1:0)}c.borderWidth=0}else if(e){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");d=b.style;d.visibility="visible";for(d.zoom=1;d=a.firstChild;)b.appendChild(d);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},ie:function(){},m:function(){this.parent.vc(this.N);delete this.rb;delete this.ra}};f.Rc=f.u.R({i:function(){var a=this.ed;for(var b in a)if(a.hasOwnProperty(b)&&a[b].i())return true;return false},Q:function(){return this.g.Pb.H()},
| |
- | ib:function(){if(this.i()){var a=this.jc(),b=a,c;a=a.currentStyle;var d=a.position,e=this.I().style,g=0,j=0;j=this.s.o();var i=j.Hd;if(d==="fixed"&&f.O>6){g=j.x*i;j=j.y*i;b=d}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;g=(j.x-c.left)*i-(parseFloat(b.borderLeftWidth)||0);j=(j.y-c.top)*i-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;g=(j.x+b.scrollLeft-b.clientLeft)*i;j=(j.y+b.scrollTop-b.clientTop)*i}b="absolute"}e.position=
| |
- | b;e.left=g;e.top=j;e.zIndex=d==="static"?-1:a.zIndex;this.Cb=true}},Mb:f.aa,Nb:function(){var a=this.g.Pb.j();this.I().style.display=a.ce&&a.nd?"":"none"},Lb:function(){this.i()?this.Nb():this.m()},jc:function(){var a=this.e;return a.tagName in f.Ac?a.offsetParent:a},I:function(){var a=this.Ta,b;if(!a){b=this.jc();a=this.Ta=doc.createElement("css3-container");a.style.direction="ltr";this.Nb();b.parentNode.insertBefore(a,b)}return a},ab:f.aa,m:function(){var a=this.Ta,b;if(a&&(b=a.parentNode))b.removeChild(a);
| |
- | delete this.Ta;delete this.ra}});f.Fc=f.u.R({N:2,Ya:"background",Q:function(){var a=this.g;return a.C.H()||a.G.H()},i:function(){var a=this.g;return a.q.i()||a.G.i()||a.C.i()||a.ga.i()&&a.ga.j().Bb},V:function(){var a=this.s.o();if(a.h&&a.f){this.od();this.pd()}},od:function(){var a=this.g.C.j(),b=this.s.o(),c=this.e,d=a&&a.color,e,g;if(d&&d.fa()>0){this.lc();a=this.Aa("bgColor","fill",this.I(),1);e=b.h;b=b.f;a.stroked=false;a.coordsize=e*2+","+b*2;a.coordorigin="1,1";a.path=this.ya(null,2);g=a.style;
| |
- | g.width=e;g.height=b;a.fill.color=d.U(c);c=d.fa();if(c<1)a.fill.opacity=c}else this.vb("bgColor")},pd:function(){var a=this.g.C.j(),b=this.s.o();a=a&&a.M;var c,d,e,g,j;if(a){this.lc();d=b.h;e=b.f;for(j=a.length;j--;){b=a[j];c=this.Aa("bgImage"+j,"fill",this.I(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=d*2+","+e*2;c.coordorigin="1,1";c.path=this.ya(0,2);g=c.style;g.width=d;g.height=e;if(b.P==="linear-gradient")this.bd(c,b);else{c.fill.src=b.Ab;this.Nd(c,j)}}}for(j=a?a.length:
| |
- | 0;this.vb("bgImage"+j++););},Nd:function(a,b){var c=this;f.p.Rb(a.fill.src,function(d){var e=c.e,g=c.s.o(),j=g.h;g=g.f;if(j&&g){var i=a.fill,h=c.g,k=h.w.j(),n=k&&k.J;k=n?n.t.a(e):0;var m=n?n.r.a(e):0,p=n?n.b.a(e):0;n=n?n.l.a(e):0;h=h.C.j().M[b];e=h.$?h.$.coords(e,j-d.h-n-m,g-d.f-k-p):{x:0,y:0};h=h.bb;p=m=0;var r=j+1,t=g+1,v=f.O===8?0:1;n=Math.round(e.x)+n+0.5;k=Math.round(e.y)+k+0.5;i.position=n/j+","+k/g;i.size.x=1;i.size=d.h+"px,"+d.f+"px";if(h&&h!=="repeat"){if(h==="repeat-x"||h==="no-repeat"){m=
| |
- | k+1;t=k+d.f+v}if(h==="repeat-y"||h==="no-repeat"){p=n+1;r=n+d.h+v}a.style.clip="rect("+m+"px,"+r+"px,"+t+"px,"+p+"px)"}}})},bd:function(a,b){var c=this.e,d=this.s.o(),e=d.h,g=d.f;a=a.fill;d=b.ca;var j=d.length,i=Math.PI,h=f.Na,k=h.tc,n=h.dc;b=h.gc(c,e,g,b);h=b.sa;var m=b.xc,p=b.yc,r=b.Wd,t=b.Xd,v=b.rd,l=b.sd,q=b.kd,s=b.ld;b=b.rc;e=h%90?Math.atan2(q*e/g,s)/i*180:h+90;e+=180;e%=360;v=k(r,t,h,v,l);g=n(r,t,v[0],v[1]);i=[];v=k(m,p,h,r,t);n=n(m,p,v[0],v[1])/g*100;k=[];for(h=0;h<j;h++)k.push(d[h].db?d[h].db.a(c,
| |
- | b):h===0?0:h===j-1?b:null);for(h=1;h<j;h++){if(k[h]===null){m=k[h-1];b=h;do p=k[++b];while(p===null);k[h]=m+(p-m)/(b-h+1)}k[h]=Math.max(k[h],k[h-1])}for(h=0;h<j;h++)i.push(n+k[h]/g*100+"% "+d[h].color.U(c));a.angle=e;a.type="gradient";a.method="sigma";a.color=d[0].color.U(c);a.color2=d[j-1].color.U(c);if(a.colors)a.colors.value=i.join(",");else a.colors=i.join(",")},lc:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},m:function(){f.u.m.call(this);
| |
- | var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});f.Gc=f.u.R({N:4,Ya:"border",Q:function(){var a=this.g;return a.w.H()||a.G.H()},i:function(){var a=this.g;return a.G.i()&&!a.q.i()&&a.w.i()},V:function(){var a=this.e,b=this.g.w.j(),c=this.s.o(),d=c.h;c=c.f;var e,g,j,i,h;if(b){this.mc();b=this.wd(2);i=0;for(h=b.length;i<h;i++){j=b[i];e=this.Aa("borderPiece"+i,j.stroke?"stroke":"fill",this.I());e.coordsize=d*2+","+c*2;e.coordorigin="1,1";e.path=j.path;g=e.style;g.width=d;g.height=c;
| |
- | e.filled=!!j.fill;e.stroked=!!j.stroke;if(j.stroke){e=e.stroke;e.weight=j.Qb+"px";e.color=j.color.U(a);e.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";e.linestyle=j.stroke==="double"&&j.Qb>2?"ThinThin":"Single"}else e.fill.color=j.fill.U(a)}for(;this.vb("borderPiece"+i++););}},wd:function(a){var b=this.e,c,d,e,g=this.g.w,j=[],i,h,k,n,m=Math.round,p,r,t;if(g.i()){c=g.j();g=c.J;r=c.Zd;t=c.gd;if(c.ee&&c.$d&&c.hd){if(t.t.fa()>0){c=g.t.a(b);k=c/2;j.push({path:this.ya({Jb:k,Ib:k,
| |
- | tb:k,Db:k},a),stroke:r.t,color:t.t,Qb:c})}}else{a=a||1;c=this.s.o();d=c.h;e=c.f;c=m(g.t.a(b));k=m(g.r.a(b));n=m(g.b.a(b));b=m(g.l.a(b));var v={t:c,r:k,b:n,l:b};b=this.g.G;if(b.i())p=this.kc(b.j());i=Math.floor;h=Math.ceil;var l=function(o,u){return p?p[o][u]:0},q=function(o,u,x,y,z,B){var E=l("x",o),D=l("y",o),C=o.charAt(1)==="r";o=o.charAt(0)==="b";return E>0&&D>0?(B?"al":"ae")+(C?h(d-E):i(E))*a+","+(o?h(e-D):i(D))*a+","+(i(E)-u)*a+","+(i(D)-x)*a+","+y*65535+","+2949075*(z?1:-1):(B?"m":"l")+(C?d-
| |
- | u:u)*a+","+(o?e-x:x)*a},s=function(o,u,x,y){var z=o==="t"?i(l("x","tl"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+i(l("y","tr"))*a:o==="b"?h(d-l("x","br"))*a+","+i(e-u)*a:i(u)*a+","+h(e-l("y","bl"))*a;o=o==="t"?h(d-l("x","tr"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+h(e-l("y","br"))*a:o==="b"?i(l("x","bl"))*a+","+i(e-u)*a:i(u)*a+","+i(l("y","tl"))*a;return x?(y?"m"+o:"")+"l"+z:(y?"m"+z:"")+"l"+o};b=function(o,u,x,y,z,B){var E=o==="l"||o==="r",D=v[o],C,F;if(D>0&&r[o]!=="none"&&t[o].fa()>0){C=v[E?o:u];u=v[E?u:
| |
- | o];F=v[E?o:x];x=v[E?x:o];if(r[o]==="dashed"||r[o]==="dotted"){j.push({path:q(y,C,u,B+45,0,1)+q(y,0,0,B,1,0),fill:t[o]});j.push({path:s(o,D/2,0,1),stroke:r[o],Qb:D,color:t[o]});j.push({path:q(z,F,x,B,0,1)+q(z,0,0,B-45,1,0),fill:t[o]})}else j.push({path:q(y,C,u,B+45,0,1)+s(o,D,0,0)+q(z,F,x,B,0,0)+(r[o]==="double"&&D>2?q(z,F-i(F/3),x-i(x/3),B-45,1,0)+s(o,h(D/3*2),1,0)+q(y,C-i(C/3),u-i(u/3),B,1,0)+"x "+q(y,i(C/3),i(u/3),B+45,0,1)+s(o,i(D/3),1,0)+q(z,i(F/3),i(x/3),B,0,0):"")+q(z,0,0,B-45,1,0)+s(o,0,1,
| |
- | 0)+q(y,0,0,B,1,0),fill:t[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},m:function(){if(this.ec||!this.g.q.i())this.e.runtimeStyle.borderColor="";f.u.m.call(this)}});f.Tb=f.u.R({N:5,Md:["t","tr","r","br","b","bl","l","tl","c"],Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){this.I();var a=this.g.q.j(),b=this.g.w.j(),c=this.s.o(),d=this.e,e=this.uc;f.p.Rb(a.src,function(g){function j(s,
| |
- | o,u,x,y){s=e[s].style;var z=Math.max;s.width=z(o,0);s.height=z(u,0);s.left=x;s.top=y}function i(s,o,u){for(var x=0,y=s.length;x<y;x++)e[s[x]].imagedata[o]=u}var h=c.h,k=c.f,n=f.n("0"),m=a.J||(b?b.J:{t:n,r:n,b:n,l:n});n=m.t.a(d);var p=m.r.a(d),r=m.b.a(d);m=m.l.a(d);var t=a.slice,v=t.t.a(d),l=t.r.a(d),q=t.b.a(d);t=t.l.a(d);j("tl",m,n,0,0);j("t",h-m-p,n,m,0);j("tr",p,n,h-p,0);j("r",p,k-n-r,h-p,n);j("br",p,r,h-p,k-r);j("b",h-m-p,r,m,k-r);j("bl",m,r,0,k-r);j("l",m,k-n-r,0,n);j("c",h-m-p,k-n-r,m,n);i(["tl",
| |
- | "t","tr"],"cropBottom",(g.f-v)/g.f);i(["tl","l","bl"],"cropRight",(g.h-t)/g.h);i(["bl","b","br"],"cropTop",(g.f-q)/g.f);i(["tr","r","br"],"cropLeft",(g.h-l)/g.h);i(["l","r","c"],"cropTop",v/g.f);i(["l","r","c"],"cropBottom",q/g.f);i(["t","b","c"],"cropLeft",t/g.h);i(["t","b","c"],"cropRight",l/g.h);e.c.style.display=a.fill?"":"none"},this)},I:function(){var a=this.parent.za(this.N),b,c,d,e=this.Md,g=e.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";this.uc={};for(d=
| |
- | 0;d<g;d++){c=this.uc[e[d]]=f.p.Za("rect");c.appendChild(f.p.Za("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.g.q.j().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.sb(this.N,a)}return a},Ea:function(){if(this.i()){var a=this.e,b=a.runtimeStyle,c=this.g.q.j().J;b.borderStyle="solid";if(c){b.borderTopWidth=c.t.a(a)+"px";b.borderRightWidth=c.r.a(a)+"px";b.borderBottomWidth=c.b.a(a)+"px";b.borderLeftWidth=c.l.a(a)+"px"}this.mc()}},
| |
- | m:function(){var a=this.e.runtimeStyle;a.borderStyle="";if(this.ec||!this.g.w.i())a.borderColor=a.borderWidth="";f.u.m.call(this)}});f.Hc=f.u.R({N:1,Ya:"outset-box-shadow",Q:function(){var a=this.g;return a.ga.H()||a.G.H()},i:function(){var a=this.g.ga;return a.i()&&a.j().Da[0]},V:function(){function a(C,F,O,H,M,P,I){C=b.Aa("shadow"+C+F,"fill",d,j-C);F=C.fill;C.coordsize=n*2+","+m*2;C.coordorigin="1,1";C.stroked=false;C.filled=true;F.color=M.U(c);if(P){F.type="gradienttitle";F.color2=F.color;F.opacity=
| |
- | 0}C.path=I;l=C.style;l.left=O;l.top=H;l.width=n;l.height=m;return C}var b=this,c=this.e,d=this.I(),e=this.g,g=e.ga.j().Da;e=e.G.j();var j=g.length,i=j,h,k=this.s.o(),n=k.h,m=k.f;k=f.O===8?1:0;for(var p=["tl","tr","br","bl"],r,t,v,l,q,s,o,u,x,y,z,B,E,D;i--;){t=g[i];q=t.fe.a(c);s=t.ge.a(c);h=t.Vd.a(c);o=t.blur.a(c);t=t.color;u=-h-o;if(!e&&o)e=f.jb.Dc;u=this.ya({Jb:u,Ib:u,tb:u,Db:u},2,e);if(o){x=(h+o)*2+n;y=(h+o)*2+m;z=x?o*2/x:0;B=y?o*2/y:0;if(o-h>n/2||o-h>m/2)for(h=4;h--;){r=p[h];E=r.charAt(0)==="b";
| |
- | D=r.charAt(1)==="r";r=a(i,r,q,s,t,o,u);v=r.fill;v.focusposition=(D?1-z:z)+","+(E?1-B:B);v.focussize="0,0";r.style.clip="rect("+((E?y/2:0)+k)+"px,"+(D?x:x/2)+"px,"+(E?y:y/2)+"px,"+((D?x/2:0)+k)+"px)"}else{r=a(i,"",q,s,t,o,u);v=r.fill;v.focusposition=z+","+B;v.focussize=1-z*2+","+(1-B*2)}}else{r=a(i,"",q,s,t,o,u);q=t.fa();if(q<1)r.fill.opacity=q}}}});f.Pc=f.u.R({N:6,Ya:"imgEl",Q:function(){var a=this.g;return this.e.src!==this.Xc||a.G.H()},i:function(){var a=this.g;return a.G.i()||a.C.qc()},V:function(){this.Xc=
| |
- | j;this.Cd();var a=this.Aa("img","fill",this.I()),b=a.fill,c=this.s.o(),d=c.h;c=c.f;var e=this.g.w.j(),g=e&&e.J;e=this.e;var j=e.src,i=Math.round,h=e.currentStyle,k=f.n;if(!g||f.O<7){g=f.n("0");g={t:g,r:g,b:g,l:g}}a.stroked=false;b.type="frame";b.src=j;b.position=(d?0.5/d:0)+","+(c?0.5/c:0);a.coordsize=d*2+","+c*2;a.coordorigin="1,1";a.path=this.ya({Jb:i(g.t.a(e)+k(h.paddingTop).a(e)),Ib:i(g.r.a(e)+k(h.paddingRight).a(e)),tb:i(g.b.a(e)+k(h.paddingBottom).a(e)),Db:i(g.l.a(e)+k(h.paddingLeft).a(e))},
| |
- | 2);a=a.style;a.width=d;a.height=c},Cd:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},m:function(){f.u.m.call(this);this.e.runtimeStyle.filter=""}});f.Oc=f.u.R({ib:f.aa,Mb:f.aa,Nb:f.aa,Lb:f.aa,Ld:/^,+|,+$/g,Fd:/,+/g,gb:function(a,b){(this.pb||(this.pb=[]))[a]=b||void 0},ab:function(){var a=this.pb,b;if(a&&(b=a.join(",").replace(this.Ld,"").replace(this.Fd,","))!==this.Wc)this.Wc=this.e.runtimeStyle.background=b},m:function(){this.e.runtimeStyle.background="";delete this.pb}});f.Mc=f.u.R({ua:1,
| |
- | Q:function(){return this.g.C.H()},i:function(){var a=this.g;return a.C.i()||a.q.i()},V:function(){var a=this.g.C.j(),b,c,d=0,e,g;if(a){b=[];if(c=a.M)for(;e=c[d++];)if(e.P==="linear-gradient"){g=this.vd(e.Wa);g=(e.Xa||f.Ka.Kc).a(this.e,g.h,g.f,g.h,g.f);b.push("url(data:image/svg+xml,"+escape(this.xd(e,g.h,g.f))+") "+this.dd(e.$)+" / "+g.h+"px "+g.f+"px "+(e.bc||"")+" "+(e.Wa||"")+" "+(e.ub||""))}else b.push(e.Hb);a.color&&b.push(a.color.Y);this.parent.gb(this.ua,b.join(","))}},dd:function(a){return a?
| |
- | a.X.map(function(b){return b.d}).join(" "):"0 0"},vd:function(a){var b=this.e,c=this.s.o(),d=c.h;c=c.f;var e;if(a!=="border-box")if((e=this.g.w.j())&&(e=e.J)){d-=e.l.a(b)+e.l.a(b);c-=e.t.a(b)+e.b.a(b)}if(a==="content-box"){a=f.n;e=b.currentStyle;d-=a(e.paddingLeft).a(b)+a(e.paddingRight).a(b);c-=a(e.paddingTop).a(b)+a(e.paddingBottom).a(b)}return{h:d,f:c}},xd:function(a,b,c){var d=this.e,e=a.ca,g=e.length,j=f.Na.gc(d,b,c,a);a=j.xc;var i=j.yc,h=j.td,k=j.ud;j=j.rc;var n,m,p,r,t;n=[];for(m=0;m<g;m++)n.push(e[m].db?
| |
- | e[m].db.a(d,j):m===0?0:m===g-1?j:null);for(m=1;m<g;m++)if(n[m]===null){r=n[m-1];p=m;do t=n[++p];while(t===null);n[m]=r+(t-r)/(p-m+1)}b=['<svg width="'+b+'" height="'+c+'" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient id="g" gradientUnits="userSpaceOnUse" x1="'+a/b*100+'%" y1="'+i/c*100+'%" x2="'+h/b*100+'%" y2="'+k/c*100+'%">'];for(m=0;m<g;m++)b.push('<stop offset="'+n[m]/j+'" stop-color="'+e[m].color.U(d)+'" stop-opacity="'+e[m].color.fa()+'"/>');b.push('</linearGradient></defs><rect width="100%" height="100%" fill="url(#g)"/></svg>');
| |
- | return b.join("")},m:function(){this.parent.gb(this.ua)}});f.Nc=f.u.R({T:"repeat",Sc:"stretch",Qc:"round",ua:0,Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){var a=this,b=a.g.q.j(),c=a.g.w.j(),d=a.s.o(),e=b.repeat,g=e.f,j=e.Ob,i=a.e,h=0;f.p.Rb(b.src,function(k){function n(Q,R,U,V,W,Y,X,S,w,A){K.push('<pattern patternUnits="userSpaceOnUse" id="pattern'+G+'" x="'+(g===l?Q+U/2-w/2:Q)+'" y="'+(j===l?R+V/2-A/2:R)+'" width="'+w+'" height="'+A+'"><svg width="'+w+'" height="'+
| |
- | A+'" viewBox="'+W+" "+Y+" "+X+" "+S+'" preserveAspectRatio="none"><image xlink:href="'+v+'" x="0" y="0" width="'+r+'" height="'+t+'" /></svg></pattern>');J.push('<rect x="'+Q+'" y="'+R+'" width="'+U+'" height="'+V+'" fill="url(#pattern'+G+')" />');G++}var m=d.h,p=d.f,r=k.h,t=k.f,v=a.Dd(b.src,r,t),l=a.T,q=a.Sc;k=a.Qc;var s=Math.ceil,o=f.n("0"),u=b.J||(c?c.J:{t:o,r:o,b:o,l:o});o=u.t.a(i);var x=u.r.a(i),y=u.b.a(i);u=u.l.a(i);var z=b.slice,B=z.t.a(i),E=z.r.a(i),D=z.b.a(i);z=z.l.a(i);var C=m-u-x,F=p-o-
| |
- | y,O=r-z-E,H=t-B-D,M=g===q?C:O*o/B,P=j===q?F:H*x/E,I=g===q?C:O*y/D;q=j===q?F:H*u/z;var K=[],J=[],G=0;if(g===k){M-=(M-(C%M||M))/s(C/M);I-=(I-(C%I||I))/s(C/I)}if(j===k){P-=(P-(F%P||P))/s(F/P);q-=(q-(F%q||q))/s(F/q)}k=['<svg width="'+m+'" height="'+p+'" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'];n(0,0,u,o,0,0,z,B,u,o);n(u,0,C,o,z,0,O,B,M,o);n(m-x,0,x,o,r-E,0,E,B,x,o);n(0,o,u,F,0,B,z,H,u,q);if(b.fill)n(u,o,C,F,z,B,O,H,M||I||O,q||P||H);n(m-x,o,x,F,r-E,B,E,H,x,P);n(0,
| |
- | p-y,u,y,0,t-D,z,D,u,y);n(u,p-y,C,y,z,t-D,O,D,I,y);n(m-x,p-y,x,y,r-E,t-D,E,D,x,y);k.push("<defs>"+K.join("\n")+"</defs>"+J.join("\n")+"</svg>");a.parent.gb(a.ua,"url(data:image/svg+xml,"+escape(k.join(""))+") no-repeat border-box border-box");h&&a.parent.ab()},a);h=1},Dd:function(){var a={};return function(b,c,d){var e=a[b],g;if(!e){e=new Image;g=doc.createElement("canvas");e.src=b;g.width=c;g.height=d;g.getContext("2d").drawImage(e,0,0);e=a[b]=g.toDataURL()}return e}}(),Ea:f.Tb.prototype.Ea,m:function(){var a=
| |
- | this.e.runtimeStyle;this.parent.gb(this.ua);a.borderColor=a.borderStyle=a.borderWidth=""}});f.kb=function(){function a(l,q){l.className+=" "+q}function b(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;)a(l,q[s])},0)}function c(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;){var o=q[s];o=t[o]||(t[o]=new RegExp("\\b"+o+"\\b","g"));l.className=l.className.replace(o,"")}},0)}function d(l){function q(){if(!U){var w,A,L=f.ja,T=l.currentStyle,
| |
- | N=T.getAttribute(g)==="true",da=T.getAttribute(i)!=="false",ea=T.getAttribute(h)!=="false";S=T.getAttribute(j);S=L>7?S!=="false":S==="true";if(!R){R=1;l.runtimeStyle.zoom=1;T=l;for(var fa=1;T=T.previousSibling;)if(T.nodeType===1){fa=0;break}fa&&a(l,p)}J.cb();if(N&&(A=J.o())&&(w=doc.documentElement||doc.body)&&(A.y>w.clientHeight||A.x>w.clientWidth||A.y+A.f<0||A.x+A.h<0)){if(!Y){Y=1;f.mb.ba(q)}}else{U=1;Y=R=0;f.mb.Ha(q);if(L===9){G={C:new f.Sb(l),q:new f.Ub(l),w:new f.Vb(l)};Q=[G.C,G.q];K=new f.Oc(l,
| |
- | J,G);w=[new f.Mc(l,J,G,K),new f.Nc(l,J,G,K)]}else{G={C:new f.Sb(l),w:new f.Vb(l),q:new f.Ub(l),G:new f.jb(l),ga:new f.Ic(l),Pb:new f.Uc(l)};Q=[G.C,G.w,G.q,G.G,G.ga,G.Pb];K=new f.Rc(l,J,G);w=[new f.Hc(l,J,G,K),new f.Fc(l,J,G,K),new f.Gc(l,J,G,K),new f.Tb(l,J,G,K)];l.tagName==="IMG"&&w.push(new f.Pc(l,J,G,K));K.ed=w}I=[K].concat(w);if(w=l.currentStyle.getAttribute(f.F+"watch-ancestors")){w=parseInt(w,10);A=0;for(N=l.parentNode;N&&(w==="NaN"||A++<w);){H(N,"onpropertychange",C);H(N,"onmouseenter",x);
| |
- | H(N,"onmouseleave",y);H(N,"onmousedown",z);if(N.tagName in f.fc){H(N,"onfocus",E);H(N,"onblur",D)}N=N.parentNode}}if(S){f.Oa.ba(o);f.Oa.Rd()}o(1)}if(!V){V=1;L<9&&H(l,"onmove",s);H(l,"onresize",s);H(l,"onpropertychange",u);ea&&H(l,"onmouseenter",x);if(ea||da)H(l,"onmouseleave",y);da&&H(l,"onmousedown",z);if(l.tagName in f.fc){H(l,"onfocus",E);H(l,"onblur",D)}f.Qa.ba(s);f.L.ba(M)}J.hb()}}function s(){J&&J.Ad()&&o()}function o(w){if(!X)if(U){var A,L=I.length;F();for(A=0;A<L;A++)I[A].Ea();if(w||J.Od())for(A=
| |
- | 0;A<L;A++)I[A].ib();if(w||J.Td())for(A=0;A<L;A++)I[A].Mb();K.ab();O()}else R||q()}function u(){var w,A=I.length,L;w=event;if(!X&&!(w&&w.propertyName in r))if(U){F();for(w=0;w<A;w++)I[w].Ea();for(w=0;w<A;w++){L=I[w];L.Cb||L.ib();L.Q()&&L.Lb()}K.ab();O()}else R||q()}function x(){b(l,k)}function y(){c(l,k,n)}function z(){b(l,n);f.lb.ba(B)}function B(){c(l,n);f.lb.Ha(B)}function E(){b(l,m)}function D(){c(l,m)}function C(){var w=event.propertyName;if(w==="className"||w==="id")u()}function F(){J.cb();for(var w=
| |
- | Q.length;w--;)Q[w].cb()}function O(){for(var w=Q.length;w--;)Q[w].hb();J.hb()}function H(w,A,L){w.attachEvent(A,L);W.push([w,A,L])}function M(){if(V){for(var w=W.length,A;w--;){A=W[w];A[0].detachEvent(A[1],A[2])}f.L.Ha(M);V=0;W=[]}}function P(){if(!X){var w,A;M();X=1;if(I){w=0;for(A=I.length;w<A;w++){I[w].ec=1;I[w].m()}}S&&f.Oa.Ha(o);f.Qa.Ha(o);I=J=G=Q=l=null}}var I,K,J=new ha(l),G,Q,R,U,V,W=[],Y,X,S;this.Ed=q;this.update=o;this.m=P;this.qd=l}var e={},g=f.F+"lazy-init",j=f.F+"poll",i=f.F+"track-active",
| |
- | h=f.F+"track-hover",k=f.La+"hover",n=f.La+"active",m=f.La+"focus",p=f.La+"first-child",r={background:1,bgColor:1,display:1},t={},v=[];d.yd=function(l){var q=f.p.Ba(l);return e[q]||(e[q]=new d(l))};d.m=function(l){l=f.p.Ba(l);var q=e[l];if(q){q.m();delete e[l]}};d.md=function(){var l=[],q;if(e){for(var s in e)if(e.hasOwnProperty(s)){q=e[s];l.push(q.qd);q.m()}e={}}return l};return d}();f.supportsVML=f.zc;f.attach=function(a){f.ja<10&&f.zc&&f.kb.yd(a).Ed()};f.detach=function(a){f.kb.m(a)}};
| |
- | var $=element;function init(){if(doc.media!=="print"){var a=window.PIE;a&&a.attach($)}}function cleanup(){if(doc.media!=="print"){var a=window.PIE;if(a){a.detach($);$=0}}}$.readyState==="complete"&&init();
| |
- | </script>
| |
- |
| |
- | </PUBLIC:COMPONENT>
| |
- |
| |
- | body.mediawiki {
| |
- | margin-top: -20px;
| |
- | }
| |
- |
| |
- | .container_24{
| |
- | margin-left:auto;
| |
- | margin-right:auto;
| |
- | width:960px
| |
- | }
| |
- |
| |
- | .grid_1,.grid_2,.grid_3,.grid_4,.grid_5,.grid_6,.grid_7,.grid_8,.grid_9,.grid_10,.grid_11,.grid_12,.grid_13,.grid_14,.grid_15,.grid_16,.grid_17,.grid_18,.grid_19,.grid_20,.grid_21,.grid_22,.grid_23,.grid_24{
| |
- | display:inline;
| |
- | float:left;
| |
- | margin-left:5px;
| |
- | margin-right:5px
| |
- | }
| |
- |
| |
- | .push_1,.pull_1,.push_2,.pull_2,.push_3,.pull_3,.push_4,.pull_4,.push_5,.pull_5,.push_6,.pull_6,.push_7,.pull_7,.push_8,.pull_8,.push_9,.pull_9,.push_10,.pull_10,.push_11,.pull_11,.push_12,.pull_12,.push_13,.pull_13,.push_14,.pull_14,.push_15,.pull_15,.push_16,.pull_16,.push_17,.pull_17,.push_18,.pull_18,.push_19,.pull_19,.push_20,.pull_20,.push_21,.pull_21,.push_22,.pull_22,.push_23,.pull_23{
| |
- | position:relative
| |
- | }
| |
- |
| |
- | .alpha{
| |
- | margin-left:0
| |
- | }
| |
- |
| |
- | .omega{
| |
- | margin-right:0
| |
- | }
| |
- |
| |
- | .container_24 .grid_1{
| |
- | width:30px
| |
- | }
| |
- |
| |
- | .container_24 .grid_2{
| |
- | width:70px
| |
- | }
| |
- |
| |
- | .container_24 .grid_3{
| |
- | width:110px
| |
- | }
| |
- |
| |
- | .container_24 .grid_4{
| |
- | width:150px
| |
- | }
| |
- |
| |
- | .container_24 .grid_5{
| |
- | width:190px
| |
- | }
| |
- |
| |
- | .container_24 .grid_6{
| |
- | width:230px
| |
- | }
| |
- |
| |
- | .container_24 .grid_7{
| |
- | width:270px
| |
- | }
| |
- |
| |
- | .container_24 .grid_8{
| |
- | width:310px
| |
- | }
| |
- |
| |
- | .container_24 .grid_9{
| |
- | width:350px
| |
- | }
| |
- |
| |
- | .container_24 .grid_10{
| |
- | width:390px
| |
- | }
| |
- |
| |
- | .container_24 .grid_11{
| |
- | width:430px
| |
- | }
| |
- |
| |
- | .container_24 .grid_12{
| |
- | width:470px
| |
- | }
| |
- |
| |
- | .container_24 .grid_13{
| |
- | width:510px
| |
- | }
| |
- |
| |
- | .container_24 .grid_14{
| |
- | width:550px
| |
- | }
| |
- |
| |
- | .container_24 .grid_15{
| |
- | width:590px
| |
- | }
| |
- |
| |
- | .container_24 .grid_16{
| |
- | width:630px
| |
- | }
| |
- |
| |
- | .container_24 .grid_17{
| |
- | width:670px
| |
- | }
| |
- |
| |
- | .container_24 .grid_18{
| |
- | width:710px
| |
- | }
| |
- |
| |
- | .container_24 .grid_19{
| |
- | width:750px
| |
- | }
| |
- |
| |
- | .container_24 .grid_20{
| |
- | width:790px
| |
- | }
| |
- |
| |
- | .container_24 .grid_21{
| |
- | width:830px
| |
- | }
| |
- |
| |
- | .container_24 .grid_22{
| |
- | width:870px
| |
- | }
| |
- |
| |
- | .container_24 .grid_23{
| |
- | width:910px
| |
- | }
| |
- |
| |
- | .container_24 .grid_24{
| |
- | width:950px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_1{
| |
- | padding-left:40px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_2{
| |
- | padding-left:80px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_3{
| |
- | padding-left:120px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_4{
| |
- | padding-left:160px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_5{
| |
- | padding-left:200px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_6{
| |
- | padding-left:240px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_7{
| |
- | padding-left:280px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_8{
| |
- | padding-left:320px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_9{
| |
- | padding-left:360px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_10{
| |
- | padding-left:400px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_11{
| |
- | padding-left:440px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_12{
| |
- | padding-left:480px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_13{
| |
- | padding-left:520px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_14{
| |
- | padding-left:560px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_15{
| |
- | padding-left:600px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_16{
| |
- | padding-left:640px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_17{
| |
- | padding-left:680px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_18{
| |
- | padding-left:720px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_19{
| |
- | padding-left:760px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_20{
| |
- | padding-left:800px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_21{
| |
- | padding-left:840px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_22{
| |
- | padding-left:880px
| |
- | }
| |
- |
| |
- | .container_24 .prefix_23{
| |
- | padding-left:920px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_1{
| |
- | padding-right:40px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_2{
| |
- | padding-right:80px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_3{
| |
- | padding-right:120px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_4{
| |
- | padding-right:160px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_5{
| |
- | padding-right:200px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_6{
| |
- | padding-right:240px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_7{
| |
- | padding-right:280px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_8{
| |
- | padding-right:320px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_9{
| |
- | padding-right:360px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_10{
| |
- | padding-right:400px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_11{
| |
- | padding-right:440px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_12{
| |
- | padding-right:480px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_13{
| |
- | padding-right:520px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_14{
| |
- | padding-right:560px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_15{
| |
- | padding-right:600px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_16{
| |
- | padding-right:640px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_17{
| |
- | padding-right:680px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_18{
| |
- | padding-right:720px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_19{
| |
- | padding-right:760px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_20{
| |
- | padding-right:800px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_21{
| |
- | padding-right:840px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_22{
| |
- | padding-right:880px
| |
- | }
| |
- |
| |
- | .container_24 .suffix_23{
| |
- | padding-right:920px
| |
- | }
| |
- |
| |
- | .container_24 .push_1{
| |
- | left:40px
| |
- | }
| |
- |
| |
- | .container_24 .push_2{
| |
- | left:80px
| |
- | }
| |
- |
| |
- | .container_24 .push_3{
| |
- | left:120px
| |
- | }
| |
- |
| |
- | .container_24 .push_4{
| |
- | left:160px
| |
- | }
| |
- |
| |
- | .container_24 .push_5{
| |
- | left:200px
| |
- | }
| |
- |
| |
- | .container_24 .push_6{
| |
- | left:240px
| |
- | }
| |
- |
| |
- | .container_24 .push_7{
| |
- | left:280px
| |
- | }
| |
- |
| |
- | .container_24 .push_8{
| |
- | left:320px
| |
- | }
| |
- |
| |
- | .container_24 .push_9{
| |
- | left:360px
| |
- | }
| |
- |
| |
- | .container_24 .push_10{
| |
- | left:400px
| |
- | }
| |
- |
| |
- | .container_24 .push_11{
| |
- | left:440px
| |
- | }
| |
- |
| |
- | .container_24 .push_12{
| |
- | left:480px
| |
- | }
| |
- |
| |
- | .container_24 .push_13{
| |
- | left:520px
| |
- | }
| |
- |
| |
- | .container_24 .push_14{
| |
- | left:560px
| |
- | }
| |
- |
| |
- | .container_24 .push_15{
| |
- | left:600px
| |
- | }
| |
- |
| |
- | .container_24 .push_16{
| |
- | left:640px
| |
- | }
| |
- |
| |
- | .container_24 .push_17{
| |
- | left:680px
| |
- | }
| |
- |
| |
- | .container_24 .push_18{
| |
- | left:720px
| |
- | }
| |
- |
| |
- | .container_24 .push_19{
| |
- | left:760px
| |
- | }
| |
- |
| |
- | .container_24 .push_20{
| |
- | left:800px
| |
- | }
| |
- |
| |
- | .container_24 .push_21{
| |
- | left:840px
| |
- | }
| |
- |
| |
- | .container_24 .push_22{
| |
- | left:880px
| |
- | }
| |
- |
| |
- | .container_24 .push_23{
| |
- | left:920px
| |
- | }
| |
- |
| |
- | .container_24 .pull_1{
| |
- | left:-40px
| |
- | }
| |
- |
| |
- | .container_24 .pull_2{
| |
- | left:-80px
| |
- | }
| |
- |
| |
- | .container_24 .pull_3{
| |
- | left:-120px
| |
- | }
| |
- |
| |
- | .container_24 .pull_4{
| |
- | left:-160px
| |
- | }
| |
- |
| |
- | .container_24 .pull_5{
| |
- | left:-200px
| |
- | }
| |
- |
| |
- | .container_24 .pull_6{
| |
- | left:-240px
| |
- | }
| |
- |
| |
- | .container_24 .pull_7{
| |
- | left:-280px
| |
- | }
| |
- |
| |
- | .container_24 .pull_8{
| |
- | left:-320px
| |
- | }
| |
- |
| |
- | .container_24 .pull_9{
| |
- | left:-360px
| |
- | }
| |
- |
| |
- | .container_24 .pull_10{
| |
- | left:-400px
| |
- | }
| |
- |
| |
- | .container_24 .pull_11{
| |
- | left:-440px
| |
- | }
| |
- |
| |
- | .container_24 .pull_12{
| |
- | left:-480px
| |
- | }
| |
- |
| |
- | .container_24 .pull_13{
| |
- | left:-520px
| |
- | }
| |
- |
| |
- | .container_24 .pull_14{
| |
- | left:-560px
| |
- | }
| |
- |
| |
- | .container_24 .pull_15{
| |
- | left:-600px
| |
- | }
| |
- |
| |
- | .container_24 .pull_16{
| |
- | left:-640px
| |
- | }
| |
- |
| |
- | .container_24 .pull_17{
| |
- | left:-680px
| |
- | }
| |
- |
| |
- | .container_24 .pull_18{
| |
- | left:-720px
| |
- | }
| |
- |
| |
- | .container_24 .pull_19{
| |
- | left:-760px
| |
- | }
| |
- |
| |
- | .container_24 .pull_20{
| |
- | left:-800px
| |
- | }
| |
- |
| |
- | .container_24 .pull_21{
| |
- | left:-840px
| |
- | }
| |
- |
| |
- | .container_24 .pull_22{
| |
- | left:-880px
| |
- | }
| |
- |
| |
- | .container_24 .pull_23{
| |
- | left:-920px
| |
- | }
| |
- |
| |
- | .clear{
| |
- | clear:both;
| |
- | display:block;
| |
- | overflow:hidden;
| |
- | visibility:hidden;
| |
- | width:0;
| |
- | height:0
| |
- | }
| |
- |
| |
- | .clearfix:before,.clearfix:after,.container_24:before,.container_24:after{
| |
- | content:'.';
| |
- | display:block;
| |
- | overflow:hidden;
| |
- | visibility:hidden;
| |
- | font-size:0;
| |
- | line-height:0;
| |
- | width:0;
| |
- | height:0
| |
- | }
| |
- |
| |
- | .clearfix:after,.container_24:after{
| |
- | clear:both
| |
- | }
| |
- |
| |
- | .clearfix,.container_24{
| |
- | zoom:1
| |
- | }
| |
- |
| |
- |
| |
- | #mmswf543e99c71a2aa {
| |
- | margin-left: 10%;
| |
- | margin-right: 10%;
| |
- |
| |
- | }
| |
- |
| |
- | body {
| |
- | font-family: Arial,sans-serif;
| |
- | }
| |
- |
| |
- |
| |
- | .small, .contentcenter {
| |
- |
| |
- | width: 650px;
| |
- | margin: 0 auto;
| |
- | margin-left: 10%;
| |
- |
| |
- | }
| |
- |
| |
- | .small img, .contentcenter img {
| |
- | display: inline;
| |
- | margin: 0 auto;
| |
- | }
| |
- |
| |
- | .small p, .contentcenter p {
| |
- | font-size: 17px;
| |
- | color: grey;
| |
- | text-align: right;
| |
- |
| |
- | }
| |
- |
| |
- | .small {
| |
- | width: 400px;
| |
- | }
| |
- |
| |
- | .contentright {
| |
- |
| |
- | float: right;
| |
- | margin: 0 20px 0 40px;
| |
- |
| |
- | }
| |
- |
| |
- | .team {
| |
- | color: black;
| |
- | }
| |
- |
| |
- | .team li:hover {
| |
- | background-color: light-grey;
| |
- | opacity: 0.6;
| |
- |
| |
- | }
| |
- |
| |
- | .team li {
| |
- |
| |
- | padding-top: 25px;
| |
- | padding-bottom: 25px;
| |
- | border-top: 1px solid lightgrey;
| |
- | list-style: none;
| |
- | margin-bottom: 80px;
| |
- |
| |
- | }
| |
- |
| |
- | .team li img {
| |
- |
| |
- | float: right;
| |
- | margin-top: 0px;
| |
- | margin-left: 30px;
| |
- | margin-right: -90px;
| |
- | }
| |
- |
| |
- |
| |
- | .team li p, .team li b {
| |
- | width: 650px;
| |
- | }
| |
- |
| |
- |
| |
- | #gallery li {
| |
- | list-style: none;
| |
- | display: inline;
| |
- |
| |
- |
| |
- | }
| |
- |
| |
- | #gallery li img {
| |
- | width: 300px;
| |
- | margin: 20px 20px 20px 20px;
| |
- | -webkit-box-shadow: 0px 0px 4px 1px rgba(50, 50, 50, 0.72);
| |
- | -moz-box-shadow: 0px 0px 4px 1px rgba(50, 50, 50, 0.72);
| |
- | box-shadow: 0px 0px 4px 1px rgba(50, 50, 50, 0.72);
| |
- | }
| |
- |
| |
- | #gallery li img:hover {
| |
- | opacity: 0.7;
| |
- | }
| |
- |
| |
- | /* Preload images */
| |
- | body:after {
| |
- | content: url(https://static.igem.org/mediawiki/2014/6/65/TuDarmstadtLightboxClose.png) url(https://static.igem.org/mediawiki/2014/4/47/TuDarmstadtLightboxLoading.gif) url(https://static.igem.org/mediawiki/2014/8/8a/TuDarmstadtLightboxPrev.png) url(https://static.igem.org/mediawiki/2014/a/ad/TuDarmstadtLightboxNext.png);
| |
- | display: none;
| |
- | }
| |
- |
| |
- | .lightboxOverlay {
| |
- | position: absolute;
| |
- | top: 0;
| |
- | left: 0;
| |
- | z-index: 9999;
| |
- | background-color: black;
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=80);
| |
- | opacity: 0.8;
| |
- | display: none;
| |
- | }
| |
- |
| |
- | .lightbox {
| |
- | position: absolute;
| |
- | left: 0;
| |
- | width: 100%;
| |
- | z-index: 10000;
| |
- | text-align: center;
| |
- | line-height: 0;
| |
- | font-weight: normal;
| |
- | }
| |
- |
| |
- | .lightbox .lb-image {
| |
- | display: block;
| |
- | height: auto;
| |
- | max-width: inherit;
| |
- | -webkit-border-radius: 3px;
| |
- | -moz-border-radius: 3px;
| |
- | -ms-border-radius: 3px;
| |
- | -o-border-radius: 3px;
| |
- | border-radius: 3px;
| |
- | }
| |
- |
| |
- | .lightbox a img {
| |
- | border: none;
| |
- | }
| |
- |
| |
- | .lb-outerContainer {
| |
- | position: relative;
| |
- | background-color: white;
| |
- | *zoom: 1;
| |
- | width: 250px;
| |
- | height: 250px;
| |
- | margin: 0 auto;
| |
- | -webkit-border-radius: 4px;
| |
- | -moz-border-radius: 4px;
| |
- | -ms-border-radius: 4px;
| |
- | -o-border-radius: 4px;
| |
- | border-radius: 4px;
| |
- | }
| |
- |
| |
- | .lb-outerContainer:after {
| |
- | content: "";
| |
- | display: table;
| |
- | clear: both;
| |
- | }
| |
- |
| |
- | .lb-container {
| |
- | padding: 4px;
| |
- | }
| |
- |
| |
- | .lb-loader {
| |
- | position: absolute;
| |
- | top: 43%;
| |
- | left: 0;
| |
- | height: 25%;
| |
- | width: 100%;
| |
- | text-align: center;
| |
- | line-height: 0;
| |
- | }
| |
- |
| |
- | .lb-cancel {
| |
- | display: block;
| |
- | width: 32px;
| |
- | height: 32px;
| |
- | margin: 0 auto;
| |
- | background: url(https://static.igem.org/mediawiki/2014/4/47/TuDarmstadtLightboxLoading.gif) no-repeat;
| |
- | }
| |
- |
| |
- | .lb-nav {
| |
- | position: absolute;
| |
- | top: 0;
| |
- | left: 0;
| |
- | height: 100%;
| |
- | width: 100%;
| |
- | z-index: 10;
| |
- | }
| |
- |
| |
- | .lb-container > .nav {
| |
- | left: 0;
| |
- | }
| |
- |
| |
- | .lb-nav a {
| |
- | outline: none;
| |
- | background-image: url('data:image/gif;base64,R0lGODlhAQABAPAAAP///wAAACH5BAEAAAAALAAAAAABAAEAAAICRAEAOw==');
| |
- | }
| |
- |
| |
- | .lb-prev, .lb-next {
| |
- | height: 100%;
| |
- | cursor: pointer;
| |
- | display: block;
| |
- | }
| |
- |
| |
- | .lb-nav a.lb-prev {
| |
- | width: 34%;
| |
- | left: 0;
| |
- | float: left;
| |
- | background: url(https://static.igem.org/mediawiki/2014/8/8a/TuDarmstadtLightboxPrev.png) left 48% no-repeat;
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=0);
| |
- | opacity: 0;
| |
- | -webkit-transition: opacity 0.6s;
| |
- | -moz-transition: opacity 0.6s;
| |
- | -o-transition: opacity 0.6s;
| |
- | transition: opacity 0.6s;
| |
- | }
| |
- |
| |
- | .lb-nav a.lb-prev:hover {
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=100);
| |
- | opacity: 1;
| |
- | }
| |
- |
| |
- | .lb-nav a.lb-next {
| |
- | width: 64%;
| |
- | right: 0;
| |
- | float: right;
| |
- | background: url(https://static.igem.org/mediawiki/2014/a/ad/TuDarmstadtLightboxNext.png) right 48% no-repeat;
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=0);
| |
- | opacity: 0;
| |
- | -webkit-transition: opacity 0.6s;
| |
- | -moz-transition: opacity 0.6s;
| |
- | -o-transition: opacity 0.6s;
| |
- | transition: opacity 0.6s;
| |
- | }
| |
- |
| |
- | .lb-nav a.lb-next:hover {
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=100);
| |
- | opacity: 1;
| |
- | }
| |
- |
| |
- | .lb-dataContainer {
| |
- | margin: 0 auto;
| |
- | padding-top: 5px;
| |
- | *zoom: 1;
| |
- | width: 100%;
| |
- | -moz-border-radius-bottomleft: 4px;
| |
- | -webkit-border-bottom-left-radius: 4px;
| |
- | border-bottom-left-radius: 4px;
| |
- | -moz-border-radius-bottomright: 4px;
| |
- | -webkit-border-bottom-right-radius: 4px;
| |
- | border-bottom-right-radius: 4px;
| |
- | }
| |
- |
| |
- | .lb-dataContainer:after {
| |
- | content: "";
| |
- | display: table;
| |
- | clear: both;
| |
- | }
| |
- |
| |
- | .lb-data {
| |
- | padding: 0 4px;
| |
- | color: #ccc;
| |
- | }
| |
- |
| |
- | .lb-data .lb-details {
| |
- | width: 85%;
| |
- | float: left;
| |
- | text-align: left;
| |
- | line-height: 1.1em;
| |
- | }
| |
- |
| |
- | .lb-data .lb-caption {
| |
- | font-size: 13px;
| |
- | font-weight: bold;
| |
- | line-height: 1em;
| |
- | }
| |
- |
| |
- | .lb-data .lb-number {
| |
- | display: block;
| |
- | clear: left;
| |
- | padding-bottom: 1em;
| |
- | font-size: 12px;
| |
- | color: #999999;
| |
- | }
| |
- |
| |
- | .lb-data .lb-close {
| |
- | display: block;
| |
- | float: right;
| |
- | width: 30px;
| |
- | height: 30px;
| |
- | background: url(https://static.igem.org/mediawiki/2014/6/65/TuDarmstadtLightboxClose.png) top right no-repeat;
| |
- | text-align: right;
| |
- | outline: none;
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=70);
| |
- | opacity: 0.7;
| |
- | -webkit-transition: opacity 0.2s;
| |
- | -moz-transition: opacity 0.2s;
| |
- | -o-transition: opacity 0.2s;
| |
- | transition: opacity 0.2s;
| |
- | }
| |
- |
| |
- | .lb-data .lb-close:hover {
| |
- | cursor: pointer;
| |
- | filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=100);
| |
- | opacity: 1;
| |
- | }
| |
- |
| |
- |
| |
- |
| |
- | </style>
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | <script src="//ajax.googleapis.com/ajax/libs/jquery/1.9.1/jquery.min.js" type="text/javascript"></script>
| |
- |
| |
- | <script src="http://ajax.googleapis.com/ajax/libs/jquery/1.9.1/jquery.min.js" type="text/javascript"></script>
| |
- |
| |
- |
| |
- | <script type="text/javascript">
| |
- | (function() {
| |
- | var supports = (function() {
| |
- | var supports = {};
| |
- |
| |
- | var html;
| |
- | var work = this.document.createElement('div');
| |
- |
| |
- | html = "<P><I></P></I>";
| |
- | work.innerHTML = html;
| |
- | supports.tagSoup = work.innerHTML !== html;
| |
- |
| |
- | work.innerHTML = "<P><i><P></P></i></P>";
| |
- | supports.selfClose = work.childNodes.length === 2;
| |
- |
| |
- | return supports;
| |
- | })();
| |
- |
| |
- |
| |
- |
| |
- | // Regular Expressions for parsing tags and attributes
| |
- | var startTag = /^<([\-A-Za-z0-9_]+)((?:\s+[\w\-]+(?:\s*=\s*(?:(?:"[^"]*")|(?:'[^']*')|[^>\s]+))?)*)\s*(\/?)>/;
| |
- | var endTag = /^<\/([\-A-Za-z0-9_]+)[^>]*>/;
| |
- | var attr = /([\-A-Za-z0-9_]+)(?:\s*=\s*(?:(?:"((?:\\.|[^"])*)")|(?:'((?:\\.|[^'])*)')|([^>\s]+)))?/g;
| |
- | var fillAttr = /^(checked|compact|declare|defer|disabled|ismap|multiple|nohref|noresize|noshade|nowrap|readonly|selected)$/i;
| |
- |
| |
- | var DEBUG = false;
| |
- |
| |
- | function htmlParser(stream, options) {
| |
- | stream = stream || '';
| |
- |
| |
- | // Options
| |
- | options = options || {};
| |
- |
| |
- | for(var key in supports) {
| |
- | if(supports.hasOwnProperty(key)) {
| |
- | if(options.autoFix) {
| |
- | options['fix_'+key] = true;//!supports[key];
| |
- | }
| |
- | options.fix = options.fix || options['fix_'+key];
| |
- | }
| |
- | }
| |
- |
| |
- | var stack = [];
| |
- |
| |
- | var append = function(str) {
| |
- | stream += str;
| |
- | };
| |
- |
| |
- | var prepend = function(str) {
| |
- | stream = str + stream;
| |
- | };
| |
- |
| |
- | // Order of detection matters: detection of one can only
| |
- | // succeed if detection of previous didn't
| |
- | var detect = {
| |
- | comment: /^<!--/,
| |
- | endTag: /^<\//,
| |
- | atomicTag: /^<\s*(script|style|noscript|iframe|textarea)[\s>]/i,
| |
- | startTag: /^</,
| |
- | chars: /^[^<]/
| |
- | };
| |
- |
| |
- | // Detection has already happened when a reader is called.
| |
- | var reader = {
| |
- |
| |
- | comment: function() {
| |
- | var index = stream.indexOf("-->");
| |
- | if ( index >= 0 ) {
| |
- | return {
| |
- | content: stream.substr(4, index),
| |
- | length: index + 3
| |
- | };
| |
- | }
| |
- | },
| |
- |
| |
- | endTag: function() {
| |
- | var match = stream.match( endTag );
| |
- |
| |
- | if ( match ) {
| |
- | return {
| |
- | tagName: match[1],
| |
- | length: match[0].length
| |
- | };
| |
- | }
| |
- | },
| |
- |
| |
- | atomicTag: function() {
| |
- | var start = reader.startTag();
| |
- | if(start) {
| |
- | var rest = stream.slice(start.length);
| |
- | // for optimization, we check first just for the end tag
| |
- | if(rest.match(new RegExp("<\/\\s*" + start.tagName + "\\s*>", "i"))) {
| |
- | // capturing the content is inefficient, so we do it inside the if
| |
- | var match = rest.match(new RegExp("([\\s\\S]*?)<\/\\s*" + start.tagName + "\\s*>", "i"));
| |
- | if(match) {
| |
- | // good to go
| |
- | return {
| |
- | tagName: start.tagName,
| |
- | attrs: start.attrs,
| |
- | content: match[1],
| |
- | length: match[0].length + start.length
| |
- | };
| |
- | }
| |
- | }
| |
- | }
| |
- | },
| |
- |
| |
- | startTag: function() {
| |
- | var match = stream.match( startTag );
| |
- |
| |
- | if ( match ) {
| |
- | var attrs = {};
| |
- |
| |
- | match[2].replace(attr, function(match, name) {
| |
- | var value = arguments[2] || arguments[3] || arguments[4] ||
| |
- | fillAttr.test(name) && name || null;
| |
- |
| |
- | attrs[name] = value;
| |
- | });
| |
- |
| |
- | return {
| |
- | tagName: match[1],
| |
- | attrs: attrs,
| |
- | unary: !!match[3],
| |
- | length: match[0].length
| |
- | };
| |
- | }
| |
- | },
| |
- |
| |
- | chars: function() {
| |
- | var index = stream.indexOf("<");
| |
- | return {
| |
- | length: index >= 0 ? index : stream.length
| |
- | };
| |
- | }
| |
- | };
| |
- |
| |
- | var readToken = function() {
| |
- |
| |
- | // Enumerate detects in order
| |
- | for (var type in detect) {
| |
- |
| |
- | if(detect[type].test(stream)) {
| |
- | if(DEBUG) { console.log('suspected ' + type); }
| |
- |
| |
- | var token = reader[type]();
| |
- | if(token) {
| |
- | if(DEBUG) { console.log('parsed ' + type, token); }
| |
- | // Type
| |
- | token.type = token.type || type;
| |
- | // Entire text
| |
- | token.text = stream.substr(0, token.length);
| |
- | // Update the stream
| |
- | stream = stream.slice(token.length);
| |
- |
| |
- | return token;
| |
- | }
| |
- | return null;
| |
- | }
| |
- | }
| |
- | };
| |
- |
| |
- | var readTokens = function(handlers) {
| |
- | var tok;
| |
- | while(tok = readToken()) {
| |
- | // continue until we get an explicit "false" return
| |
- | if(handlers[tok.type] && handlers[tok.type](tok) === false) {
| |
- | return;
| |
- | }
| |
- | }
| |
- | };
| |
- |
| |
- | var clear = function() {
| |
- | var rest = stream;
| |
- | stream = '';
| |
- | return rest;
| |
- | };
| |
- |
| |
- | var rest = function() {
| |
- | return stream;
| |
- | };
| |
- |
| |
- | if(options.fix) {
| |
- | (function() {
| |
- | // Empty Elements - HTML 4.01
| |
- | var EMPTY = /^(AREA|BASE|BASEFONT|BR|COL|FRAME|HR|IMG|INPUT|ISINDEX|LINK|META|PARAM|EMBED)$/i;
| |
- |
| |
- | // Elements that you can| intentionally| leave open
| |
- | // (and which close themselves)
| |
- | var CLOSESELF = /^(COLGROUP|DD|DT|LI|OPTIONS|P|TD|TFOOT|TH|THEAD|TR)$/i;
| |
- |
| |
- |
| |
- | var stack = [];
| |
- | stack.last = function() {
| |
- | return this[this.length - 1];
| |
- | };
| |
- | stack.lastTagNameEq = function(tagName) {
| |
- | var last = this.last();
| |
- | return last && last.tagName &&
| |
- | last.tagName.toUpperCase() === tagName.toUpperCase();
| |
- | };
| |
- |
| |
- | stack.containsTagName = function(tagName) {
| |
- | for(var i = 0, tok; tok = this[i]; i++) {
| |
- | if(tok.tagName === tagName) {
| |
- | return true;
| |
- | }
| |
- | }
| |
- | return false;
| |
- | };
| |
- |
| |
- | var correct = function(tok) {
| |
- | if(tok && tok.type === 'startTag') {
| |
- | // unary
| |
- | tok.unary = EMPTY.test(tok.tagName) || tok.unary;
| |
- | }
| |
- | return tok;
| |
- | };
| |
- |
| |
- | var readTokenImpl = readToken;
| |
- |
| |
- | var peekToken = function() {
| |
- | var tmp = stream;
| |
- | var tok = correct(readTokenImpl());
| |
- | stream = tmp;
| |
- | return tok;
| |
- | };
| |
- |
| |
- | var closeLast = function() {
| |
- | var tok = stack.pop();
| |
- |
| |
- | // prepend close tag to stream.
| |
- | prepend('</'+tok.tagName+'>');
| |
- | };
| |
- |
| |
- | var handlers = {
| |
- | startTag: function(tok) {
| |
- | var tagName = tok.tagName;
| |
- | // Fix tbody
| |
- | if(tagName.toUpperCase() === 'TR' && stack.lastTagNameEq('TABLE')) {
| |
- | prepend('<TBODY>');
| |
- | prepareNextToken();
| |
- | } else if(options.fix_selfClose &&
| |
- | CLOSESELF.test(tagName) &&
| |
- | stack.containsTagName(tagName)) {
| |
- | if(stack.lastTagNameEq(tagName)) {
| |
- | closeLast();
| |
- | } else {
| |
- | prepend('</'+tok.tagName+'>');
| |
- | prepareNextToken();
| |
- | }
| |
- | } else if (!tok.unary) {
| |
- | stack.push(tok);
| |
- | }
| |
- | },
| |
- |
| |
- | endTag: function(tok) {
| |
- | var last = stack.last();
| |
- | if(last) {
| |
- | if(options.fix_tagSoup && !stack.lastTagNameEq(tok.tagName)) {
| |
- | // cleanup tag soup
| |
- | closeLast();
| |
- | } else {
| |
- | stack.pop();
| |
- | }
| |
- | } else if (options.fix_tagSoup) {
| |
- | // cleanup tag soup part 2: skip this token
| |
- | skipToken();
| |
- | }
| |
- | }
| |
- | };
| |
- |
| |
- | var skipToken = function() {
| |
- | // shift the next token
| |
- | readTokenImpl();
| |
- |
| |
- | prepareNextToken();
| |
- | };
| |
- |
| |
- | var prepareNextToken = function() {
| |
- | var tok = peekToken();
| |
- | if(tok && handlers[tok.type]) {
| |
- | handlers[tok.type](tok);
| |
- | }
| |
- | };
| |
- |
| |
- | // redefine readToken
| |
- | readToken = function() {
| |
- | prepareNextToken();
| |
- | return correct(readTokenImpl());
| |
- | };
| |
- | })();
| |
- | }
| |
- |
| |
- | return {
| |
- | append: append,
| |
- | readToken: readToken,
| |
- | readTokens: readTokens,
| |
- | clear: clear,
| |
- | rest: rest,
| |
- | stack: stack
| |
- | };
| |
- |
| |
- | }
| |
- |
| |
- | htmlParser.supports = supports;
| |
- |
| |
- | htmlParser.tokenToString = function(tok) {
| |
- | var handler = {
| |
- | comment: function(tok) {
| |
- | return '<--' + tok.content + '-->';
| |
- | },
| |
- | endTag: function(tok) {
| |
- | return '</'+tok.tagName+'>';
| |
- | },
| |
- | atomicTag: function(tok) {
| |
- | console.log(tok);
| |
- | return handler.startTag(tok) +
| |
- | tok.content +
| |
- | handler.endTag(tok);
| |
- | },
| |
- | startTag: function(tok) {
| |
- | var str = '<'+tok.tagName;
| |
- | for (var key in tok.attrs) {
| |
- | var val = tok.attrs[key];
| |
- | // escape quotes
| |
- | str += ' '+key+'="'+(val ? val.replace(/(^|[^\\])"/g, '$1\\\"') : '')+'"';
| |
- | }
| |
- | return str + (tok.unary ? '/>' : '>');
| |
- | },
| |
- | chars: function(tok) {
| |
- | return tok.text;
| |
- | }
| |
- | };
| |
- | return handler[tok.type](tok);
| |
- | };
| |
- |
| |
- | htmlParser.escapeAttributes = function(attrs) {
| |
- | var escapedAttrs = {};
| |
- | // escape double-quotes for writing html as a string
| |
- |
| |
- | for(var name in attrs) {
| |
- | var value = attrs[name];
| |
- | escapedAttrs[name] = value && value.replace(/(^|[^\\])"/g, '$1\\\"');
| |
- | }
| |
- | return escapedAttrs;
| |
- | };
| |
- |
| |
- | for(var key in supports) {
| |
- | htmlParser.browserHasFlaw = htmlParser.browserHasFlaw || (!supports[key]) && key;
| |
- | }
| |
- |
| |
- | this.htmlParser = htmlParser;
| |
- | })();
| |
- | </script>
| |
- |
| |
- |
| |
- |
| |
- | <script>
| |
- |
| |
- | // postscribe.js 1.1.2
| |
- | // (c) Copyright 2012 to the present, Krux
| |
- | // postscribe is freely distributable under the MIT license.
| |
- | // For all details and documentation:
| |
- | // http://krux.github.com/postscribe
| |
- |
| |
- |
| |
- | (function() {
| |
- |
| |
- | var global = this;
| |
- |
| |
- | if(global.postscribe) {
| |
- | return;
| |
- | }
| |
- |
| |
- | // Debug write tasks.
| |
- | var DEBUG = true;
| |
- |
| |
- | // Turn on to debug how each chunk affected the DOM.
| |
- | var DEBUG_CHUNK = false;
| |
- |
| |
- | // # Helper Functions
| |
- |
| |
- | var slice = Array.prototype.slice;
| |
- |
| |
- | // A function that intentionally does nothing.
| |
- | function doNothing() {}
| |
- |
| |
- |
| |
- | // Is this a function?
| |
- | function isFunction(x) {
| |
- | return "function" === typeof x;
| |
- | }
| |
- |
| |
- | // Loop over each item in an array-like value.
| |
- | function each(arr, fn, _this) {
| |
- | var i, len = (arr && arr.length) || 0;
| |
- | for(i = 0; i < len; i++) {
| |
- | fn.call(_this, arr[i], i);
| |
- | }
| |
- | }
| |
- |
| |
- | // Loop over each key/value pair in a hash.
| |
- | function eachKey(obj, fn, _this) {
| |
- | var key;
| |
- | for(key in obj) {
| |
- | if(obj.hasOwnProperty(key)) {
| |
- | fn.call(_this, key, obj[key]);
| |
- | }
| |
- | }
| |
- | }
| |
- |
| |
- | // Set properties on an object.
| |
- | function set(obj, props) {
| |
- | eachKey(props, function(key, value) {
| |
- | obj[key] = value;
| |
- | });
| |
- | return obj;
| |
- | }
| |
- |
| |
- | // Set default options where some option was not specified.
| |
- | function defaults(options, _defaults) {
| |
- | options = options || {};
| |
- | eachKey(_defaults, function(key, val) {
| |
- | if(options[key] == null) {
| |
- | options[key] = val;
| |
- | }
| |
- | });
| |
- | return options;
| |
- | }
| |
- |
| |
- | // Convert value (e.g., a NodeList) to an array.
| |
- | function toArray(obj) {
| |
- | try {
| |
- | return slice.call(obj);
| |
- | } catch(e) {
| |
- | var ret = [];
| |
- | each(obj, function(val) {
| |
- | ret.push(val);
| |
- | });
| |
- | return ret;
| |
- | }
| |
- | }
| |
- |
| |
- | // Test if token is a script tag.
| |
- | function isScript(tok) {
| |
- | return (/^script$/i).test(tok.tagName);
| |
- | }
| |
- |
| |
- | // # Class WriteStream
| |
- |
| |
- | // Stream static html to an element, where "static html" denotes "html without scripts".
| |
- |
| |
- | // This class maintains a *history of writes devoid of any attributes* or "proxy history".
| |
- | // Injecting the proxy history into a temporary div has no side-effects,
| |
- | // other than to create proxy elements for previously written elements.
| |
- |
| |
- | // Given the `staticHtml` of a new write, a `tempDiv`'s innerHTML is set to `proxy_history + staticHtml`.
| |
- | // The *structure* of `tempDiv`'s contents, (i.e., the placement of new nodes beside or inside of proxy elements),
| |
- | // reflects the DOM structure that would have resulted if all writes had been squashed into a single write.
| |
- |
| |
- | // For each descendent `node` of `tempDiv` whose parentNode is a *proxy*, `node` is appended to the corresponding *real* element within the DOM.
| |
- |
| |
- | // Proxy elements are mapped to *actual* elements in the DOM by injecting a data-id attribute into each start tag in `staticHtml`.
| |
- | var WriteStream = (function(){
| |
- |
| |
- | // Prefix for data attributes on DOM elements.
| |
- | var BASEATTR = 'data-ps-';
| |
- |
| |
- | // get / set data attributes
| |
- | function data(el, name, value) {
| |
- | var attr = BASEATTR + name;
| |
- |
| |
- | if(arguments.length === 2) {
| |
- | // Get
| |
- | var val = el.getAttribute(attr);
| |
- |
| |
- | // IE 8 returns a number if it's a number
| |
- | return val == null ? val : String(val);
| |
- |
| |
- | } else if( value != null && value !== '') {
| |
- | // Set
| |
- | el.setAttribute(attr, value);
| |
- |
| |
- | } else {
| |
- | // Remove
| |
- | el.removeAttribute(attr);
| |
- | }
| |
- | }
| |
- |
| |
- | function WriteStream(root, options) {
| |
- | var doc = root.ownerDocument;
| |
- |
| |
- | set(this, {
| |
- | root: root,
| |
- |
| |
- | options: options,
| |
- |
| |
- | win: doc.defaultView || doc.parentWindow,
| |
- |
| |
- | doc: doc,
| |
- |
| |
- | parser: global.htmlParser('', { autoFix: true }),
| |
- |
| |
- | // Actual elements by id.
| |
- | actuals: [root],
| |
- |
| |
- | // Embodies the "structure" of what's been written so far, devoid of attributes.
| |
- | proxyHistory: '',
| |
- |
| |
- | // Create a proxy of the root element.
| |
- | proxyRoot: doc.createElement(root.nodeName),
| |
- |
| |
- | scriptStack: [],
| |
- |
| |
- | writeQueue: []
| |
- | });
| |
- |
| |
- | data(this.proxyRoot, 'proxyof', 0);
| |
- |
| |
- | }
| |
- |
| |
- |
| |
- | WriteStream.prototype.write = function() {
| |
- | [].push.apply(this.writeQueue, arguments);
| |
- | // Process writes
| |
- | // When new script gets pushed or pending this will stop
| |
- | // because new writeQueue gets pushed
| |
- | var arg;
| |
- | while(!this.deferredRemote &&
| |
- | this.writeQueue.length) {
| |
- | arg = this.writeQueue.shift();
| |
- |
| |
- | if(isFunction(arg)) {
| |
- | this.callFunction(arg);
| |
- | } else {
| |
- | this.writeImpl(arg);
| |
- | }
| |
- | }
| |
- | };
| |
- |
| |
- | WriteStream.prototype.callFunction = function(fn) {
| |
- | var tok = { type: "function", value: fn.name || fn.toString() };
| |
- | this.onScriptStart(tok);
| |
- | fn.call(this.win, this.doc);
| |
- | this.onScriptDone(tok);
| |
- | };
| |
- |
| |
- | WriteStream.prototype.writeImpl = function(html) {
| |
- | this.parser.append(html);
| |
- |
| |
- | var tok, tokens = [];
| |
- |
| |
- | // stop if we see a script token
| |
- | while((tok = this.parser.readToken()) && !isScript(tok)) {
| |
- | tokens.push(tok);
| |
- | }
| |
- |
| |
- | this.writeStaticTokens(tokens);
| |
- |
| |
- | if(tok) {
| |
- | this.handleScriptToken(tok);
| |
- | }
| |
- | };
| |
- |
| |
- |
| |
- | // ## Contiguous non-script tokens (a chunk)
| |
- | WriteStream.prototype.writeStaticTokens = function(tokens) {
| |
- |
| |
- | var chunk = this.buildChunk(tokens);
| |
- |
| |
- | if(!chunk.actual) {
| |
- | // e.g., no tokens, or a noscript that got ignored
| |
- | return;
| |
- | }
| |
- | chunk.html = this.proxyHistory + chunk.actual;
| |
- | this.proxyHistory += chunk.proxy;
| |
- |
| |
- | this.proxyRoot.innerHTML = chunk.html;
| |
- |
| |
- | if(DEBUG_CHUNK) {
| |
- | chunk.proxyInnerHTML = this.proxyRoot.innerHTML;
| |
- | }
| |
- |
| |
- | this.walkChunk();
| |
- |
| |
- | if(DEBUG_CHUNK) {
| |
- | chunk.actualInnerHTML = this.root.innerHTML; //root
| |
- | }
| |
- |
| |
- | return chunk;
| |
- | };
| |
- |
| |
- |
| |
- | WriteStream.prototype.buildChunk = function (tokens) {
| |
- | var nextId = this.actuals.length,
| |
- |
| |
- | // The raw html of this chunk.
| |
- | raw = [],
| |
- |
| |
- | // The html to create the nodes in the tokens (with id's injected).
| |
- | actual = [],
| |
- |
| |
- | // Html that can later be used to proxy the nodes in the tokens.
| |
- | proxy = [];
| |
- |
| |
- | each(tokens, function(tok) {
| |
- |
| |
- | raw.push(tok.text);
| |
- |
| |
- | if(tok.attrs) { // tok.attrs <==> startTag or atomicTag or cursor
| |
- | // Ignore noscript tags. They are atomic, so we don't have to worry about children.
| |
- | if(!(/^noscript$/i).test(tok.tagName)) {
| |
- | var id = nextId++;
| |
- |
| |
- | // Actual: inject id attribute: replace '>' at end of start tag with id attribute + '>'
| |
- | actual.push(
| |
- | tok.text.replace(/(\/?>)/, ' '+BASEATTR+'id='+id+' $1')
| |
- | );
| |
- |
| |
- | // Don't proxy scripts: they have no bearing on DOM structure.
| |
- | if(tok.attrs.id !== "ps-script") {
| |
- | // Proxy: strip all attributes and inject proxyof attribute
| |
- | proxy.push(
| |
- | // ignore atomic tags (e.g., style): they have no "structural" effect
| |
- | tok.type === 'atomicTag' ? '' :
| |
- | '<'+tok.tagName+' '+BASEATTR+'proxyof='+id+(tok.unary ? '/>' : '>')
| |
- | );
| |
- | }
| |
- | }
| |
- |
| |
- | } else {
| |
- | // Visit any other type of token
| |
- | // Actual: append.
| |
- | actual.push(tok.text);
| |
- | // Proxy: append endTags. Ignore everything else.
| |
- | proxy.push(tok.type === 'endTag' ? tok.text : '');
| |
- | }
| |
- | });
| |
- |
| |
- | return {
| |
- | tokens: tokens,
| |
- | raw: raw.join(''),
| |
- | actual: actual.join(''),
| |
- | proxy: proxy.join('')
| |
- | };
| |
- | };
| |
- |
| |
- | WriteStream.prototype.walkChunk = function() {
| |
- | var node, stack = [this.proxyRoot];
| |
- |
| |
- | // use shift/unshift so that children are walked in document order
| |
- |
| |
- | while((node = stack.shift()) != null) {
| |
- |
| |
- | var isElement = node.nodeType === 1;
| |
- | var isProxy = isElement && data(node, 'proxyof');
| |
- |
| |
- | // Ignore proxies
| |
- | if(!isProxy) {
| |
- |
| |
- | if(isElement) {
| |
- | // New actual element: register it and remove the the id attr.
| |
- | this.actuals[data(node, 'id')] = node;
| |
- | data(node, 'id', null);
| |
- | }
| |
- |
| |
- | // Is node's parent a proxy?
| |
- | var parentIsProxyOf = node.parentNode && data(node.parentNode, 'proxyof');
| |
- | if(parentIsProxyOf) {
| |
- | // Move node under actual parent.
| |
- | this.actuals[parentIsProxyOf].appendChild(node);
| |
- | }
| |
- | }
| |
- | // prepend childNodes to stack
| |
- | stack.unshift.apply(stack, toArray(node.childNodes));
| |
- | }
| |
- | };
| |
- |
| |
- | // ### Script tokens
| |
- |
| |
- | WriteStream.prototype.handleScriptToken = function(tok) {
| |
- | var remainder = this.parser.clear();
| |
- |
| |
- | if(remainder) {
| |
- | // Write remainder immediately behind this script.
| |
- | this.writeQueue.unshift(remainder);
| |
- | }
| |
- |
| |
- | tok.src = tok.attrs.src || tok.attrs.SRC;
| |
- |
| |
- | if(tok.src && this.scriptStack.length) {
| |
- | // Defer this script until scriptStack is empty.
| |
- | // Assumption 1: This script will not start executing until
| |
- | // scriptStack is empty.
| |
- | this.deferredRemote = tok;
| |
- | } else {
| |
- | this.onScriptStart(tok);
| |
- | }
| |
- |
| |
- | // Put the script node in the DOM.
| |
- | var _this = this;
| |
- | this.writeScriptToken(tok, function() {
| |
- | _this.onScriptDone(tok);
| |
- | });
| |
- |
| |
- | };
| |
- |
| |
- | WriteStream.prototype.onScriptStart = function(tok) {
| |
- | tok.outerWrites = this.writeQueue;
| |
- | this.writeQueue = [];
| |
- | this.scriptStack.unshift(tok);
| |
- | };
| |
- |
| |
- | WriteStream.prototype.onScriptDone = function(tok) {
| |
- | // Pop script and check nesting.
| |
- | if(tok !== this.scriptStack[0]) {
| |
- | this.options.error({ message: "Bad script nesting or script finished twice" });
| |
- | return;
| |
- | }
| |
- | this.scriptStack.shift();
| |
- |
| |
- | // Append outer writes to queue and process them.
| |
- | this.write.apply(this, tok.outerWrites);
| |
- |
| |
- | // Check for pending remote
| |
- |
| |
- | // Assumption 2: if remote_script1 writes remote_script2 then
| |
- | // the we notice remote_script1 finishes before remote_script2 starts.
| |
- | // I think this is equivalent to assumption 1
| |
- | if(!this.scriptStack.length && this.deferredRemote) {
| |
- | this.onScriptStart(this.deferredRemote);
| |
- | this.deferredRemote = null;
| |
- | }
| |
- | };
| |
- |
| |
- | // Build a script and insert it into the DOM.
| |
- | // Done is called once script has executed.
| |
- | WriteStream.prototype.writeScriptToken = function(tok, done) {
| |
- | var el = this.buildScript(tok);
| |
- |
| |
- | if(tok.src) {
| |
- | // Fix for attribute "SRC" (capitalized). IE does not recognize it.
| |
- | el.src = tok.src;
| |
- | this.scriptLoadHandler(el, done);
| |
- | }
| |
- |
| |
- | try {
| |
- | this.insertScript(el);
| |
- | if(!tok.src) {
| |
- | done();
| |
- | }
| |
- | } catch(e) {
| |
- | this.options.error(e);
| |
- | done();
| |
- | }
| |
- | };
| |
- |
| |
- | // Build a script element from an atomic script token.
| |
- | WriteStream.prototype.buildScript = function(tok) {
| |
- | var el = this.doc.createElement(tok.tagName);
| |
- |
| |
- | // Set attributes
| |
- | eachKey(tok.attrs, function(name, value) {
| |
- | el.setAttribute(name, value);
| |
- | });
| |
- |
| |
- | // Set content
| |
- | if(tok.content) {
| |
- | el.text = tok.content;
| |
- | }
| |
- |
| |
- | return el;
| |
- | };
| |
- |
| |
- |
| |
- | // Insert script into DOM where it would naturally be written.
| |
- | WriteStream.prototype.insertScript = function(el) {
| |
- | // Append a span to the stream. That span will act as a cursor
| |
- | // (i.e. insertion point) for the script.
| |
- | this.writeImpl('<span id="ps-script"/>');
| |
- |
| |
- | // Grab that span from the DOM.
| |
- | var cursor = this.doc.getElementById("ps-script");
| |
- |
| |
- | // Replace cursor with script.
| |
- | cursor.parentNode.replaceChild(el, cursor);
| |
- | };
| |
- |
| |
- |
| |
- | WriteStream.prototype.scriptLoadHandler = function(el, done) {
| |
- | function cleanup() {
| |
- | el = el.onload = el.onreadystatechange = el.onerror = null;
| |
- | done();
| |
- | }
| |
- |
| |
- | // Error handler
| |
- | var error = this.options.error;
| |
- |
| |
- | // Set handlers
| |
- | set(el, {
| |
- | onload: function() { cleanup(); },
| |
- |
| |
- | onreadystatechange: function() {
| |
- | if(/^(loaded|complete)$/.test( el.readyState )) {
| |
- | cleanup();
| |
- | }
| |
- | },
| |
- |
| |
- | onerror: function() {
| |
- | error({ message: 'remote script failed ' + el.src });
| |
- | cleanup();
| |
- | }
| |
- | });
| |
- | };
| |
- |
| |
- | return WriteStream;
| |
- |
| |
- | }());
| |
- |
| |
- |
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | // Public-facing interface and queuing
| |
- | var postscribe = (function() {
| |
- | var nextId = 0;
| |
- |
| |
- | var queue = [];
| |
- |
| |
- | var active = null;
| |
- |
| |
- | function nextStream() {
| |
- | var args = queue.shift();
| |
- | if(args) {
| |
- | args.stream = runStream.apply(null, args);
| |
- | }
| |
- | }
| |
- |
| |
- |
| |
- | function runStream(el, html, options) {
| |
- | active = new WriteStream(el, options);
| |
- |
| |
- | // Identify this stream.
| |
- | active.id = nextId++;
| |
- | active.name = options.name || active.id;
| |
- | postscribe.streams[active.name] = active;
| |
- |
| |
- | // Override document.write.
| |
- | var doc = el.ownerDocument;
| |
- |
| |
- | var stash = { write: doc.write, writeln: doc.writeln };
| |
- |
| |
- | function write(str) {
| |
- | str = options.beforeWrite(str);
| |
- | active.write(str);
| |
- | options.afterWrite(str);
| |
- | }
| |
- |
| |
- | set(doc, { write: write, writeln: function(str) { write(str + '\n'); } });
| |
- |
| |
- | // Override window.onerror
| |
- | var oldOnError = active.win.onerror || doNothing;
| |
- |
| |
- | // This works together with the try/catch around WriteStream::insertScript
| |
- | // In modern browsers, exceptions in tag scripts go directly to top level
| |
- | active.win.onerror = function(msg, url, line) {
| |
- | options.error({ msg: msg + ' - ' + url + ':' + line });
| |
- | oldOnError.apply(active.win, arguments);
| |
- | };
| |
- |
| |
- | // Write to the stream
| |
- | active.write(html, function streamDone() {
| |
- | // restore document.write
| |
- | set(doc, stash);
| |
- |
| |
- | // restore window.onerror
| |
- | active.win.onerror = oldOnError;
| |
- |
| |
- | options.done();
| |
- | active = null;
| |
- | nextStream();
| |
- | });
| |
- |
| |
- | return active;
| |
- | }
| |
- |
| |
- |
| |
- | function postscribe(el, html, options) {
| |
- | if(isFunction(options)) {
| |
- | options = { done: options };
| |
- | }
| |
- | options = defaults(options, {
| |
- | done: doNothing,
| |
- | error: function(e) { throw e; },
| |
- | beforeWrite: function(str) { return str; },
| |
- | afterWrite: doNothing
| |
- | });
| |
- |
| |
- | el =
| |
- | // id selector
| |
- | (/^#/).test(el) ? global.document.getElementById(el.substr(1)) :
| |
- | // jquery object. TODO: loop over all elements.
| |
- | el.jquery ? el[0] : el;
| |
- |
| |
- |
| |
- | var args = [el, html, options];
| |
- |
| |
- | el.postscribe = {
| |
- | cancel: function() {
| |
- | if(args.stream) {
| |
- | // TODO: implement this
| |
- | args.stream.abort();
| |
- | } else {
| |
- | args[1] = doNothing;
| |
- | }
| |
- | }
| |
- | };
| |
- |
| |
- | queue.push(args);
| |
- | if(!active) {
| |
- | nextStream();
| |
- | }
| |
- |
| |
- | return el.postscribe;
| |
- | }
| |
- |
| |
- | return set(postscribe, {
| |
- | // Streams by name.
| |
- | streams: {},
| |
- | // Queue of streams.
| |
- | queue: queue,
| |
- | // Expose internal classes.
| |
- | WriteStream: WriteStream
| |
- | });
| |
- |
| |
- | }());
| |
- |
| |
- | // export postscribe
| |
- | global.postscribe = postscribe;
| |
- |
| |
- | }());
| |
- |
| |
- | </script>
| |
- |
| |
- | <script>
| |
- |
| |
- | /**
| |
- | * AJAX Banner placement
| |
- | *
| |
- | * @param {int} uid
| |
- | * @param {int} lang
| |
- | * @param {int} typeNum
| |
- | * @param {string} startingPoint
| |
- | * @param {string} categories
| |
- | * @param {string} displayMode
| |
- | * @param {string} position
| |
- | * @param {string} hmac
| |
- | * @constructor
| |
- | */
| |
- | var BannerPlacement = function (uid, lang, typeNum, startingPoint, categories, displayMode, position, hmac) {
| |
- | var url = 'index.php?id=' + uid;
| |
- | url += '&L=' + lang;
| |
- | url += '&type=' + typeNum;
| |
- | url += '&tx_sfbanners_pi1[action]=getBanners';
| |
- | url += '&tx_sfbanners_pi1[currentPageUid]=' + uid;
| |
- | url += '&tx_sfbanners_pi1[hmac]=' + hmac;
| |
- |
| |
- | if (typeof startingPoint !== 'undefined' && startingPoint !== '') {
| |
- | url += '&tx_sfbanners_pi1[startingPoint]=' + startingPoint;
| |
- | }
| |
- |
| |
- | if (typeof categories !== 'undefined' && categories !== '') {
| |
- | url += '&tx_sfbanners_pi1[categories]=' + categories;
| |
- | }
| |
- |
| |
- | if (typeof displayMode !== 'undefined' && displayMode !== '') {
| |
- | url += '&tx_sfbanners_pi1[displayMode]=' + displayMode;
| |
- | }
| |
- |
| |
- | $.get(url, function(data) {
| |
- | postscribe('#' + position, data);
| |
- | });
| |
- | }
| |
- |
| |
- | </script>
| |
- |
| |
- | <script>
| |
- | /*
| |
- | * jQuery FlexSlider v2.1
| |
- | * Copyright 2012 WooThemes
| |
- | * Contributing Author: Tyler Smith
| |
- | */
| |
- | ; (function(d){d.flexslider=function(i,k){var a=d(i),c=d.extend({},d.flexslider.defaults,k),e=c.namespace,r="ontouchstart"in window||window.DocumentTouch&&document instanceof DocumentTouch,s=r?"touchend":"click",l="vertical"===c.direction,m=c.reverse,h=0<c.itemWidth,q="fade"===c.animation,p=""!==c.asNavFor,f={};d.data(i,"flexslider",a);f={init:function(){a.animating=!1;a.currentSlide=c.startAt;a.animatingTo=a.currentSlide;a.atEnd=0===a.currentSlide||a.currentSlide===a.last;a.containerSelector=c.selector.substr(0,
| |
- | c.selector.search(" "));a.slides=d(c.selector,a);a.container=d(a.containerSelector,a);a.count=a.slides.length;a.syncExists=0<d(c.sync).length;"slide"===c.animation&&(c.animation="swing");a.prop=l?"top":"marginLeft";a.args={};a.manualPause=!1;var b=a,g;if(g=!c.video)if(g=!q)if(g=c.useCSS)a:{g=document.createElement("div");var n=["perspectiveProperty","WebkitPerspective","MozPerspective","OPerspective","msPerspective"],e;for(e in n)if(void 0!==g.style[n[e]]){a.pfx=n[e].replace("Perspective","").toLowerCase();
| |
- | a.prop="-"+a.pfx+"-transform";g=!0;break a}g=!1}b.transitions=g;""!==c.controlsContainer&&(a.controlsContainer=0<d(c.controlsContainer).length&&d(c.controlsContainer));""!==c.manualControls&&(a.manualControls=0<d(c.manualControls).length&&d(c.manualControls));c.randomize&&(a.slides.sort(function(){return Math.round(Math.random())-0.5}),a.container.empty().append(a.slides));a.doMath();p&&f.asNav.setup();a.setup("init");c.controlNav&&f.controlNav.setup();c.directionNav&&f.directionNav.setup();c.keyboard&&
| |
- | (1===d(a.containerSelector).length||c.multipleKeyboard)&&d(document).bind("keyup",function(b){b=b.keyCode;if(!a.animating&&(b===39||b===37)){b=b===39?a.getTarget("next"):b===37?a.getTarget("prev"):false;a.flexAnimate(b,c.pauseOnAction)}});c.mousewheel&&a.bind("mousewheel",function(b,g){b.preventDefault();var d=g<0?a.getTarget("next"):a.getTarget("prev");a.flexAnimate(d,c.pauseOnAction)});c.pausePlay&&f.pausePlay.setup();c.slideshow&&(c.pauseOnHover&&a.hover(function(){!a.manualPlay&&!a.manualPause&&
| |
- | a.pause()},function(){!a.manualPause&&!a.manualPlay&&a.play()}),0<c.initDelay?setTimeout(a.play,c.initDelay):a.play());r&&c.touch&&f.touch();(!q||q&&c.smoothHeight)&&d(window).bind("resize focus",f.resize);setTimeout(function(){c.start(a)},200)},asNav:{setup:function(){a.asNav=!0;a.animatingTo=Math.floor(a.currentSlide/a.move);a.currentItem=a.currentSlide;a.slides.removeClass(e+"active-slide").eq(a.currentItem).addClass(e+"active-slide");a.slides.click(function(b){b.preventDefault();var b=d(this),
| |
- | g=b.index();!d(c.asNavFor).data("flexslider").animating&&!b.hasClass("active")&&(a.direction=a.currentItem<g?"next":"prev",a.flexAnimate(g,c.pauseOnAction,!1,!0,!0))})}},controlNav:{setup:function(){a.manualControls?f.controlNav.setupManual():f.controlNav.setupPaging()},setupPaging:function(){var b=1,g;a.controlNavScaffold=d('<ol class="'+e+"control-nav "+e+("thumbnails"===c.controlNav?"control-thumbs":"control-paging")+'"></ol>');if(1<a.pagingCount)for(var n=0;n<a.pagingCount;n++)g="thumbnails"===
| |
- | c.controlNav?'<img src="'+a.slides.eq(n).attr("data-thumb")+'"/>':"<a>"+b+"</a>",a.controlNavScaffold.append("<li>"+g+"</li>"),b++;a.controlsContainer?d(a.controlsContainer).append(a.controlNavScaffold):a.append(a.controlNavScaffold);f.controlNav.set();f.controlNav.active();a.controlNavScaffold.delegate("a, img",s,function(b){b.preventDefault();var b=d(this),g=a.controlNav.index(b);b.hasClass(e+"active")||(a.direction=g>a.currentSlide?"next":"prev",a.flexAnimate(g,c.pauseOnAction))});r&&a.controlNavScaffold.delegate("a",
| |
- | "click touchstart",function(a){a.preventDefault()})},setupManual:function(){a.controlNav=a.manualControls;f.controlNav.active();a.controlNav.live(s,function(b){b.preventDefault();var b=d(this),g=a.controlNav.index(b);b.hasClass(e+"active")||(g>a.currentSlide?a.direction="next":a.direction="prev",a.flexAnimate(g,c.pauseOnAction))});r&&a.controlNav.live("click touchstart",function(a){a.preventDefault()})},set:function(){a.controlNav=d("."+e+"control-nav li "+("thumbnails"===c.controlNav?"img":"a"),
| |
- | a.controlsContainer?a.controlsContainer:a)},active:function(){a.controlNav.removeClass(e+"active").eq(a.animatingTo).addClass(e+"active")},update:function(b,c){1<a.pagingCount&&"add"===b?a.controlNavScaffold.append(d("<li><a>"+a.count+"</a></li>")):1===a.pagingCount?a.controlNavScaffold.find("li").remove():a.controlNav.eq(c).closest("li").remove();f.controlNav.set();1<a.pagingCount&&a.pagingCount!==a.controlNav.length?a.update(c,b):f.controlNav.active()}},directionNav:{setup:function(){var b=d('<ul class="'+
| |
- | e+'direction-nav"><li><a class="'+e+'prev" href="#">'+c.prevText+'</a></li><li><a class="'+e+'next" href="#">'+c.nextText+"</a></li></ul>");a.controlsContainer?(d(a.controlsContainer).append(b),a.directionNav=d("."+e+"direction-nav li a",a.controlsContainer)):(a.append(b),a.directionNav=d("."+e+"direction-nav li a",a));f.directionNav.update();a.directionNav.bind(s,function(b){b.preventDefault();b=d(this).hasClass(e+"next")?a.getTarget("next"):a.getTarget("prev");a.flexAnimate(b,c.pauseOnAction)});
| |
- | r&&a.directionNav.bind("click touchstart",function(a){a.preventDefault()})},update:function(){var b=e+"disabled";1===a.pagingCount?a.directionNav.addClass(b):c.animationLoop?a.directionNav.removeClass(b):0===a.animatingTo?a.directionNav.removeClass(b).filter("."+e+"prev").addClass(b):a.animatingTo===a.last?a.directionNav.removeClass(b).filter("."+e+"next").addClass(b):a.directionNav.removeClass(b)}},pausePlay:{setup:function(){var b=d('<div class="'+e+'pauseplay"><a></a></div>');a.controlsContainer?
| |
- | (a.controlsContainer.append(b),a.pausePlay=d("."+e+"pauseplay a",a.controlsContainer)):(a.append(b),a.pausePlay=d("."+e+"pauseplay a",a));f.pausePlay.update(c.slideshow?e+"pause":e+"play");a.pausePlay.bind(s,function(b){b.preventDefault();if(d(this).hasClass(e+"pause")){a.manualPause=true;a.manualPlay=false;a.pause()}else{a.manualPause=false;a.manualPlay=true;a.play()}});r&&a.pausePlay.bind("click touchstart",function(a){a.preventDefault()})},update:function(b){"play"===b?a.pausePlay.removeClass(e+
| |
- | "pause").addClass(e+"play").text(c.playText):a.pausePlay.removeClass(e+"play").addClass(e+"pause").text(c.pauseText)}},touch:function(){function b(b){j=l?d-b.touches[0].pageY:d-b.touches[0].pageX;p=l?Math.abs(j)<Math.abs(b.touches[0].pageX-e):Math.abs(j)<Math.abs(b.touches[0].pageY-e);if(!p||500<Number(new Date)-k)b.preventDefault(),!q&&a.transitions&&(c.animationLoop||(j/=0===a.currentSlide&&0>j||a.currentSlide===a.last&&0<j?Math.abs(j)/o+2:1),a.setProps(f+j,"setTouch"))}function g(){if(a.animatingTo===
| |
- | a.currentSlide&&!p&&null!==j){var h=m?-j:j,l=0<h?a.getTarget("next"):a.getTarget("prev");a.canAdvance(l)&&(550>Number(new Date)-k&&50<Math.abs(h)||Math.abs(h)>o/2)?a.flexAnimate(l,c.pauseOnAction):a.flexAnimate(a.currentSlide,c.pauseOnAction,!0)}i.removeEventListener("touchmove",b,!1);i.removeEventListener("touchend",g,!1);f=j=e=d=null}var d,e,f,o,j,k,p=!1;i.addEventListener("touchstart",function(j){a.animating?j.preventDefault():1===j.touches.length&&(a.pause(),o=l?a.h:a.w,k=Number(new Date),f=h&&
| |
- | m&&a.animatingTo===a.last?0:h&&m?a.limit-(a.itemW+c.itemMargin)*a.move*a.animatingTo:h&&a.currentSlide===a.last?a.limit:h?(a.itemW+c.itemMargin)*a.move*a.currentSlide:m?(a.last-a.currentSlide+a.cloneOffset)*o:(a.currentSlide+a.cloneOffset)*o,d=l?j.touches[0].pageY:j.touches[0].pageX,e=l?j.touches[0].pageX:j.touches[0].pageY,i.addEventListener("touchmove",b,!1),i.addEventListener("touchend",g,!1))},!1)},resize:function(){!a.animating&&a.is(":visible")&&(h||a.doMath(),q?f.smoothHeight():h?(a.slides.width(a.computedW),
| |
- | a.update(a.pagingCount),a.setProps()):l?(a.viewport.height(a.h),a.setProps(a.h,"setTotal")):(c.smoothHeight&&f.smoothHeight(),a.newSlides.width(a.computedW),a.setProps(a.computedW,"setTotal")))},smoothHeight:function(b){if(!l||q){var c=q?a:a.viewport;b?c.animate({height:a.slides.eq(a.animatingTo).height()},b):c.height(a.slides.eq(a.animatingTo).height())}},sync:function(b){var g=d(c.sync).data("flexslider"),e=a.animatingTo;switch(b){case "animate":g.flexAnimate(e,c.pauseOnAction,!1,!0);break;case "play":!g.playing&&
| |
- | !g.asNav&&g.play();break;case "pause":g.pause()}}};a.flexAnimate=function(b,g,n,i,k){p&&1===a.pagingCount&&(a.direction=a.currentItem<b?"next":"prev");if(!a.animating&&(a.canAdvance(b,k)||n)&&a.is(":visible")){if(p&&i)if(n=d(c.asNavFor).data("flexslider"),a.atEnd=0===b||b===a.count-1,n.flexAnimate(b,!0,!1,!0,k),a.direction=a.currentItem<b?"next":"prev",n.direction=a.direction,Math.ceil((b+1)/a.visible)-1!==a.currentSlide&&0!==b)a.currentItem=b,a.slides.removeClass(e+"active-slide").eq(b).addClass(e+
| |
- | "active-slide"),b=Math.floor(b/a.visible);else return a.currentItem=b,a.slides.removeClass(e+"active-slide").eq(b).addClass(e+"active-slide"),!1;a.animating=!0;a.animatingTo=b;c.before(a);g&&a.pause();a.syncExists&&!k&&f.sync("animate");c.controlNav&&f.controlNav.active();h||a.slides.removeClass(e+"active-slide").eq(b).addClass(e+"active-slide");a.atEnd=0===b||b===a.last;c.directionNav&&f.directionNav.update();b===a.last&&(c.end(a),c.animationLoop||a.pause());if(q)a.slides.eq(a.currentSlide).fadeOut(c.animationSpeed,
| |
- | c.easing),a.slides.eq(b).fadeIn(c.animationSpeed,c.easing,a.wrapup);else{var o=l?a.slides.filter(":first").height():a.computedW;h?(b=c.itemWidth>a.w?2*c.itemMargin:c.itemMargin,b=(a.itemW+b)*a.move*a.animatingTo,b=b>a.limit&&1!==a.visible?a.limit:b):b=0===a.currentSlide&&b===a.count-1&&c.animationLoop&&"next"!==a.direction?m?(a.count+a.cloneOffset)*o:0:a.currentSlide===a.last&&0===b&&c.animationLoop&&"prev"!==a.direction?m?0:(a.count+1)*o:m?(a.count-1-b+a.cloneOffset)*o:(b+a.cloneOffset)*o;a.setProps(b,
| |
- | "",c.animationSpeed);if(a.transitions){if(!c.animationLoop||!a.atEnd)a.animating=!1,a.currentSlide=a.animatingTo;a.container.unbind("webkitTransitionEnd transitionend");a.container.bind("webkitTransitionEnd transitionend",function(){a.wrapup(o)})}else a.container.animate(a.args,c.animationSpeed,c.easing,function(){a.wrapup(o)})}c.smoothHeight&&f.smoothHeight(c.animationSpeed)}};a.wrapup=function(b){!q&&!h&&(0===a.currentSlide&&a.animatingTo===a.last&&c.animationLoop?a.setProps(b,"jumpEnd"):a.currentSlide===
| |
- | a.last&&(0===a.animatingTo&&c.animationLoop)&&a.setProps(b,"jumpStart"));a.animating=!1;a.currentSlide=a.animatingTo;c.after(a)};a.animateSlides=function(){a.animating||a.flexAnimate(a.getTarget("next"))};a.pause=function(){clearInterval(a.animatedSlides);a.playing=!1;c.pausePlay&&f.pausePlay.update("play");a.syncExists&&f.sync("pause")};a.play=function(){a.animatedSlides=setInterval(a.animateSlides,c.slideshowSpeed);a.playing=!0;c.pausePlay&&f.pausePlay.update("pause");a.syncExists&&f.sync("play")};
| |
- | a.canAdvance=function(b,g){var d=p?a.pagingCount-1:a.last;return g?!0:p&&a.currentItem===a.count-1&&0===b&&"prev"===a.direction?!0:p&&0===a.currentItem&&b===a.pagingCount-1&&"next"!==a.direction?!1:b===a.currentSlide&&!p?!1:c.animationLoop?!0:a.atEnd&&0===a.currentSlide&&b===d&&"next"!==a.direction?!1:a.atEnd&&a.currentSlide===d&&0===b&&"next"===a.direction?!1:!0};a.getTarget=function(b){a.direction=b;return"next"===b?a.currentSlide===a.last?0:a.currentSlide+1:0===a.currentSlide?a.last:a.currentSlide-
| |
- | 1};a.setProps=function(b,g,d){var e,f=b?b:(a.itemW+c.itemMargin)*a.move*a.animatingTo;e=-1*function(){if(h)return"setTouch"===g?b:m&&a.animatingTo===a.last?0:m?a.limit-(a.itemW+c.itemMargin)*a.move*a.animatingTo:a.animatingTo===a.last?a.limit:f;switch(g){case "setTotal":return m?(a.count-1-a.currentSlide+a.cloneOffset)*b:(a.currentSlide+a.cloneOffset)*b;case "setTouch":return b;case "jumpEnd":return m?b:a.count*b;case "jumpStart":return m?a.count*b:b;default:return b}}()+"px";a.transitions&&(e=l?
| |
- | "translate3d(0,"+e+",0)":"translate3d("+e+",0,0)",d=void 0!==d?d/1E3+"s":"0s",a.container.css("-"+a.pfx+"-transition-duration",d));a.args[a.prop]=e;(a.transitions||void 0===d)&&a.container.css(a.args)};a.setup=function(b){if(q)a.slides.css({width:"100%","float":"left",marginRight:"-100%",position:"relative"}),"init"===b&&a.slides.eq(a.currentSlide).fadeIn(c.animationSpeed,c.easing),c.smoothHeight&&f.smoothHeight();else{var g,n;"init"===b&&(a.viewport=d('<div class="'+e+'viewport"></div>').css({overflow:"hidden",
| |
- | position:"relative"}).appendTo(a).append(a.container),a.cloneCount=0,a.cloneOffset=0,m&&(n=d.makeArray(a.slides).reverse(),a.slides=d(n),a.container.empty().append(a.slides)));c.animationLoop&&!h&&(a.cloneCount=2,a.cloneOffset=1,"init"!==b&&a.container.find(".clone").remove(),a.container.append(a.slides.first().clone().addClass("clone")).prepend(a.slides.last().clone().addClass("clone")));a.newSlides=d(c.selector,a);g=m?a.count-1-a.currentSlide+a.cloneOffset:a.currentSlide+a.cloneOffset;l&&!h?(a.container.height(200*
| |
- | (a.count+a.cloneCount)+"%").css("position","absolute").width("100%"),setTimeout(function(){a.newSlides.css({display:"block"});a.doMath();a.viewport.height(a.h);a.setProps(g*a.h,"init")},"init"===b?100:0)):(a.container.width(200*(a.count+a.cloneCount)+"%"),a.setProps(g*a.computedW,"init"),setTimeout(function(){a.doMath();a.newSlides.css({width:a.computedW,"float":"left",display:"block"});c.smoothHeight&&f.smoothHeight()},"init"===b?100:0))}h||a.slides.removeClass(e+"active-slide").eq(a.currentSlide).addClass(e+
| |
- | "active-slide")};a.doMath=function(){var b=a.slides.first(),d=c.itemMargin,e=c.minItems,f=c.maxItems;a.w=a.width();a.h=b.height();a.boxPadding=b.outerWidth()-b.width();h?(a.itemT=c.itemWidth+d,a.minW=e?e*a.itemT:a.w,a.maxW=f?f*a.itemT:a.w,a.itemW=a.minW>a.w?(a.w-d*e)/e:a.maxW<a.w?(a.w-d*f)/f:c.itemWidth>a.w?a.w:c.itemWidth,a.visible=Math.floor(a.w/(a.itemW+d)),a.move=0<c.move&&c.move<a.visible?c.move:a.visible,a.pagingCount=Math.ceil((a.count-a.visible)/a.move+1),a.last=a.pagingCount-1,a.limit=1===
| |
- | a.pagingCount?0:c.itemWidth>a.w?(a.itemW+2*d)*a.count-a.w-d:(a.itemW+d)*a.count-a.w-d):(a.itemW=a.w,a.pagingCount=a.count,a.last=a.count-1);a.computedW=a.itemW-a.boxPadding};a.update=function(b,d){a.doMath();h||(b<a.currentSlide?a.currentSlide+=1:b<=a.currentSlide&&0!==b&&(a.currentSlide-=1),a.animatingTo=a.currentSlide);if(c.controlNav&&!a.manualControls)if("add"===d&&!h||a.pagingCount>a.controlNav.length)f.controlNav.update("add");else if("remove"===d&&!h||a.pagingCount<a.controlNav.length)h&&a.currentSlide>
| |
- | a.last&&(a.currentSlide-=1,a.animatingTo-=1),f.controlNav.update("remove",a.last);c.directionNav&&f.directionNav.update()};a.addSlide=function(b,e){var f=d(b);a.count+=1;a.last=a.count-1;l&&m?void 0!==e?a.slides.eq(a.count-e).after(f):a.container.prepend(f):void 0!==e?a.slides.eq(e).before(f):a.container.append(f);a.update(e,"add");a.slides=d(c.selector+":not(.clone)",a);a.setup();c.added(a)};a.removeSlide=function(b){var e=isNaN(b)?a.slides.index(d(b)):b;a.count-=1;a.last=a.count-1;isNaN(b)?d(b,
| |
- | a.slides).remove():l&&m?a.slides.eq(a.last).remove():a.slides.eq(b).remove();a.doMath();a.update(e,"remove");a.slides=d(c.selector+":not(.clone)",a);a.setup();c.removed(a)};f.init()};d.flexslider.defaults={namespace:"flex-",selector:".slides > li",animation:"fade",easing:"swing",direction:"horizontal",reverse:!1,animationLoop:!0,smoothHeight:!1,startAt:0,slideshow:!0,slideshowSpeed:7E3,animationSpeed:600,initDelay:0,randomize:!1,pauseOnAction:!0,pauseOnHover:!1,useCSS:!0,touch:!0,video:!1,controlNav:!0,
| |
- | directionNav:!0,prevText:"Previous",nextText:"Next",keyboard:!0,multipleKeyboard:!1,mousewheel:!1,pausePlay:!1,pauseText:"Pause",playText:"Play",controlsContainer:"",manualControls:"",sync:"",asNavFor:"",itemWidth:0,itemMargin:0,minItems:0,maxItems:0,move:0,start:function(){},before:function(){},after:function(){},end:function(){},added:function(){},removed:function(){}};d.fn.flexslider=function(i){void 0===i&&(i={});if("object"===typeof i)return this.each(function(){var a=d(this),c=a.find(i.selector?
| |
- | i.selector:".slides > li");1===c.length?(c.fadeIn(400),i.start&&i.start(a)):void 0===a.data("flexslider")&&new d.flexslider(this,i)});var k=d(this).data("flexslider");switch(i){case "play":k.play();break;case "pause":k.pause();break;case "next":k.flexAnimate(k.getTarget("next"),!0);break;case "prev":case "previous":k.flexAnimate(k.getTarget("prev"),!0);break;default:"number"===typeof i&&k.flexAnimate(i,!0)}}})(jQuery);
| |
- |
| |
- | </script>
| |
- |
| |
- |
| |
- | <script>
| |
- | // Can also be used with $(document).ready()
| |
- | jQuery(window).load(function() {
| |
- | jQuery('#slider').flexslider({
| |
- | animation: "slide"
| |
- | });
| |
- | jQuery('#slider img').removeAttr('width').removeAttr('height');
| |
- | });
| |
- | </script>
| |
- |
| |
- | <script src="https://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML" type="text/javascript"></script>
| |
- |
| |
- | <script>
| |
- |
| |
- | // decrypt helper function
| |
- | function decryptCharcode(n,start,end,offset) {
| |
- | n = n + offset;
| |
- | if (offset > 0 && n > end) {
| |
- | n = start + (n - end - 1);
| |
- | } else if (offset < 0 && n < start) {
| |
- | n = end - (start - n - 1);
| |
- | }
| |
- | return String.fromCharCode(n);
| |
- | }
| |
- | // decrypt string
| |
- | function decryptString(enc,offset) {
| |
- | var dec = "";
| |
- | var len = enc.length;
| |
- | for(var i=0; i < len; i++) {
| |
- | var n = enc.charCodeAt(i);
| |
- | if (n >= 0x2B && n <= 0x3A) {
| |
- | dec += decryptCharcode(n,0x2B,0x3A,offset); // 0-9 . , - + / :
| |
- | } else if (n >= 0x40 && n <= 0x5A) {
| |
- | dec += decryptCharcode(n,0x40,0x5A,offset); // A-Z @
| |
- | } else if (n >= 0x61 && n <= 0x7A) {
| |
- | dec += decryptCharcode(n,0x61,0x7A,offset); // a-z
| |
- | } else {
| |
- | dec += enc.charAt(i);
| |
- | }
| |
- | }
| |
- | return dec;
| |
- | }
| |
- | // decrypt spam-protected emails
| |
- | function linkTo_UnCryptMailto(s) {
| |
- | location.href = decryptString(s,-2);
| |
- | }
| |
- |
| |
- | </script>
| |
- | <script>
| |
- | /**
| |
- | * Baseurl
| |
- | *
| |
- | * @type {string}
| |
- | */
| |
- | var baseurl;
| |
- |
| |
- | /**
| |
- | * Powermail main JavaScript for form validation
| |
- | */
| |
- | jQuery(document).ready(function($) {
| |
- |
| |
- | // Read baseURL
| |
- | baseurl = getBaseUrl();
| |
- |
| |
- | // Tabs
| |
- | if ($.fn.powermailTabs) {
| |
- | $('.powermail_morestep').powermailTabs();
| |
- | }
| |
- |
| |
- | // Location field
| |
- | if ($('.powermail_fieldwrap_location input').length) {
| |
- | getLocationAndWrite();
| |
- | }
| |
- |
| |
- | // AJAX Form submit
| |
- | if ($('form[data-powermail-ajax]').length) {
| |
- | ajaxFormSubmit();
| |
- | }
| |
- |
| |
- | // Datepicker field
| |
- | if ($.fn.datetimepicker) {
| |
- | $('.powermail_date').each(function() {
| |
- | var $this = $(this);
| |
- | // stop javascript datepicker, if browser supports type="date" or "datetime-local" or "time"
| |
- | if ($this.prop('type') === 'date' || $this.prop('type') === 'datetime-local' || $this.prop('type') === 'time') {
| |
- | if ($this.data('datepicker-force')) {
| |
- | // rewrite input type
| |
- | $this.prop('type', 'text');
| |
- | } else {
| |
- | // get date in format Y-m-d H:i for html5 date fields
| |
- | if ($(this).data('date-value')) {
| |
- | $(this).val(
| |
- | getDatetimeForDateFields($(this).data('date-value'), $(this).data('datepicker-format'), $this.prop('type'))
| |
- | );
| |
- | }
| |
- |
| |
- | // stop js datepicker
| |
- | return;
| |
- | }
| |
- | }
| |
- |
| |
- | var datepickerStatus = true;
| |
- | var timepickerStatus = true;
| |
- | if ($this.data('datepicker-settings') === 'date') {
| |
- | timepickerStatus = false;
| |
- | } else if ($this.data('datepicker-settings') === 'time') {
| |
- | datepickerStatus = false;
| |
- | }
| |
- |
| |
- | // create datepicker
| |
- | $this.datetimepicker({
| |
- | format: $this.data('datepicker-format'),
| |
- | timepicker: timepickerStatus,
| |
- | datepicker: datepickerStatus,
| |
- | lang: 'en',
| |
- | i18n:{
| |
- | en:{
| |
- | months: $this.data('datepicker-months').split(','),
| |
- | dayOfWeek: $this.data('datepicker-days').split(',')
| |
- | }
| |
- | }
| |
- | });
| |
- | });
| |
- | }
| |
- |
| |
- | // File Upload Delete
| |
- | $('.powermail_fieldwrap_file_inner').find('.deleteAllFiles').each(function() {
| |
- | // initially hide upload fields
| |
- | disableUploadField($(this).closest('.powermail_fieldwrap_file_inner').find('input[type="file"]'));
| |
- | });
| |
- | $('.deleteAllFiles').click(function() {
| |
- | enableUploadField($(this).closest('.powermail_fieldwrap_file_inner').find('input[type="file"]'));
| |
- | $(this).closest('ul').fadeOut(function() {
| |
- | $(this).remove();
| |
- | });
| |
- | });
| |
- | function disableUploadField(element) {
| |
- | element.prop('disabled', 'disabled').addClass('hide');
| |
- | }
| |
- | function enableUploadField(element) {
| |
- | element.removeProp('disabled').removeClass('hide');
| |
- | }
| |
- |
| |
- | // Password Field Output
| |
- | $('.powermail_all_type_password.powermail_all_value').html('********');
| |
- | });
| |
- |
| |
- | /**
| |
- | * Allow AJAX Submit for powermail
| |
- | *
| |
- | * @return void
| |
- | */
| |
- | function ajaxFormSubmit() {
| |
- | // submit is called after parsley and html5 validation - so we don't have to check for errors
| |
- | $(document).on('submit', 'form[data-powermail-ajax]', function (e) {
| |
- | var $this = $(this);
| |
- | var formUid = $this.data('powermail-form');
| |
- |
| |
- | $.ajax({
| |
- | type: 'POST',
| |
- | url: $this.prop('action'),
| |
- | data: $this.serialize(),
| |
- | beforeSend: function() {
| |
- | // add progressbar <div class="powermail_progressbar"><div class="powermail_progress"><div class="powermail_progess_inner"></div></div></div>
| |
- | var progressBar = $('<div />').addClass('powermail_progressbar').html(
| |
- | $('<div />').addClass('powermail_progress').html(
| |
- | $('<div />').addClass('powermail_progess_inner')
| |
- | )
| |
- | );
| |
- | $('.powermail_submit', $this).parent().append(progressBar);
| |
- | $('.powermail_confirmation_submit, .powermail_confirmation_form', $this).closest('.powermail_confirmation').append(progressBar);
| |
- | },
| |
- | complete: function() {
| |
- | // remove progressbar
| |
- | $('.powermail_fieldwrap_submit', $this).find('.powermail_progressbar').remove();
| |
- | },
| |
- | success: function(data) {
| |
- | var html = $('*[data-powermail-form="' + formUid + '"]:first', data);
| |
- | $('.tx-powermail').html(html);
| |
- | // fire tabs and parsley again
| |
- | if ($.fn.powermailTabs) {
| |
- | $('.powermail_morestep').powermailTabs();
| |
- | }
| |
- | if ($.fn.parsley) {
| |
- | $('form[data-parsley-validate="data-parsley-validate"]').parsley();
| |
- | }
| |
- | }
| |
- | });
| |
- |
| |
- | e.preventDefault();
| |
- | });
| |
- | }
| |
- |
| |
- | /**
| |
- | * Convert date format for html5 date fields
| |
- | * 31.08.2014 => 2014-08-31
| |
- | *
| |
- | * @param value
| |
- | * @param format
| |
- | * @param type
| |
- | * @returns {string}
| |
- | */
| |
- | function getDatetimeForDateFields(value, format, type) {
| |
- | var date = new Date(Date.parseDate(value, format));
| |
- | var valueDate = date.getFullYear() + '-';
| |
- | valueDate += ('0' + (date.getMonth() + 1)).slice(-2) + '-';
| |
- | valueDate += ('0' + date.getDate()).slice(-2);
| |
- | var valueTime = ('0' + date.getHours()).slice(-2) + ':' + ('0' + date.getMinutes()).slice(-2);
| |
- | var valueDateTime = valueDate + 'T' + valueTime;
| |
- |
| |
- | if (type === 'date') {
| |
- | return valueDate;
| |
- | }
| |
- | if (type === 'datetime-local') {
| |
- | return valueDateTime;
| |
- | }
| |
- | if (type === 'time') {
| |
- | return valueTime;
| |
- | }
| |
- | return 'error';
| |
- | }
| |
- |
| |
- | /**
| |
- | * Getting the Location by the browser and write to inputform as address
| |
- | *
| |
- | * @return void
| |
- | */
| |
- | function getLocationAndWrite() {
| |
- | if (navigator.geolocation) { // Read location from Browser
| |
- | navigator.geolocation.getCurrentPosition(function(position) {
| |
- | var lat = position.coords.latitude;
| |
- | var lng = position.coords.longitude;
| |
- | var url = baseurl + '/index.php' + '?eID=' + 'powermailEidGetLocation';
| |
- | jQuery.ajax({
| |
- | url: url,
| |
- | data: 'lat=' + lat + '&lng=' + lng,
| |
- | cache: false,
| |
- | beforeSend: function(jqXHR, settings) {
| |
- | jQuery('body').css('cursor', 'wait');
| |
- | },
| |
- | complete: function(jqXHR, textStatus) {
| |
- | jQuery('body').css('cursor', 'default');
| |
- | },
| |
- | success: function(data) { // return values
| |
- | if (data) {
| |
- | jQuery('.powermail_fieldwrap_location input').val(data);
| |
- | }
| |
- | }
| |
- | });
| |
- | });
| |
- | }
| |
- | }
| |
- |
| |
- | /**
| |
- | * Return BaseUrl as prefix
| |
- | *
| |
- | * @return string Base Url
| |
- | */
| |
- | function getBaseUrl() {
| |
- | var baseurl;
| |
- | if (jQuery('base').length > 0) {
| |
- | baseurl = jQuery('base').prop('href');
| |
- | } else {
| |
- | if (window.location.protocol != "https:") {
| |
- | baseurl = 'http://' + window.location.hostname;
| |
- | } else {
| |
- | baseurl = 'https://' + window.location.hostname;
| |
- | }
| |
- | }
| |
- | return baseurl;
| |
- | }
| |
- |
| |
- |
| |
- | </script>
| |
- | <script>
| |
- | /*!
| |
- | * Parsleyjs
| |
- | * Guillaume Potier - <guillaume@wisembly.com>
| |
- | * Version 2.0.5 - built Thu Aug 28 2014 11:33:36
| |
- | * MIT Licensed
| |
- | *
| |
- | */
| |
- | !function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a(jQuery)}(function(a){"undefined"==typeof a&&"undefined"!=typeof window.jQuery&&(a=window.jQuery);var b={attr:function(a,b,c){var d,e={},f=this.msieversion(),g=new RegExp("^"+b,"i");if("undefined"==typeof a||"undefined"==typeof a[0])return{};for(var h in a[0].attributes)if(d=a[0].attributes[h],"undefined"!=typeof d&&null!==d&&(!f||f>=8||d.specified)&&g.test(d.name)){if("undefined"!=typeof c&&new RegExp(c+"$","i").test(d.name))return!0;e[this.camelize(d.name.replace(b,""))]=this.deserializeValue(d.value)}return"undefined"==typeof c?e:!1},setAttr:function(a,b,c,d){a[0].setAttribute(this.dasherize(b+c),String(d))},get:function(a,b){for(var c=0,d=(b||"").split(".");this.isObject(a)||this.isArray(a);)if(a=a[d[c++]],c===d.length)return a;return void 0},hash:function(a){return String(Math.random()).substring(2,a?a+2:9)},isArray:function(a){return"[object Array]"===Object.prototype.toString.call(a)},isObject:function(a){return a===Object(a)},deserializeValue:function(b){var c;try{return b?"true"==b||("false"==b?!1:"null"==b?null:isNaN(c=Number(b))?/^[\[\{]/.test(b)?a.parseJSON(b):b:c):b}catch(d){return b}},camelize:function(a){return a.replace(/-+(.)?/g,function(a,b){return b?b.toUpperCase():""})},dasherize:function(a){return a.replace(/::/g,"/").replace(/([A-Z]+)([A-Z][a-z])/g,"$1_$2").replace(/([a-z\d])([A-Z])/g,"$1_$2").replace(/_/g,"-").toLowerCase()},msieversion:function(){var a=window.navigator.userAgent,b=a.indexOf("MSIE ");return b>0||navigator.userAgent.match(/Trident.*rv\:11\./)?parseInt(a.substring(b+5,a.indexOf(".",b)),10):0}},c={namespace:"data-parsley-",inputs:"input, textarea, select",excluded:"input[type=button], input[type=submit], input[type=reset], input[type=hidden]",priorityEnabled:!0,uiEnabled:!0,validationThreshold:3,focus:"first",trigger:!1,errorClass:"parsley-error",successClass:"parsley-success",classHandler:function(){},errorsContainer:function(){},errorsWrapper:'<ul class="parsley-errors-list"></ul>',errorTemplate:"<li></li>"},d=function(){};d.prototype={asyncSupport:!1,actualizeOptions:function(){return this.options=this.OptionsFactory.get(this),this},validateThroughValidator:function(a,b,c){return window.ParsleyValidator.validate.apply(window.ParsleyValidator,[a,b,c])},subscribe:function(b,c){return a.listenTo(this,b.toLowerCase(),c),this},unsubscribe:function(b){return a.unsubscribeTo(this,b.toLowerCase()),this},reset:function(){if("ParsleyForm"!==this.__class__)return a.emit("parsley:field:reset",this);for(var b=0;b<this.fields.length;b++)a.emit("parsley:field:reset",this.fields[b]);a.emit("parsley:form:reset",this)},destroy:function(){if("ParsleyForm"!==this.__class__)return this.$element.removeData("Parsley"),this.$element.removeData("ParsleyFieldMultiple"),void a.emit("parsley:field:destroy",this);for(var b=0;b<this.fields.length;b++)this.fields[b].destroy();this.$element.removeData("Parsley"),a.emit("parsley:form:destroy",this)}};var e=function(){var a={},b=function(a){this.__class__="Validator",this.__version__="1.0.0",this.options=a||{},this.bindingKey=this.options.bindingKey||"_validatorjsConstraint"};b.prototype={constructor:b,validate:function(a,b,c){if("string"!=typeof a&&"object"!=typeof a)throw new Error("You must validate an object or a string");return"string"==typeof a||g(a)?this._validateString(a,b,c):this.isBinded(a)?this._validateBindedObject(a,b):this._validateObject(a,b,c)},bind:function(a,b){if("object"!=typeof a)throw new Error("Must bind a Constraint to an object");return a[this.bindingKey]=new c(b),this},unbind:function(a){return"undefined"==typeof a._validatorjsConstraint?this:(delete a[this.bindingKey],this)},isBinded:function(a){return"undefined"!=typeof a[this.bindingKey]},getBinded:function(a){return this.isBinded(a)?a[this.bindingKey]:null},_validateString:function(a,b,c){var f,h=[];g(b)||(b=[b]);for(var i=0;i<b.length;i++){if(!(b[i]instanceof e))throw new Error("You must give an Assert or an Asserts array to validate a string");f=b[i].check(a,c),f instanceof d&&h.push(f)}return h.length?h:!0},_validateObject:function(a,b,d){if("object"!=typeof b)throw new Error("You must give a constraint to validate an object");return b instanceof c?b.check(a,d):new c(b).check(a,d)},_validateBindedObject:function(a,b){return a[this.bindingKey].check(a,b)}},b.errorCode={must_be_a_string:"must_be_a_string",must_be_an_array:"must_be_an_array",must_be_a_number:"must_be_a_number",must_be_a_string_or_array:"must_be_a_string_or_array"};var c=function(a,b){if(this.__class__="Constraint",this.options=b||{},this.nodes={},a)try{this._bootstrap(a)}catch(c){throw new Error("Should give a valid mapping object to Constraint",c,a)}};c.prototype={constructor:c,check:function(a,b){var c,d={};for(var h in this.nodes){for(var i=!1,j=this.get(h),k=g(j)?j:[j],l=k.length-1;l>=0;l--)"Required"!==k[l].__class__||(i=k[l].requiresValidation(b));if(this.has(h,a)||this.options.strict||i)try{this.has(h,this.options.strict||i?a:void 0)||(new e).HaveProperty(h).validate(a),c=this._check(h,a[h],b),(g(c)&&c.length>0||!g(c)&&!f(c))&&(d[h]=c)}catch(m){d[h]=m}}return f(d)?!0:d},add:function(a,b){if(b instanceof e||g(b)&&b[0]instanceof e)return this.nodes[a]=b,this;if("object"==typeof b&&!g(b))return this.nodes[a]=b instanceof c?b:new c(b),this;throw new Error("Should give an Assert, an Asserts array, a Constraint",b)},has:function(a,b){return b="undefined"!=typeof b?b:this.nodes,"undefined"!=typeof b[a]},get:function(a,b){return this.has(a)?this.nodes[a]:b||null},remove:function(a){var b=[];for(var c in this.nodes)c!==a&&(b[c]=this.nodes[c]);return this.nodes=b,this},_bootstrap:function(a){if(a instanceof c)return this.nodes=a.nodes;for(var b in a)this.add(b,a[b])},_check:function(a,b,d){if(this.nodes[a]instanceof e)return this._checkAsserts(b,[this.nodes[a]],d);if(g(this.nodes[a]))return this._checkAsserts(b,this.nodes[a],d);if(this.nodes[a]instanceof c)return this.nodes[a].check(b,d);throw new Error("Invalid node",this.nodes[a])},_checkAsserts:function(a,b,c){for(var d,e=[],f=0;f<b.length;f++)d=b[f].check(a,c),"undefined"!=typeof d&&!0!==d&&e.push(d);return e}};var d=function(a,b,c){if(this.__class__="Violation",!(a instanceof e))throw new Error("Should give an assertion implementing the Assert interface");this.assert=a,this.value=b,"undefined"!=typeof c&&(this.violation=c)};d.prototype={show:function(){var a={assert:this.assert.__class__,value:this.value};return this.violation&&(a.violation=this.violation),a},__toString:function(){return"undefined"!=typeof this.violation&&(this.violation='", '+this.getViolation().constraint+" expected was "+this.getViolation().expected),this.assert.__class__+' assert failed for "'+this.value+this.violation||""},getViolation:function(){var a,b;for(a in this.violation)b=this.violation[a];return{constraint:a,expected:b}}};var e=function(a){this.__class__="Assert",this.__parentClass__=this.__class__,this.groups=[],"undefined"!=typeof a&&this.addGroup(a)};e.prototype={construct:e,requiresValidation:function(a){return a&&!this.hasGroup(a)?!1:!a&&this.hasGroups()?!1:!0},check:function(a,b){if(this.requiresValidation(b))try{return this.validate(a,b)}catch(c){return c}},hasGroup:function(a){return g(a)?this.hasOneOf(a):"Any"===a?!0:this.hasGroups()?-1!==this.groups.indexOf(a):"Default"===a},hasOneOf:function(a){for(var b=0;b<a.length;b++)if(this.hasGroup(a[b]))return!0;return!1},hasGroups:function(){return this.groups.length>0},addGroup:function(a){return g(a)?this.addGroups(a):(this.hasGroup(a)||this.groups.push(a),this)},removeGroup:function(a){for(var b=[],c=0;c<this.groups.length;c++)a!==this.groups[c]&&b.push(this.groups[c]);return this.groups=b,this},addGroups:function(a){for(var b=0;b<a.length;b++)this.addGroup(a[b]);return this},HaveProperty:function(a){return this.__class__="HaveProperty",this.node=a,this.validate=function(a){if("undefined"==typeof a[this.node])throw new d(this,a,{value:this.node});return!0},this},Blank:function(){return this.__class__="Blank",this.validate=function(a){if("string"!=typeof a)throw new d(this,a,{value:b.errorCode.must_be_a_string});if(""!==a.replace(/^\s+/g,"").replace(/\s+$/g,""))throw new d(this,a);return!0},this},Callback:function(a){if(this.__class__="Callback",this.arguments=Array.prototype.slice.call(arguments),1===this.arguments.length?this.arguments=[]:this.arguments.splice(0,1),"function"!=typeof a)throw new Error("Callback must be instanciated with a function");return this.fn=a,this.validate=function(a){var b=this.fn.apply(this,[a].concat(this.arguments));if(!0!==b)throw new d(this,a,{result:b});return!0},this},Choice:function(a){if(this.__class__="Choice",!g(a)&&"function"!=typeof a)throw new Error("Choice must be instanciated with an array or a function");return this.list=a,this.validate=function(a){for(var b="function"==typeof this.list?this.list():this.list,c=0;c<b.length;c++)if(a===b[c])return!0;throw new d(this,a,{choices:b})},this},Collection:function(a){return this.__class__="Collection",this.constraint="undefined"!=typeof a?a instanceof e?a:new c(a):!1,this.validate=function(a,c){var e,h=new b,i=0,j={},k=this.groups.length?this.groups:c;if(!g(a))throw new d(this,array,{value:b.errorCode.must_be_an_array});for(var l=0;l<a.length;l++)e=this.constraint?h.validate(a[l],this.constraint,k):h.validate(a[l],k),f(e)||(j[i]=e),i++;return f(j)?!0:j},this},Count:function(a){return this.__class__="Count",this.count=a,this.validate=function(a){if(!g(a))throw new d(this,a,{value:b.errorCode.must_be_an_array});var c="function"==typeof this.count?this.count(a):this.count;if(isNaN(Number(c)))throw new Error("Count must be a valid interger",c);if(c!==a.length)throw new d(this,a,{count:c});return!0},this},Email:function(){return this.__class__="Email",this.validate=function(a){var c=/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i;if("string"!=typeof a)throw new d(this,a,{value:b.errorCode.must_be_a_string});if(!c.test(a))throw new d(this,a);return!0},this},EqualTo:function(a){if(this.__class__="EqualTo","undefined"==typeof a)throw new Error("EqualTo must be instanciated with a value or a function");return this.reference=a,this.validate=function(a){var b="function"==typeof this.reference?this.reference(a):this.reference;if(b!==a)throw new d(this,a,{value:b});return!0},this},GreaterThan:function(a){if(this.__class__="GreaterThan","undefined"==typeof a)throw new Error("Should give a threshold value");return this.threshold=a,this.validate=function(a){if(""===a||isNaN(Number(a)))throw new d(this,a,{value:b.errorCode.must_be_a_number});if(this.threshold>=a)throw new d(this,a,{threshold:this.threshold});return!0},this},GreaterThanOrEqual:function(a){if(this.__class__="GreaterThanOrEqual","undefined"==typeof a)throw new Error("Should give a threshold value");return this.threshold=a,this.validate=function(a){if(""===a||isNaN(Number(a)))throw new d(this,a,{value:b.errorCode.must_be_a_number});if(this.threshold>a)throw new d(this,a,{threshold:this.threshold});return!0},this},InstanceOf:function(a){if(this.__class__="InstanceOf","undefined"==typeof a)throw new Error("InstanceOf must be instanciated with a value");return this.classRef=a,this.validate=function(a){if(!0!=a instanceof this.classRef)throw new d(this,a,{classRef:this.classRef});return!0},this},Length:function(a){if(this.__class__="Length",!a.min&&!a.max)throw new Error("Lenth assert must be instanciated with a { min: x, max: y } object");return this.min=a.min,this.max=a.max,this.validate=function(a){if("string"!=typeof a&&!g(a))throw new d(this,a,{value:b.errorCode.must_be_a_string_or_array});if("undefined"!=typeof this.min&&this.min===this.max&&a.length!==this.min)throw new d(this,a,{min:this.min,max:this.max});if("undefined"!=typeof this.max&&a.length>this.max)throw new d(this,a,{max:this.max});if("undefined"!=typeof this.min&&a.length<this.min)throw new d(this,a,{min:this.min});return!0},this},LessThan:function(a){if(this.__class__="LessThan","undefined"==typeof a)throw new Error("Should give a threshold value");return this.threshold=a,this.validate=function(a){if(""===a||isNaN(Number(a)))throw new d(this,a,{value:b.errorCode.must_be_a_number});if(this.threshold<=a)throw new d(this,a,{threshold:this.threshold});return!0},this},LessThanOrEqual:function(a){if(this.__class__="LessThanOrEqual","undefined"==typeof a)throw new Error("Should give a threshold value");return this.threshold=a,this.validate=function(a){if(""===a||isNaN(Number(a)))throw new d(this,a,{value:b.errorCode.must_be_a_number});if(this.threshold<a)throw new d(this,a,{threshold:this.threshold});return!0},this},NotNull:function(){return this.__class__="NotNull",this.validate=function(a){if(null===a||"undefined"==typeof a)throw new d(this,a);return!0},this},NotBlank:function(){return this.__class__="NotBlank",this.validate=function(a){if("string"!=typeof a)throw new d(this,a,{value:b.errorCode.must_be_a_string});if(""===a.replace(/^\s+/g,"").replace(/\s+$/g,""))throw new d(this,a);return!0},this},Null:function(){return this.__class__="Null",this.validate=function(a){if(null!==a)throw new d(this,a);return!0},this},Range:function(a,b){if(this.__class__="Range","undefined"==typeof a||"undefined"==typeof b)throw new Error("Range assert expects min and max values");return this.min=a,this.max=b,this.validate=function(a){try{return"string"==typeof a&&isNaN(Number(a))||g(a)?(new e).Length({min:this.min,max:this.max}).validate(a):(new e).GreaterThanOrEqual(this.min).validate(a)&&(new e).LessThanOrEqual(this.max).validate(a),!0}catch(b){throw new d(this,a,b.violation)}return!0},this},Regexp:function(a,c){if(this.__class__="Regexp","undefined"==typeof a)throw new Error("You must give a regexp");return this.regexp=a,this.flag=c||"",this.validate=function(a){if("string"!=typeof a)throw new d(this,a,{value:b.errorCode.must_be_a_string});if(!new RegExp(this.regexp,this.flag).test(a))throw new d(this,a,{regexp:this.regexp,flag:this.flag});return!0},this},Required:function(){return this.__class__="Required",this.validate=function(a){if("undefined"==typeof a)throw new d(this,a);try{"string"==typeof a?(new e).NotNull().validate(a)&&(new e).NotBlank().validate(a):!0===g(a)&&(new e).Length({min:1}).validate(a)}catch(b){throw new d(this,a)}return!0},this},Unique:function(a){return this.__class__="Unique","object"==typeof a&&(this.key=a.key),this.validate=function(a){var c,e=[];if(!g(a))throw new d(this,a,{value:b.errorCode.must_be_an_array});for(var f=0;f<a.length;f++)if(c="object"==typeof a[f]?a[f][this.key]:a[f],"undefined"!=typeof c){if(-1!==e.indexOf(c))throw new d(this,a,{value:c});e.push(c)}return!0},this}},a.Assert=e,a.Validator=b,a.Violation=d,a.Constraint=c,Array.prototype.indexOf||(Array.prototype.indexOf=function(a){if(null===this)throw new TypeError;var b=Object(this),c=b.length>>>0;if(0===c)return-1;var d=0;if(arguments.length>1&&(d=Number(arguments[1]),d!=d?d=0:0!==d&&1/0!=d&&d!=-1/0&&(d=(d>0||-1)*Math.floor(Math.abs(d)))),d>=c)return-1;for(var e=d>=0?d:Math.max(c-Math.abs(d),0);c>e;e++)if(e in b&&b[e]===a)return e;return-1});var f=function(a){for(var b in a)return!1;return!0},g=function(a){return"[object Array]"===Object.prototype.toString.call(a)};return"function"==typeof define&&define.amd?define("vendors/validator.js/dist/validator",[],function(){return a}):"undefined"!=typeof module&&module.exports?module.exports=a:window["undefined"!=typeof validatorjs_ns?validatorjs_ns:"Validator"]=a,a}();e="undefined"!=typeof e?e:"undefined"!=typeof module?module.exports:null;var f=function(a,b){this.__class__="ParsleyValidator",this.Validator=e,this.locale="en",this.init(a||{},b||{})};f.prototype={init:function(b,c){this.catalog=c;for(var d in b)this.addValidator(d,b[d].fn,b[d].priority,b[d].requirementsTransformer);a.emit("parsley:validator:init")},setLocale:function(a){if("undefined"==typeof this.catalog[a])throw new Error(a+" is not available in the catalog");return this.locale=a,this},addCatalog:function(a,b,c){return"object"==typeof b&&(this.catalog[a]=b),!0===c?this.setLocale(a):this},addMessage:function(a,b,c){return"undefined"==typeof this.catalog[a]&&(this.catalog[a]={}),this.catalog[a][b.toLowerCase()]=c,this},validate:function(){return(new this.Validator.Validator).validate.apply(new e.Validator,arguments)},addValidator:function(b,c,d,f){return this.validators[b.toLowerCase()]=function(b){return a.extend((new e.Assert).Callback(c,b),{priority:d,requirementsTransformer:f})},this},updateValidator:function(a,b,c,d){return this.addValidator(a,b,c,d)},removeValidator:function(a){return delete this.validators[a],this},getErrorMessage:function(a){var b;return b="type"===a.name?this.catalog[this.locale][a.name][a.requirements]:this.formatMessage(this.catalog[this.locale][a.name],a.requirements),""!==b?b:this.catalog[this.locale].defaultMessage},formatMessage:function(a,b){if("object"==typeof b){for(var c in b)a=this.formatMessage(a,b[c]);return a}return"string"==typeof a?a.replace(new RegExp("%s","i"),b):""},validators:{notblank:function(){return a.extend((new e.Assert).NotBlank(),{priority:2})},required:function(){return a.extend((new e.Assert).Required(),{priority:512})},type:function(b){var c;switch(b){case"email":c=(new e.Assert).Email();break;case"range":case"number":c=(new e.Assert).Regexp("^-?(?:\\d+|\\d{1,3}(?:,\\d{3})+)?(?:\\.\\d+)?$");break;case"integer":c=(new e.Assert).Regexp("^-?\\d+$");break;case"digits":c=(new e.Assert).Regexp("^\\d+$");break;case"alphanum":c=(new e.Assert).Regexp("^\\w+$","i");break;case"url":c=(new e.Assert).Regexp("(https?:\\/\\/)?(www\\.)?[-a-zA-Z0-9@:%._\\+~#=]{2,256}\\.[a-z]{2,4}\\b([-a-zA-Z0-9@:%_\\+.~#?&//=]*)","i");break;default:throw new Error("validator type `"+b+"` is not supported")}return a.extend(c,{priority:256})},pattern:function(b){var c="";return/^\/.*\/(?:[gimy]*)$/.test(b)&&(c=b.replace(/.*\/([gimy]*)$/,"$1"),b=b.replace(new RegExp("^/(.*?)/"+c+"$"),"$1")),a.extend((new e.Assert).Regexp(b,c),{priority:64})},minlength:function(b){return a.extend((new e.Assert).Length({min:b}),{priority:30,requirementsTransformer:function(){return"string"!=typeof b||isNaN(b)?b:parseInt(b,10)}})},maxlength:function(b){return a.extend((new e.Assert).Length({max:b}),{priority:30,requirementsTransformer:function(){return"string"!=typeof b||isNaN(b)?b:parseInt(b,10)}})},length:function(b){return a.extend((new e.Assert).Length({min:b[0],max:b[1]}),{priority:32})},mincheck:function(a){return this.minlength(a)},maxcheck:function(a){return this.maxlength(a)},check:function(a){return this.length(a)},min:function(b){return a.extend((new e.Assert).GreaterThanOrEqual(b),{priority:30,requirementsTransformer:function(){return"string"!=typeof b||isNaN(b)?b:parseInt(b,10)}})},max:function(b){return a.extend((new e.Assert).LessThanOrEqual(b),{priority:30,requirementsTransformer:function(){return"string"!=typeof b||isNaN(b)?b:parseInt(b,10)}})},range:function(b){return a.extend((new e.Assert).Range(b[0],b[1]),{priority:32,requirementsTransformer:function(){for(var a=0;a<b.length;a++)b[a]="string"!=typeof b[a]||isNaN(b[a])?b[a]:parseInt(b[a],10);return b}})},equalto:function(b){return a.extend((new e.Assert).EqualTo(b),{priority:256,requirementsTransformer:function(){return a(b).length?a(b).val():b}})}}};var g=function(){this.__class__="ParsleyUI"};g.prototype={listen:function(){return a.listen("parsley:form:init",this,this.setupForm),a.listen("parsley:field:init",this,this.setupField),a.listen("parsley:field:validated",this,this.reflow),a.listen("parsley:form:validated",this,this.focus),a.listen("parsley:field:reset",this,this.reset),a.listen("parsley:form:destroy",this,this.destroy),a.listen("parsley:field:destroy",this,this.destroy),this},reflow:function(a){if("undefined"!=typeof a._ui&&!1!==a._ui.active){var b=this._diff(a.validationResult,a._ui.lastValidationResult);a._ui.lastValidationResult=a.validationResult,a._ui.validatedOnce=!0,this.manageStatusClass(a),this.manageErrorsMessages(a,b),this.actualizeTriggers(a),(b.kept.length||b.added.length)&&"undefined"==typeof a._ui.failedOnce&&this.manageFailingFieldTrigger(a)}},getErrorsMessages:function(a){if(!0===a.validationResult)return[];for(var b=[],c=0;c<a.validationResult.length;c++)b.push(this._getErrorMessage(a,a.validationResult[c].assert));return b},manageStatusClass:function(a){!0===a.validationResult?this._successClass(a):a.validationResult.length>0?this._errorClass(a):this._resetClass(a)},manageErrorsMessages:function(b,c){if("undefined"==typeof b.options.errorsMessagesDisabled){if("undefined"!=typeof b.options.errorMessage)return c.added.length||c.kept.length?(0===b._ui.$errorsWrapper.find(".parsley-custom-error-message").length&&b._ui.$errorsWrapper.append(a(b.options.errorTemplate).addClass("parsley-custom-error-message")),b._ui.$errorsWrapper.addClass("filled").find(".parsley-custom-error-message").html(b.options.errorMessage)):b._ui.$errorsWrapper.removeClass("filled").find(".parsley-custom-error-message").remove();for(var d=0;d<c.removed.length;d++)this.removeError(b,c.removed[d].assert.name,!0);for(d=0;d<c.added.length;d++)this.addError(b,c.added[d].assert.name,void 0,c.added[d].assert,!0);for(d=0;d<c.kept.length;d++)this.updateError(b,c.kept[d].assert.name,void 0,c.kept[d].assert,!0)}},addError:function(b,c,d,e,f){b._ui.$errorsWrapper.addClass("filled").append(a(b.options.errorTemplate).addClass("parsley-"+c).html(d||this._getErrorMessage(b,e))),!0!==f&&this._errorClass(b)},updateError:function(a,b,c,d,e){a._ui.$errorsWrapper.addClass("filled").find(".parsley-"+b).html(c||this._getErrorMessage(a,d)),!0!==e&&this._errorClass(a)},removeError:function(a,b,c){a._ui.$errorsWrapper.removeClass("filled").find(".parsley-"+b).remove(),!0!==c&&this.manageStatusClass(a)},focus:function(a){if(!0===a.validationResult||"none"===a.options.focus)return a._focusedField=null;a._focusedField=null;for(var b=0;b<a.fields.length;b++)if(!0!==a.fields[b].validationResult&&a.fields[b].validationResult.length>0&&"undefined"==typeof a.fields[b].options.noFocus){if("first"===a.options.focus)return a._focusedField=a.fields[b].$element,a._focusedField.focus();a._focusedField=a.fields[b].$element}return null===a._focusedField?null:a._focusedField.focus()},_getErrorMessage:function(a,b){var c=b.name+"Message";return"undefined"!=typeof a.options[c]?window.ParsleyValidator.formatMessage(a.options[c],b.requirements):window.ParsleyValidator.getErrorMessage(b)},_diff:function(a,b,c){for(var d=[],e=[],f=0;f<a.length;f++){for(var g=!1,h=0;h<b.length;h++)if(a[f].assert.name===b[h].assert.name){g=!0;break}g?e.push(a[f]):d.push(a[f])}return{kept:e,added:d,removed:c?[]:this._diff(b,a,!0).added}},setupForm:function(b){b.$element.on("submit.Parsley",!1,a.proxy(b.onSubmitValidate,b)),!1!==b.options.uiEnabled&&b.$element.attr("novalidate","")},setupField:function(b){var c={active:!1};!1!==b.options.uiEnabled&&(c.active=!0,b.$element.attr(b.options.namespace+"id",b.__id__),c.$errorClassHandler=this._manageClassHandler(b),c.errorsWrapperId="parsley-id-"+("undefined"!=typeof b.options.multiple?"multiple-"+b.options.multiple:b.__id__),c.$errorsWrapper=a(b.options.errorsWrapper).attr("id",c.errorsWrapperId),c.lastValidationResult=[],c.validatedOnce=!1,c.validationInformationVisible=!1,b._ui=c,b.$element.is(b.options.excluded)||this._insertErrorWrapper(b),this.actualizeTriggers(b))},_manageClassHandler:function(b){if("string"==typeof b.options.classHandler&&a(b.options.classHandler).length)return a(b.options.classHandler);var c=b.options.classHandler(b);return"undefined"!=typeof c&&c.length?c:"undefined"==typeof b.options.multiple||b.$element.is("select")?b.$element:b.$element.parent()},_insertErrorWrapper:function(b){var c;if("string"==typeof b.options.errorsContainer){if(a(b.options.errorsContainer).length)return a(b.options.errorsContainer).append(b._ui.$errorsWrapper);window.console&&window.console.warn&&window.console.warn("The errors container `"+b.options.errorsContainer+"` does not exist in DOM")}else"function"==typeof b.options.errorsContainer&&(c=b.options.errorsContainer(b));return"undefined"!=typeof c&&c.length?c.append(b._ui.$errorsWrapper):"undefined"==typeof b.options.multiple?b.$element.after(b._ui.$errorsWrapper):b.$element.parent().after(b._ui.$errorsWrapper)},actualizeTriggers:function(b){var c=this;if(b.options.multiple?a("["+b.options.namespace+'multiple="'+b.options.multiple+'"]').each(function(){a(this).off(".Parsley")}):b.$element.off(".Parsley"),!1!==b.options.trigger){var d=b.options.trigger.replace(/^\s+/g,"").replace(/\s+$/g,"");""!==d&&(b.options.multiple?a("["+b.options.namespace+'multiple="'+b.options.multiple+'"]').each(function(){a(this).on(d.split(" ").join(".Parsley ")+".Parsley",!1,a.proxy("function"==typeof b.eventValidate?b.eventValidate:c.eventValidate,b))}):b.$element.on(d.split(" ").join(".Parsley ")+".Parsley",!1,a.proxy("function"==typeof b.eventValidate?b.eventValidate:this.eventValidate,b)))}},eventValidate:function(a){new RegExp("key").test(a.type)&&!this._ui.validationInformationVisible&&this.getValue().length<=this.options.validationThreshold||(this._ui.validatedOnce=!0,this.validate())},manageFailingFieldTrigger:function(b){return b._ui.failedOnce=!0,b.options.multiple&&a("["+b.options.namespace+'multiple="'+b.options.multiple+'"]').each(function(){return new RegExp("change","i").test(a(this).parsley().options.trigger||"")?void 0:a(this).on("change.ParsleyFailedOnce",!1,a.proxy(b.validate,b))}),b.$element.is("select")&&!new RegExp("change","i").test(b.options.trigger||"")?b.$element.on("change.ParsleyFailedOnce",!1,a.proxy(b.validate,b)):new RegExp("keyup","i").test(b.options.trigger||"")?void 0:b.$element.on("keyup.ParsleyFailedOnce",!1,a.proxy(b.validate,b))},reset:function(b){b.$element.off(".Parsley"),b.$element.off(".ParsleyFailedOnce"),"undefined"!=typeof b._ui&&"ParsleyForm"!==b.__class__&&(b._ui.$errorsWrapper.children().each(function(){a(this).remove()}),this._resetClass(b),b._ui.validatedOnce=!1,b._ui.lastValidationResult=[],b._ui.validationInformationVisible=!1)},destroy:function(a){this.reset(a),"ParsleyForm"!==a.__class__&&("undefined"!=typeof a._ui&&a._ui.$errorsWrapper.remove(),delete a._ui)},_successClass:function(a){a._ui.validationInformationVisible=!0,a._ui.$errorClassHandler.removeClass(a.options.errorClass).addClass(a.options.successClass)},_errorClass:function(a){a._ui.validationInformationVisible=!0,a._ui.$errorClassHandler.removeClass(a.options.successClass).addClass(a.options.errorClass)},_resetClass:function(a){a._ui.$errorClassHandler.removeClass(a.options.successClass).removeClass(a.options.errorClass)}};var h=function(c,d,e,f){this.__class__="OptionsFactory",this.__id__=b.hash(4),this.formOptions=null,this.fieldOptions=null,this.staticOptions=a.extend(!0,{},c,d,e,{namespace:f})};h.prototype={get:function(a){if("undefined"==typeof a.__class__)throw new Error("Parsley Instance expected");switch(a.__class__){case"Parsley":return this.staticOptions;case"ParsleyForm":return this.getFormOptions(a);case"ParsleyField":case"ParsleyFieldMultiple":return this.getFieldOptions(a);default:throw new Error("Instance "+a.__class__+" is not supported")}},getFormOptions:function(c){return this.formOptions=b.attr(c.$element,this.staticOptions.namespace),a.extend({},this.staticOptions,this.formOptions)},getFieldOptions:function(c){return this.fieldOptions=b.attr(c.$element,this.staticOptions.namespace),null===this.formOptions&&"undefined"!=typeof c.parent&&(this.formOptions=this.getFormOptions(c.parent)),a.extend({},this.staticOptions,this.formOptions,this.fieldOptions)}};var i=function(c,d){if(this.__class__="ParsleyForm",this.__id__=b.hash(4),"OptionsFactory"!==b.get(d,"__class__"))throw new Error("You must give an OptionsFactory instance");this.OptionsFactory=d,this.$element=a(c),this.validationResult=null,this.options=this.OptionsFactory.get(this)};i.prototype={onSubmitValidate:function(b){return this.validate(void 0,void 0,b),!1===this.validationResult&&b instanceof a.Event&&(b.stopImmediatePropagation(),b.preventDefault()),this},validate:function(b,c,d){this.submitEvent=d,this.validationResult=!0;var e=[];this._refreshFields(),a.emit("parsley:form:validate",this);for(var f=0;f<this.fields.length;f++)(!b||this._isFieldInGroup(this.fields[f],b))&&(e=this.fields[f].validate(c),!0!==e&&e.length>0&&this.validationResult&&(this.validationResult=!1));return a.emit("parsley:form:validated",this),this.validationResult},isValid:function(a,b){this._refreshFields();for(var c=0;c<this.fields.length;c++)if((!a||this._isFieldInGroup(this.fields[c],a))&&!1===this.fields[c].isValid(b))return!1;return!0},_isFieldInGroup:function(c,d){return b.isArray(c.options.group)?-1!==a.inArray(c.options.group,d):c.options.group===d},_refreshFields:function(){return this.actualizeOptions()._bindFields()},_bindFields:function(){var a=this;return this.fields=[],this.fieldsMappedById={},this.$element.find(this.options.inputs).each(function(){var b=new window.Parsley(this,{},a);"ParsleyField"!==b.__class__&&"ParsleyFieldMultiple"!==b.__class__||b.$element.is(b.options.excluded)||"undefined"==typeof a.fieldsMappedById[b.__class__+"-"+b.__id__]&&(a.fieldsMappedById[b.__class__+"-"+b.__id__]=b,a.fields.push(b))}),this}};var j=function(c,d,e,f,g){if(!new RegExp("ParsleyField").test(b.get(c,"__class__")))throw new Error("ParsleyField or ParsleyFieldMultiple instance expected");if("function"!=typeof window.ParsleyValidator.validators[d]&&"Assert"!==window.ParsleyValidator.validators[d](e).__parentClass__)throw new Error("Valid validator expected");var h=function(a,c){return"undefined"!=typeof a.options[c+"Priority"]?a.options[c+"Priority"]:b.get(window.ParsleyValidator.validators[c](e),"priority")||2};return f=f||h(c,d),"function"==typeof window.ParsleyValidator.validators[d](e).requirementsTransformer&&(e=window.ParsleyValidator.validators[d](e).requirementsTransformer()),a.extend(window.ParsleyValidator.validators[d](e),{name:d,requirements:e,priority:f,groups:[f],isDomConstraint:g||b.attr(c.$element,c.options.namespace,d)})},k=function(c,d,e){this.__class__="ParsleyField",this.__id__=b.hash(4),this.$element=a(c),"undefined"!=typeof e?(this.parent=e,this.OptionsFactory=this.parent.OptionsFactory,this.options=this.OptionsFactory.get(this)):(this.OptionsFactory=d,this.options=this.OptionsFactory.get(this)),this.constraints=[],this.constraintsByName={},this.validationResult=[],this._bindConstraints()};k.prototype={validate:function(b){return this.value=this.getValue(),a.emit("parsley:field:validate",this),a.emit("parsley:field:"+(this.isValid(b,this.value)?"success":"error"),this),a.emit("parsley:field:validated",this),this.validationResult},isValid:function(a,b){this.refreshConstraints();var c=this._getConstraintsSortedPriorities();if(b=b||this.getValue(),0===b.length&&!this._isRequired()&&"undefined"==typeof this.options.validateIfEmpty&&!0!==a)return this.validationResult=[];if(!1===this.options.priorityEnabled)return!0===(this.validationResult=this.validateThroughValidator(b,this.constraints,"Any"));for(var d=0;d<c.length;d++)if(!0!==(this.validationResult=this.validateThroughValidator(b,this.constraints,c[d])))return!1;return!0},getValue:function(){var a;
| |
- | return a="undefined"!=typeof this.options.value?this.options.value:this.$element.val(),"undefined"==typeof a||null===a?"":!0===this.options.trimValue?a.replace(/^\s+|\s+$/g,""):a},refreshConstraints:function(){return this.actualizeOptions()._bindConstraints()},addConstraint:function(a,b,c,d){if(a=a.toLowerCase(),"function"==typeof window.ParsleyValidator.validators[a]){var e=new j(this,a,b,c,d);"undefined"!==this.constraintsByName[e.name]&&this.removeConstraint(e.name),this.constraints.push(e),this.constraintsByName[e.name]=e}return this},removeConstraint:function(a){for(var b=0;b<this.constraints.length;b++)if(a===this.constraints[b].name){this.constraints.splice(b,1);break}return this},updateConstraint:function(a,b,c){return this.removeConstraint(a).addConstraint(a,b,c)},_bindConstraints:function(){for(var a=[],b=0;b<this.constraints.length;b++)!1===this.constraints[b].isDomConstraint&&a.push(this.constraints[b]);this.constraints=a;for(var c in this.options)this.addConstraint(c,this.options[c]);return this._bindHtml5Constraints()},_bindHtml5Constraints:function(){(this.$element.hasClass("required")||this.$element.attr("required"))&&this.addConstraint("required",!0,void 0,!0),"string"==typeof this.$element.attr("pattern")&&this.addConstraint("pattern",this.$element.attr("pattern"),void 0,!0),"undefined"!=typeof this.$element.attr("min")&&"undefined"!=typeof this.$element.attr("max")?this.addConstraint("range",[this.$element.attr("min"),this.$element.attr("max")],void 0,!0):"undefined"!=typeof this.$element.attr("min")?this.addConstraint("min",this.$element.attr("min"),void 0,!0):"undefined"!=typeof this.$element.attr("max")&&this.addConstraint("max",this.$element.attr("max"),void 0,!0);var a=this.$element.attr("type");return"undefined"==typeof a?this:"number"===a?this.addConstraint("type","integer",void 0,!0):new RegExp(a,"i").test("email url range")?this.addConstraint("type",a,void 0,!0):this},_isRequired:function(){return"undefined"==typeof this.constraintsByName.required?!1:!1!==this.constraintsByName.required.requirements},_getConstraintsSortedPriorities:function(){for(var a=[],b=0;b<this.constraints.length;b++)-1===a.indexOf(this.constraints[b].priority)&&a.push(this.constraints[b].priority);return a.sort(function(a,b){return b-a}),a}};var l=function(){this.__class__="ParsleyFieldMultiple"};l.prototype={addElement:function(a){return this.$elements.push(a),this},refreshConstraints:function(){var b;if(this.constraints=[],this.$element.is("select"))return this.actualizeOptions()._bindConstraints(),this;for(var c=0;c<this.$elements.length;c++)if(a("html").has(this.$elements[c]).length){b=this.$elements[c].data("ParsleyFieldMultiple").refreshConstraints().constraints;for(var d=0;d<b.length;d++)this.addConstraint(b[d].name,b[d].requirements,b[d].priority,b[d].isDomConstraint)}else this.$elements.splice(c,1);return this},getValue:function(){if("undefined"!=typeof this.options.value)return this.options.value;if(this.$element.is("input[type=radio]"))return a("["+this.options.namespace+'multiple="'+this.options.multiple+'"]:checked').val()||"";if(this.$element.is("input[type=checkbox]")){var b=[];return a("["+this.options.namespace+'multiple="'+this.options.multiple+'"]:checked').each(function(){b.push(a(this).val())}),b.length?b:[]}return this.$element.is("select")&&null===this.$element.val()?[]:this.$element.val()},_init:function(a){return this.$elements=[this.$element],this.options.multiple=a,this}};var m=a({}),n={};a.listen=function(a){if("undefined"==typeof n[a]&&(n[a]=[]),"function"==typeof arguments[1])return n[a].push({fn:arguments[1]});if("object"==typeof arguments[1]&&"function"==typeof arguments[2])return n[a].push({fn:arguments[2],ctxt:arguments[1]});throw new Error("Wrong parameters")},a.listenTo=function(a,b,c){if("undefined"==typeof n[b]&&(n[b]=[]),!(a instanceof k||a instanceof i))throw new Error("Must give Parsley instance");if("string"!=typeof b||"function"!=typeof c)throw new Error("Wrong parameters");n[b].push({instance:a,fn:c})},a.unsubscribe=function(a,b){if("undefined"!=typeof n[a]){if("string"!=typeof a||"function"!=typeof b)throw new Error("Wrong arguments");for(var c=0;c<n[a].length;c++)if(n[a][c].fn===b)return n[a].splice(c,1)}},a.unsubscribeTo=function(a,b){if("undefined"!=typeof n[b]){if(!(a instanceof k||a instanceof i))throw new Error("Must give Parsley instance");for(var c=0;c<n[b].length;c++)if("undefined"!=typeof n[b][c].instance&&n[b][c].instance.__id__===a.__id__)return n[b].splice(c,1)}},a.unsubscribeAll=function(a){"undefined"!=typeof n[a]&&delete n[a]},a.emit=function(a,b){if("undefined"!=typeof n[a])for(var c=0;c<n[a].length;c++)if("undefined"!=typeof n[a][c].instance){if(b instanceof k||b instanceof i)if(n[a][c].instance.__id__!==b.__id__){if(n[a][c].instance instanceof i&&b instanceof k)for(var d=0;d<n[a][c].instance.fields.length;d++)if(n[a][c].instance.fields[d].__id__===b.__id__){n[a][c].fn.apply(m,Array.prototype.slice.call(arguments,1));continue}}else n[a][c].fn.apply(m,Array.prototype.slice.call(arguments,1))}else n[a][c].fn.apply("undefined"!=typeof n[a][c].ctxt?n[a][c].ctxt:m,Array.prototype.slice.call(arguments,1))},a.subscribed=function(){return n},window.ParsleyConfig=window.ParsleyConfig||{},window.ParsleyConfig.i18n=window.ParsleyConfig.i18n||{},window.ParsleyConfig.i18n.en=a.extend(window.ParsleyConfig.i18n.en||{},{defaultMessage:"This value seems to be invalid.",type:{email:"This value should be a valid email.",url:"This value should be a valid url.",number:"This value should be a valid number.",integer:"This value should be a valid integer.",digits:"This value should be digits.",alphanum:"This value should be alphanumeric."},notblank:"This value should not be blank.",required:"This value is required.",pattern:"This value seems to be invalid.",min:"This value should be greater than or equal to %s.",max:"This value should be lower than or equal to %s.",range:"This value should be between %s and %s.",minlength:"This value is too short. It should have %s characters or more.",maxlength:"This value is too long. It should have %s characters or fewer.",length:"This value length is invalid. It should be between %s and %s characters long.",mincheck:"You must select at least %s choices.",maxcheck:"You must select %s choices or fewer.",check:"You must select between %s and %s choices.",equalto:"This value should be the same."}),"undefined"!=typeof window.ParsleyValidator&&window.ParsleyValidator.addCatalog("en",window.ParsleyConfig.i18n.en,!0);var o=function(c,d,e){if(this.__class__="Parsley",this.__version__="2.0.5",this.__id__=b.hash(4),"undefined"==typeof c)throw new Error("You must give an element");if("undefined"!=typeof e&&"ParsleyForm"!==e.__class__)throw new Error("Parent instance must be a ParsleyForm instance");return this.init(a(c),d,e)};o.prototype={init:function(a,d,e){if(!a.length)throw new Error("You must bind Parsley on an existing element.");if(this.$element=a,this.$element.data("Parsley")){var f=this.$element.data("Parsley");return"undefined"!=typeof e&&(f.parent=e),f}return this.OptionsFactory=new h(c,b.get(window,"ParsleyConfig")||{},d,this.getNamespace(d)),this.options=this.OptionsFactory.get(this),this.$element.is("form")||b.attr(this.$element,this.options.namespace,"validate")&&!this.$element.is(this.options.inputs)?this.bind("parsleyForm"):this.$element.is(this.options.inputs)&&!this.$element.is(this.options.excluded)?this.isMultiple()?this.handleMultiple(e):this.bind("parsleyField",e):this},isMultiple:function(){return this.$element.is("input[type=radio], input[type=checkbox]")&&"undefined"==typeof this.options.multiple||this.$element.is("select")&&"undefined"!=typeof this.$element.attr("multiple")},handleMultiple:function(c){var d,e,f,g=this;if(this.options=a.extend(this.options,c?c.OptionsFactory.get(c):{},b.attr(this.$element,this.options.namespace)),this.options.multiple?e=this.options.multiple:"undefined"!=typeof this.$element.attr("name")&&this.$element.attr("name").length?e=d=this.$element.attr("name"):"undefined"!=typeof this.$element.attr("id")&&this.$element.attr("id").length&&(e=this.$element.attr("id")),this.$element.is("select")&&"undefined"!=typeof this.$element.attr("multiple"))return this.bind("parsleyFieldMultiple",c,e||this.__id__);if("undefined"==typeof e)return window.console&&window.console.warn&&window.console.warn("To be binded by Parsley, a radio, a checkbox and a multiple select input must have either a name or a multiple option.",this.$element),this;if(e=e.replace(/(:|\.|\[|\]|\$)/g,""),"undefined"!=typeof d&&a('input[name="'+d+'"]').each(function(){a(this).is("input[type=radio], input[type=checkbox]")&&a(this).attr(g.options.namespace+"multiple",e)}),a("["+this.options.namespace+"multiple="+e+"]").length)for(var h=0;h<a("["+this.options.namespace+"multiple="+e+"]").length;h++)if("undefined"!=typeof a(a("["+this.options.namespace+"multiple="+e+"]").get(h)).data("Parsley")){f=a(a("["+this.options.namespace+"multiple="+e+"]").get(h)).data("Parsley"),this.$element.data("ParsleyFieldMultiple")||(f.addElement(this.$element),this.$element.attr(this.options.namespace+"id",f.__id__));break}return this.bind("parsleyField",c,e,!0),f||this.bind("parsleyFieldMultiple",c,e)},getNamespace:function(a){return"undefined"!=typeof this.$element.data("parsleyNamespace")?this.$element.data("parsleyNamespace"):"undefined"!=typeof b.get(a,"namespace")?a.namespace:"undefined"!=typeof b.get(window,"ParsleyConfig.namespace")?window.ParsleyConfig.namespace:c.namespace},bind:function(c,e,f,g){var h;switch(c){case"parsleyForm":h=a.extend(new i(this.$element,this.OptionsFactory),new d,window.ParsleyExtend)._bindFields();break;case"parsleyField":h=a.extend(new k(this.$element,this.OptionsFactory,e),new d,window.ParsleyExtend);break;case"parsleyFieldMultiple":h=a.extend(new k(this.$element,this.OptionsFactory,e),new d,new l,window.ParsleyExtend)._init(f);break;default:throw new Error(c+"is not a supported Parsley type")}return"undefined"!=typeof f&&b.setAttr(this.$element,this.options.namespace,"multiple",f),"undefined"!=typeof g?(this.$element.data("ParsleyFieldMultiple",h),h):(new RegExp("ParsleyF","i").test(h.__class__)&&(this.$element.data("Parsley",h),a.emit("parsley:"+("parsleyForm"===c?"form":"field")+":init",h)),h)}},a.fn.parsley=a.fn.psly=function(b){if(this.length>1){var c=[];return this.each(function(){c.push(a(this).parsley(b))}),c}return a(this).length?new o(this,b):void(window.console&&window.console.warn&&window.console.warn("You must bind Parsley on an existing element."))},window.ParsleyUI="function"==typeof b.get(window,"ParsleyConfig.ParsleyUI")?(new window.ParsleyConfig.ParsleyUI).listen():(new g).listen(),"undefined"==typeof window.ParsleyExtend&&(window.ParsleyExtend={}),"undefined"==typeof window.ParsleyConfig&&(window.ParsleyConfig={}),window.Parsley=window.psly=o,window.ParsleyUtils=b,window.ParsleyValidator=new f(window.ParsleyConfig.validators,window.ParsleyConfig.i18n),!1!==b.get(window,"ParsleyConfig.autoBind")&&a(document).ready(function(){a("[data-parsley-validate]").length&&a("[data-parsley-validate]").parsley()})});
| |
- | </script>
| |
- |
| |
- | <script>
| |
- | /***************************************************************
| |
- | * Copyright notice
| |
- | *
| |
- | * (c) 2012 Alexander Kellner <alexander.kellner@in2code.de>, in2code
| |
- | *
| |
- | * All rights reserved
| |
- | *
| |
- | * This script is part of the TYPO3 project. The TYPO3 project is
| |
- | * free software; you can redistribute it and/or modify
| |
- | * it under the terms of the GNU General Public License as published by
| |
- | * the Free Software Foundation; either version 3 of the License, or
| |
- | * (at your option) any later version.
| |
- | *
| |
- | * The GNU General Public License can be found at
| |
- | * http://www.gnu.org/copyleft/gpl.html.
| |
- | *
| |
- | * This script is distributed in the hope that it will be useful,
| |
- | * but WITHOUT ANY WARRANTY; without even the implied warranty of
| |
- | * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
| |
- | * GNU General Public License for more details.
| |
- | *
| |
- | * This copyright notice MUST APPEAR in all copies of the script!
| |
- | ***************************************************************/
| |
- |
| |
- | jQuery(document).ready(function() {
| |
- | $.fn.powermailTabs = function(options) {
| |
- | 'use strict';
| |
- | var $this = jQuery(this);
| |
- | options = jQuery.extend({
| |
- | container: 'fieldset',
| |
- | header: 'legend',
| |
- | tabs: true,
| |
- | navigation: true,
| |
- | openTabOnError: true,
| |
- | tabIndex: true
| |
- | }, options);
| |
- |
| |
- | // initial show first fieldset
| |
- | hideAllFieldsets($this, options);
| |
- | $this.find(options.container).first().show();
| |
- |
| |
- | generateTabNavigation($this, options);
| |
- | generateButtonNavigation($this, options);
| |
- |
| |
- | if ($.fn.parsley && $('form[data-parsley-validate="data-parsley-validate"]').length && $('.powermail_morestep').length) {
| |
- | $('form[data-parsley-validate="data-parsley-validate"]').parsley().subscribe('parsley:field:validated', function() {
| |
- | $('#powermail_tabmenu > li').removeClass('parsley-error');
| |
- |
| |
- | // if error occurs
| |
- | if (!$('form[data-parsley-validate="data-parsley-validate"]').parsley().isValid()) {
| |
- |
| |
- | // for each field with an error
| |
- | $('.parsley-error').each(function() {
| |
- | var errorIndex = $('.powermail_fieldset').index($(this).closest('.powermail_fieldset'));
| |
- | var tabWithError = $('#powermail_tabmenu > li').slice(errorIndex, errorIndex + 1);
| |
- | tabWithError.addClass('parsley-error');
| |
- | });
| |
- | }
| |
- | });
| |
- | }
| |
- |
| |
- | // open tab with error
| |
- | if (options.openTabOnError) {
| |
- | $.listen('parsley:field:error', function() {
| |
- | setTimeout(function() {
| |
- | $('.powermail_tabmenu > .parsley-error:first').click();
| |
- | }, 50);
| |
- | });
| |
- | }
| |
- | };
| |
- |
| |
- | /**
| |
- | * Show Tab
| |
- | *
| |
- | * @param tab
| |
- | * @param form
| |
- | * @param options
| |
- | * @param clickedIndex
| |
- | * @return void
| |
- | */
| |
- | function showTab(tab, form, options, clickedIndex) {
| |
- | $('.powermail_tabmenu li', form).removeClass('act');
| |
- | tab.addClass('act');
| |
- | hideAllFieldsets(form, options)
| |
- | $('.powermail_fieldset', form).slice(clickedIndex, clickedIndex + 1).show();
| |
- | }
| |
- |
| |
- | /**
| |
- | * Hide all fieldsets
| |
- | *
| |
- | * @param element
| |
- | * @param options
| |
- | * @return void
| |
- | */
| |
- | function hideAllFieldsets(element, options) {
| |
- | element.children(options.container).hide();
| |
- | }
| |
- |
| |
- | /**
| |
- | * Generate Button Navigation
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return void
| |
- | */
| |
- | function generateButtonNavigation(element, options) {
| |
- | if (!options.navigation) {
| |
- | return;
| |
- | }
| |
- |
| |
- | // buttons
| |
- | element.children(options.container).each(function(i) {
| |
- | var navigationContainer = $('<div />')
| |
- | .addClass('powermail_fieldwrap')
| |
- | .addClass('powermail_tab_navigation')
| |
- | .appendTo($(this));
| |
- | ;
| |
- | if (i > 0) {
| |
- | navigationContainer.append(createPreviousButton(element, options));
| |
- | }
| |
- | if (i < (element.children(options.container).length - 1)) {
| |
- | navigationContainer.append(createNextButton(element, options));
| |
- | }
| |
- | });
| |
- | }
| |
- |
| |
- | /**
| |
- | * Create next button
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return object
| |
- | */
| |
- | function createPreviousButton(element, options) {
| |
- | return $('<a />')
| |
- | .prop('href', '#')
| |
- | .addClass('powermail_tab_navigation_previous')
| |
- | .html('<')
| |
- | .click(function(e) {
| |
- | e.preventDefault();
| |
- | showPreviousTab(element, options);
| |
- | });
| |
- | }
| |
- |
| |
- | /**
| |
- | * Create next button
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return object
| |
- | */
| |
- | function createNextButton(element, options) {
| |
- | return $('<a />')
| |
- | .prop('href', '#')
| |
- | .addClass('powermail_tab_navigation_next')
| |
- | .html('>')
| |
- | .click(function(e) {
| |
- | e.preventDefault();
| |
- | showNextTab(element, options);
| |
- | });
| |
- | }
| |
- |
| |
- | /**
| |
- | * Show next Tab
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return void
| |
- | */
| |
- | function showNextTab(element, options) {
| |
- | var currentActiveTab = element.find('#powermail_tabmenu > li').index($('.act'));
| |
- | element.find('#powermail_tabmenu > li.act').removeClass('act').next().addClass('act');
| |
- | hideAllFieldsets(element, options);
| |
- | element.find('.powermail_fieldset').slice(currentActiveTab + 1, currentActiveTab + 2).show();
| |
- | }
| |
- |
| |
- | /**
| |
- | * Show previous Tab
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return void
| |
- | */
| |
- | function showPreviousTab(element, options) {
| |
- | var currentActiveTab = element.find('#powermail_tabmenu > li').index($('.act'));
| |
- | element.find('#powermail_tabmenu > li.act').removeClass('act').prev().addClass('act');
| |
- | hideAllFieldsets(element, options);
| |
- | element.find('.powermail_fieldset').slice(currentActiveTab - 1, currentActiveTab).show();
| |
- | }
| |
- |
| |
- | /**
| |
- | * Generate Tabs
| |
- | *
| |
- | * @param object element
| |
- | * @param array options
| |
- | * @return void
| |
- | */
| |
- | function generateTabNavigation(element, options) {
| |
- | if (!options.tabs) {
| |
- | return;
| |
- | }
| |
- |
| |
- | // generate menu
| |
- | var $ul = $('<ul />', {
| |
- | 'id': 'powermail_tabmenu',
| |
- | 'class': 'powermail_tabmenu'
| |
- | }).insertBefore(
| |
- | element.children(options.container).filter(':first')
| |
- | );
| |
- |
| |
- | // all containers
| |
- | element.children(options.container).each(function(i, $fieldset){
| |
- | //tab_menu
| |
- | var li = $('<li/>')
| |
- | .html($(this).children(options.header).html())
| |
- | .addClass((i==0) ? 'act' : '')
| |
- | .addClass('item' + i)
| |
- | .on('click keypress', {
| |
- | container: element.children(options.container),
| |
- | fieldset: $($fieldset)
| |
- | }, function() {
| |
- | var indexTab = $('.powermail_tabmenu li', element).index($(this));
| |
- | showTab($(this), element, options, indexTab);
| |
- | });
| |
- | if (options.tabIndex) {
| |
- | li.prop('tabindex', i);
| |
- | }
| |
- | $ul.append(li);
| |
- | });
| |
- | }
| |
- | });
| |
- |
| |
- | </script>
| |
- | <script>
| |
- | /**
| |
- | * Baseurl
| |
- | *
| |
- | * @type {string}
| |
- | */
| |
- | var baseurl;
| |
- |
| |
- | /**
| |
- | * Powermail main JavaScript for form validation
| |
- | */
| |
- | jQuery(document).ready(function($) {
| |
- |
| |
- | // Read baseURL
| |
- | baseurl = getBaseUrl();
| |
- |
| |
- | // Tabs
| |
- | if ($.fn.powermailTabs) {
| |
- | $('.powermail_morestep').powermailTabs();
| |
- | }
| |
- |
| |
- | // Location field
| |
- | if ($('.powermail_fieldwrap_location input').length) {
| |
- | getLocationAndWrite();
| |
- | }
| |
- |
| |
- | // AJAX Form submit
| |
- | if ($('form[data-powermail-ajax]').length) {
| |
- | ajaxFormSubmit();
| |
- | }
| |
- |
| |
- | // Datepicker field
| |
- | if ($.fn.datetimepicker) {
| |
- | $('.powermail_date').each(function() {
| |
- | var $this = $(this);
| |
- | // stop javascript datepicker, if browser supports type="date" or "datetime-local" or "time"
| |
- | if ($this.prop('type') === 'date' || $this.prop('type') === 'datetime-local' || $this.prop('type') === 'time') {
| |
- | if ($this.data('datepicker-force')) {
| |
- | // rewrite input type
| |
- | $this.prop('type', 'text');
| |
- | } else {
| |
- | // get date in format Y-m-d H:i for html5 date fields
| |
- | if ($(this).data('date-value')) {
| |
- | $(this).val(
| |
- | getDatetimeForDateFields($(this).data('date-value'), $(this).data('datepicker-format'), $this.prop('type'))
| |
- | );
| |
- | }
| |
- |
| |
- | // stop js datepicker
| |
- | return;
| |
- | }
| |
- | }
| |
- |
| |
- | var datepickerStatus = true;
| |
- | var timepickerStatus = true;
| |
- | if ($this.data('datepicker-settings') === 'date') {
| |
- | timepickerStatus = false;
| |
- | } else if ($this.data('datepicker-settings') === 'time') {
| |
- | datepickerStatus = false;
| |
- | }
| |
- |
| |
- | // create datepicker
| |
- | $this.datetimepicker({
| |
- | format: $this.data('datepicker-format'),
| |
- | timepicker: timepickerStatus,
| |
- | datepicker: datepickerStatus,
| |
- | lang: 'en',
| |
- | i18n:{
| |
- | en:{
| |
- | months: $this.data('datepicker-months').split(','),
| |
- | dayOfWeek: $this.data('datepicker-days').split(',')
| |
- | }
| |
- | }
| |
- | });
| |
- | });
| |
- | }
| |
- |
| |
- | // File Upload Delete
| |
- | $('.powermail_fieldwrap_file_inner').find('.deleteAllFiles').each(function() {
| |
- | // initially hide upload fields
| |
- | disableUploadField($(this).closest('.powermail_fieldwrap_file_inner').find('input[type="file"]'));
| |
- | });
| |
- | $('.deleteAllFiles').click(function() {
| |
- | enableUploadField($(this).closest('.powermail_fieldwrap_file_inner').find('input[type="file"]'));
| |
- | $(this).closest('ul').fadeOut(function() {
| |
- | $(this).remove();
| |
- | });
| |
- | });
| |
- | function disableUploadField(element) {
| |
- | element.prop('disabled', 'disabled').addClass('hide');
| |
- | }
| |
- | function enableUploadField(element) {
| |
- | element.removeProp('disabled').removeClass('hide');
| |
- | }
| |
- |
| |
- | // Password Field Output
| |
- | $('.powermail_all_type_password.powermail_all_value').html('********');
| |
- | });
| |
- |
| |
- | /**
| |
- | * Allow AJAX Submit for powermail
| |
- | *
| |
- | * @return void
| |
- | */
| |
- | function ajaxFormSubmit() {
| |
- | // submit is called after parsley and html5 validation - so we don't have to check for errors
| |
- | $(document).on('submit', 'form[data-powermail-ajax]', function (e) {
| |
- | var $this = $(this);
| |
- | var formUid = $this.data('powermail-form');
| |
- |
| |
- | $.ajax({
| |
- | type: 'POST',
| |
- | url: $this.prop('action'),
| |
- | data: $this.serialize(),
| |
- | beforeSend: function() {
| |
- | // add progressbar <div class="powermail_progressbar"><div class="powermail_progress"><div class="powermail_progess_inner"></div></div></div>
| |
- | var progressBar = $('<div />').addClass('powermail_progressbar').html(
| |
- | $('<div />').addClass('powermail_progress').html(
| |
- | $('<div />').addClass('powermail_progess_inner')
| |
- | )
| |
- | );
| |
- | $('.powermail_submit', $this).parent().append(progressBar);
| |
- | $('.powermail_confirmation_submit, .powermail_confirmation_form', $this).closest('.powermail_confirmation').append(progressBar);
| |
- | },
| |
- | complete: function() {
| |
- | // remove progressbar
| |
- | $('.powermail_fieldwrap_submit', $this).find('.powermail_progressbar').remove();
| |
- | },
| |
- | success: function(data) {
| |
- | var html = $('*[data-powermail-form="' + formUid + '"]:first', data);
| |
- | $('.tx-powermail').html(html);
| |
- | // fire tabs and parsley again
| |
- | if ($.fn.powermailTabs) {
| |
- | $('.powermail_morestep').powermailTabs();
| |
- | }
| |
- | if ($.fn.parsley) {
| |
- | $('form[data-parsley-validate="data-parsley-validate"]').parsley();
| |
- | }
| |
- | }
| |
- | });
| |
- |
| |
- | e.preventDefault();
| |
- | });
| |
- | }
| |
- |
| |
- | /**
| |
- | * Convert date format for html5 date fields
| |
- | * 31.08.2014 => 2014-08-31
| |
- | *
| |
- | * @param value
| |
- | * @param format
| |
- | * @param type
| |
- | * @returns {string}
| |
- | */
| |
- | function getDatetimeForDateFields(value, format, type) {
| |
- | var date = new Date(Date.parseDate(value, format));
| |
- | var valueDate = date.getFullYear() + '-';
| |
- | valueDate += ('0' + (date.getMonth() + 1)).slice(-2) + '-';
| |
- | valueDate += ('0' + date.getDate()).slice(-2);
| |
- | var valueTime = ('0' + date.getHours()).slice(-2) + ':' + ('0' + date.getMinutes()).slice(-2);
| |
- | var valueDateTime = valueDate + 'T' + valueTime;
| |
- |
| |
- | if (type === 'date') {
| |
- | return valueDate;
| |
- | }
| |
- | if (type === 'datetime-local') {
| |
- | return valueDateTime;
| |
- | }
| |
- | if (type === 'time') {
| |
- | return valueTime;
| |
- | }
| |
- | return 'error';
| |
- | }
| |
- |
| |
- | /**
| |
- | * Getting the Location by the browser and write to inputform as address
| |
- | *
| |
- | * @return void
| |
- | */
| |
- | function getLocationAndWrite() {
| |
- | if (navigator.geolocation) { // Read location from Browser
| |
- | navigator.geolocation.getCurrentPosition(function(position) {
| |
- | var lat = position.coords.latitude;
| |
- | var lng = position.coords.longitude;
| |
- | var url = baseurl + '/index.php' + '?eID=' + 'powermailEidGetLocation';
| |
- | jQuery.ajax({
| |
- | url: url,
| |
- | data: 'lat=' + lat + '&lng=' + lng,
| |
- | cache: false,
| |
- | beforeSend: function(jqXHR, settings) {
| |
- | jQuery('body').css('cursor', 'wait');
| |
- | },
| |
- | complete: function(jqXHR, textStatus) {
| |
- | jQuery('body').css('cursor', 'default');
| |
- | },
| |
- | success: function(data) { // return values
| |
- | if (data) {
| |
- | jQuery('.powermail_fieldwrap_location input').val(data);
| |
- | }
| |
- | }
| |
- | });
| |
- | });
| |
- | }
| |
- | }
| |
- |
| |
- | /**
| |
- | * Return BaseUrl as prefix
| |
- | *
| |
- | * @return string Base Url
| |
- | */
| |
- | function getBaseUrl() {
| |
- | var baseurl;
| |
- | if (jQuery('base').length > 0) {
| |
- | baseurl = jQuery('base').prop('href');
| |
- | } else {
| |
- | if (window.location.protocol != "https:") {
| |
- | baseurl = 'http://' + window.location.hostname;
| |
- | } else {
| |
- | baseurl = 'https://' + window.location.hostname;
| |
- | }
| |
- | }
| |
- | return baseurl;
| |
- | }
| |
- | </script>
| |
- | <script>
| |
- | /**
| |
- | * Powermail_Frontend main JavaScript
| |
- | */
| |
- | jQuery(document).ready(function($) {
| |
- | });
| |
- | </script>
| |
- | <script>
| |
- | jQuery(document).ready(function() {
| |
- | var data = '';
| |
- | data += 'tx_powermail_pi1[language]=' + $('#powermail_marketing_information').data('language');
| |
- | data += '&tx_powermail_pi1[pid]=' + $('#powermail_marketing_information').data('pid');
| |
- | data += '&tx_powermail_pi1[mobileDevice]=' + (isMobile() ? 1 : 0);
| |
- | data += '&tx_powermail_pi1[referer]=' + encodeURIComponent(document.referrer);
| |
- | jQuery.ajax({
| |
- | url: getBaseUrl() + '/index.php?&eID=powermailEidMarketing',
| |
- | data: data,
| |
- | cache: false
| |
- | });
| |
- | });
| |
- |
| |
- | /**
| |
- | * Check if user device is mobile or not
| |
- | *
| |
- | * @return bool
| |
- | */
| |
- | function isMobile() {
| |
- | var ua = navigator.userAgent;
| |
- | var checker = {
| |
- | iphone:ua.match(/(iPhone|iPod|iPad)/),
| |
- | blackberry:ua.match(/BlackBerry/),
| |
- | android:ua.match(/Android/)
| |
- | }
| |
- |
| |
- | if (checker.iphone || checker.blackberry || checker.android) {
| |
- | return true;
| |
- | }
| |
- | return false;
| |
- | }
| |
- |
| |
- | /**
| |
- | * Return BaseUrl as prefix
| |
- | *
| |
- | * @return string Base Url
| |
- | */
| |
- | function getBaseUrl() {
| |
- | var baseurl;
| |
- | if (jQuery('base').length > 0) {
| |
- | baseurl = jQuery('base').prop('href');
| |
- | } else {
| |
- | if (window.location.protocol != "https:") {
| |
- | baseurl = 'http://' + window.location.hostname;
| |
- | } else {
| |
- | baseurl = 'https://' + window.location.hostname;
| |
- | }
| |
- | }
| |
- | return baseurl;
| |
- | }
| |
- | </script>
| |
- |
| |
- |
| |
- | <head>
| |
- |
| |
- |
| |
- | <script src="http://lacanne.de/media/js/lightbox/jquery-1.11.0.min.js"></script>
| |
- | <script src="http://lacanne.de/media/js/lightbox/lightbox.min.js"></script>
| |
- |
| |
- |
| |
- | <meta charset="utf-8">
| |
- | <!--
| |
- | This website is powered by TYPO3 - inspiring people to share!
| |
- | TYPO3 is a free open source Content Management Framework initially created by Kasper Skaarhoj and licensed under GNU/GPL.
| |
- | TYPO3 is copyright 1998-2014 of Kasper Skaarhoj. Extensions are copyright of their respective owners.
| |
- | Information and contribution at http://typo3.org/
| |
- | -->
| |
- |
| |
- |
| |
- | <link rel="shortcut icon" href="https://igem.bio.tu-darmstadt.de/wiki/fileadmin/templates/images/favicon.jpg" type="image/jpeg; charset=binary">
| |
- | <link rel="icon" href="https://igem.bio.tu-darmstadt.de/wiki/fileadmin/templates/images/favicon.jpg" type="image/jpeg; charset=binary">
| |
- | <title>Home</title>
| |
- |
| |
- | <script src="https://igem.bio.tu-darmstadt.de/wiki/fileadmin/templates/js/jquery.flexslider-min.js?1411862880" type="text/javascript"></script>
| |
- |
| |
- | <!--[if lt IE 9]>
| |
- |
| |
- |
| |
- | <link media="all" href="https://igem.bio.tu-darmstadt.de/wiki/fileadmin/templates/css/oldie.css" type="text/css" rel="stylesheet" /><![endif]--> <link rel="home" type="text/html" title="Startseite" href="/">
| |
- | <link rel="search" title="Suche" href="/suche.html">
| |
- | <script src="//cdnjs.cloudflare.com/ajax/libs/jquery-backstretch/2.0.4/jquery.backstretch.min.js" type="text/javascript"></script>
| |
- | <script type="text/javascript">
| |
- | jQuery(function($){
| |
- | $.backstretch("https://igem.bio.tu-darmstadt.de/wiki/fileadmin/templates/images/vibations_final.jpg.jpg");
| |
- | });
| |
- | </script> <script type="text/javascript">$(function() {
| |
- | if (window.PIE) {
| |
- | $('.rounded').each(function() {
| |
- | PIE.attach(this);
| |
- | });
| |
- | }
| |
- | });</script>
| |
- | <!--[endif]---->
| |
- | <script type="text/javascript" charset="utf-8">$(window).load(function() {$('.flexslider').flexslider({pauseOnAction:false,slideshowSpeed: 7000,animationSpeed:1500});});</script>
| |
- |
| |
- | <style type="text/css">.MathJax_Hover_Frame {border-radius: .25em; -webkit-border-radius: .25em; -moz-border-radius: .25em; -khtml-border-radius: .25em; box-shadow: 0px 0px 15px #83A; -webkit-box-shadow: 0px 0px 15px #83A; -moz-box-shadow: 0px 0px 15px #83A; -khtml-box-shadow: 0px 0px 15px #83A; border: 1px solid #A6D ! important; display: inline-block; position: absolute}
| |
- | .MathJax_Hover_Arrow {position: absolute; width: 15px; height: 11px; cursor: pointer}
| |
- | </style><style type="text/css">#MathJax_About {position: fixed; left: 50%; width: auto; text-align: center; border: 3px outset; padding: 1em 2em; background-color: #DDDDDD; color: black; cursor: default; font-family: message-box; font-size: 120%; font-style: normal; text-indent: 0; text-transform: none; line-height: normal; letter-spacing: normal; word-spacing: normal; word-wrap: normal; white-space: nowrap; float: none; z-index: 201; border-radius: 15px; -webkit-border-radius: 15px; -moz-border-radius: 15px; -khtml-border-radius: 15px; box-shadow: 0px 10px 20px #808080; -webkit-box-shadow: 0px 10px 20px #808080; -moz-box-shadow: 0px 10px 20px #808080; -khtml-box-shadow: 0px 10px 20px #808080; filter: progid:DXImageTransform.Microsoft.dropshadow(OffX=2, OffY=2, Color='gray', Positive='true')}
| |
- | .MathJax_Menu {position: absolute; background-color: white; color: black; width: auto; padding: 5px 0px; border: 1px solid #CCCCCC; margin: 0; cursor: default; font: menu; text-align: left; text-indent: 0; text-transform: none; line-height: normal; letter-spacing: normal; word-spacing: normal; word-wrap: normal; white-space: nowrap; float: none; z-index: 201; border-radius: 5px; -webkit-border-radius: 5px; -moz-border-radius: 5px; -khtml-border-radius: 5px; box-shadow: 0px 10px 20px #808080; -webkit-box-shadow: 0px 10px 20px #808080; -moz-box-shadow: 0px 10px 20px #808080; -khtml-box-shadow: 0px 10px 20px #808080; filter: progid:DXImageTransform.Microsoft.dropshadow(OffX=2, OffY=2, Color='gray', Positive='true')}
| |
- | .MathJax_MenuItem {padding: 1px 2em; background: transparent}
| |
- | .MathJax_MenuArrow {position: absolute; right: .5em; color: #666666}
| |
- | .MathJax_MenuActive .MathJax_MenuArrow {color: white}
| |
- | .MathJax_MenuArrow.RTL {left: .5em; right: auto}
| |
- | .MathJax_MenuCheck {position: absolute; left: .7em}
| |
- | .MathJax_MenuCheck.RTL {right: .7em; left: auto}
| |
- | .MathJax_MenuRadioCheck {position: absolute; left: .7em}
| |
- | .MathJax_MenuRadioCheck.RTL {right: .7em; left: auto}
| |
- | .MathJax_MenuLabel {padding: 1px 2em 3px 1.33em; font-style: italic}
| |
- | .MathJax_MenuRule {border-top: 1px solid #DDDDDD; margin: 4px 3px}
| |
- | .MathJax_MenuDisabled {color: GrayText}
| |
- | .MathJax_MenuActive {background-color: #606872; color: white}
| |
- | .MathJax_Menu_Close {position: absolute; width: 31px; height: 31px; top: -15px; left: -15px}
| |
- | </style><style type="text/css">#MathJax_Zoom {position: absolute; background-color: #F0F0F0; overflow: auto; display: block; z-index: 301; padding: .5em; border: 1px solid black; margin: 0; font-weight: normal; font-style: normal; text-align: left; text-indent: 0; text-transform: none; line-height: normal; letter-spacing: normal; word-spacing: normal; word-wrap: normal; white-space: nowrap; float: none; box-shadow: 5px 5px 15px #AAAAAA; -webkit-box-shadow: 5px 5px 15px #AAAAAA; -moz-box-shadow: 5px 5px 15px #AAAAAA; -khtml-box-shadow: 5px 5px 15px #AAAAAA; filter: progid:DXImageTransform.Microsoft.dropshadow(OffX=2, OffY=2, Color='gray', Positive='true')}
| |
- | #MathJax_ZoomOverlay {position: absolute; left: 0; top: 0; z-index: 300; display: inline-block; width: 100%; height: 100%; border: 0; padding: 0; margin: 0; background-color: white; opacity: 0; filter: alpha(opacity=0)}
| |
- | #MathJax_ZoomFrame {position: relative; display: inline-block; height: 0; width: 0}
| |
- | #MathJax_ZoomEventTrap {position: absolute; left: 0; top: 0; z-index: 302; display: inline-block; border: 0; padding: 0; margin: 0; background-color: white; opacity: 0; filter: alpha(opacity=0)}
| |
- | </style><style type="text/css">.MathJax_Preview {color: #888}
| |
- | #MathJax_Message {position: fixed; left: 1px; bottom: 2px; background-color: #E6E6E6; border: 1px solid #959595; margin: 0px; padding: 2px 8px; z-index: 102; color: black; font-size: 80%; width: auto; white-space: nowrap}
| |
- | #MathJax_MSIE_Frame {position: absolute; top: 0; left: 0; width: 0px; z-index: 101; border: 0px; margin: 0px; padding: 0px}
| |
- | .MathJax_Error {color: #CC0000; font-style: italic}
| |
- |
| |
- | body { margin-top: -10px; }
| |
- | </style>
| |
- |
| |
- |
| |
- | <body>
| |
- |
| |
- |
| |
- | <div id="allWrap">
| |
- | <!-- Go to www.addthis.com/dashboard to customize your tools
| |
- | <script type="text/javascript" src="//s7.addthis.com/js/300/addthis_widget.js#pubid=ra-53fc937343a24a1a" async></script>-->
| |
- |
| |
- |
| |
- |
| |
- | <div id="headerBG">
| |
- | <div id="headerWrap" class="container_24">
| |
- | <div id="logo" class="grid_6">
| |
- | <a href="https://2014.igem.org/Team:TU_Darmstadt"><img src="https://static.igem.org/mediawiki/2014/a/af/IGEMLogoTUD.png" alt=""></a></figure>
| |
- | </div>
| |
- |
| |
- | <div id="claim" class="grid_18">
| |
- | <!--TYPO3SEARCH_begin--><div id="c318" class="csc-default">
| |
- | <div class="csc-textpic csc-textpic-intext-right">
| |
- |
| |
- | <a href="https://igem.org/" target="_blank">
| |
- | <img src="https://static.igem.org/mediawiki/igem.org/f/f2/Igemfooterlogo.png" width="60" height="47" alt=""></a></div>
| |
- | </div><!--TYPO3SEARCH_end-->
| |
- | </div>
| |
- |
| |
- | <div id="topBar" class="grid_18">
| |
- | <ul class="top">
| |
- | <li class="active first"><a href="https://2014.igem.org/Team:TU_Darmstadt" >Home</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Project" >Project</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Results" >Results</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/PolicyandPractices" >Policy & Practices</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Achievements" >Achievements</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Notebook" >Notebook</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Team" >Team</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Gallery" >Gallery</a></li>
| |
- | <li><a href="https://2014.igem.org/Team:TU_Darmstadt/Sitemap" >Sitemap</a></li>
| |
- | <li class="last"><a href="https://2014.igem.org/Team:TU_Darmstadt/Contact" >Contact</a></li></ul>
| |
- | </div>
| |
- |
| |
- |
| |
- | </div>
| |
- | </div> <!--ende headerBG-->
| |
- |
| |
- |
| |
- | <div id="topWrap" class="container_24">
| |
- | <div id="slider" class="grid_18">
| |
- | <ul class="slides">
| |
- | <li><img src="https://static.igem.org/mediawiki/2014/1/1e/Slideroject.jpg" width="710" height="300" alt="" ></li>
| |
- | <li><img src="https://static.igem.org/mediawiki/parts/f/fe/SlideResults.jpg" width="710" height="300" alt="" ></li>
| |
- | <li><img src="https://static.igem.org/mediawiki/parts/a/ac/SlideTeam.jpg" width="710" height="300" alt="" ></li>
| |
- | <li><img src="https://static.igem.org/mediawiki/parts/5/59/SlidePolicyandPractices.jpg" width="710" height="300" alt="" ></li>
| |
- | <li><img src="https://static.igem.org/mediawiki/parts/0/0a/SlideOpenHardware.jpg" width="710" height="300" alt="" ></li>
| |
- | <li><img src="https://static.igem.org/mediawiki/parts/6/67/SlideModeling.jpg" width="710" height="300" alt="" ></li>
| |
- | </ul>
| |
- | </div>
| |
- |
| |
- | <div id="promoWrap" class="grid_6">
| |
- |
| |
- | <div class="grid_6 promo1"><a href="https://2014.igem.org/Team:TU_Darmstadt/Project" target="_top"><h1>The Project</h1><p>Find out, what it's all about</p></a></div>
| |
- |
| |
- | <div class="grid_6 promo2"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results" target="_top"><h1>Data, more data!</h1><p>Check out our results</p></a></div>
| |
- | <div class="grid_6 promo3"><a href="https://2014.igem.org/Team:TU_Darmstadt/Team" target="_top"><h1>The People</h1><p>See the people behind the project</p></a></div>
| |
- | </div>
| |
- | </div> <!--ende topWrap-->
| |
- |
| |
- |
| |
- | <div id="contentWrap" class="container_24">
| |
- |
| |
- |
| |
- |
| |
- |
| |
- | <div id="footerBG">
| |
- | <div id="sponsoren">
| |
- | <ul>
| |
- | <li>
| |
- | <a href="http://schenck.net/de/">
| |
- | <img src="https://static.igem.org/mediawiki/parts/2/2d/Schenck.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.hse-stiftung.de">
| |
- | <img src="https://static.igem.org/mediawiki/parts/e/ed/Hse.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.suedzucker.de">
| |
- | <img src="https://static.igem.org/mediawiki/parts/a/af/Suedzucker.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.lot-qd.de/de/de/">
| |
- | <img src="https://static.igem.org/mediawiki/parts/c/cb/LOT.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.merck.de">
| |
- | <img src="https://static.igem.org/mediawiki/parts/6/6c/Merck_gut.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <a href="http://ead.darmstadt.de">
| |
- | <img src="https://static.igem.org/mediawiki/parts/9/9d/Ead_gut.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | </li>
| |
- | <a href="http://www.binder-world.com">
| |
- | <img src="https://static.igem.org/mediawiki/parts/4/4e/BINDER_gut.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.solaronix.com/">
| |
- | <img src="https://static.igem.org/mediawiki/parts/1/15/Solaronix.png" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.sarstedt.com">
| |
- | <img src="https://static.igem.org/mediawiki/parts/f/fd/Sarstedt_gut.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="https://www.neb.com">
| |
- | <img src="https://static.igem.org/mediawiki/parts/3/34/NEB_gut.jpg" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- | <li>
| |
- | <a href="http://www.snapgene.com">
| |
- | <img src="https://static.igem.org/mediawiki/parts/c/c0/SnapGene.png" alt="" width="120" height="84">
| |
- | </a>
| |
- | </li>
| |
- |
| |
- | </ul>
| |
- |
| |
- | </div>
| |
- | <div id="footerInner">
| |
- | <div id="footerWrap" class="container_24">
| |
- | <div class="grid_4">
| |
- | <ul class="menu"><li class="first"><a href="index.php?id=23" >iGEM TUD</a></li><li><a href="index.php?id=26" >Sitemap</a></li><li><a href="index.php?id=33" >Team</a></li><li><a href="index.php?id=27" >Kontakt</a></li><li class="last"><a href="index.php?id=57" >Sponsoren</a></li></ul>
| |
- | </div>
| |
- |
| |
- | <div class="grid_4">
| |
- | <ul class="menu"></ul>
| |
- | </div>
| |
- |
| |
- | <div class="grid_4">
| |
- | <ul class="menu"></ul>
| |
- | </div>
| |
- |
| |
- | <div class="grid_4">
| |
- | <ul class="menu"></ul>
| |
- | </div>
| |
- |
| |
- | <div id="footerContent" class="grid_8">
| |
- | <!--TYPO3SEARCH_begin--><!--TYPO3SEARCH_end-->
| |
- | </div>
| |
- |
| |
- |
| |
- | <div id="copy" class="grid_24">
| |
- | <p>© 2014 iGEM 2014 TUDarmstadt | Alle Rechte vorbehalten.</p>
| |
- | </div>
| |
- |
| |
- | </div>
| |
- | </div> <!--ende footerWrap-->
| |
- |
| |
- |
| |
- | </div> <!--ende footerBG-->
| |
- |
| |
- |
| |
- | </body>
| |
- |
| |
| | | |
| | | |
| + | <html> |
| <div id="contentWrap" class="container_24"> | | <div id="contentWrap" class="container_24"> |
| <div id="breadcrumbs" class="grid_24"> | | <div id="breadcrumbs" class="grid_24"> |
- | | + | <p>Sie sind hier: <a href="index.php?id=23" >wiki</a> › <a href="index.php?id=29" >Results</a> › <span class="current"><a href="index.php?id=45" >Modeling</a></span></p> |
| </div> | | </div> |
| | | |
| <div id="leftNavi" class="grid_5"> | | <div id="leftNavi" class="grid_5"> |
| <nav> | | <nav> |
- | <ul class="menu"><li class="first"><a href="https://2014.igem.org/Team:TU_Darmstadt/Home" >Home</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Project" >Project</a></li><li class="active"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results" >Results</a><ul class="menu2"><li class="first"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Pathway" >Pathway</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Scaffold" >Scaffold</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Modeling" >Modeling</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Safety" >Safety</a></li><li class="active last"><a href="Results/Open_Hardware" >Open Hardware</a><ul class="menu3"><li class="first"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware/Graetzel_Cell_Open_Hardware" >Grätzel Cell</a></li><li class="last"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware/Gel_Electrophoresis_Chamber" >Gel Electrophoresis Chamber</a></li></ul></li></ul></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/PolicyandPractices" >Policy & Practices</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Achievements" >Achievements</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Notebook" >Notebook</a></li><li><a href="https://2014.igem.org/Team:TU_Darmstadt/Team" >Team</a></li></ul> | + | <ul class="menu"><li class="first"><a href="index.php?id=160" >Home</a></li><li><a href="index.php?id=28" >Project</a></li><li class="active"><a href="index.php?id=29" >Results</a><ul class="menu2"><li class="first"><a href="index.php?id=43" >Pathway</a></li><li><a href="index.php?id=44" >Scaffold</a></li><li class="active"><a href="index.php?id=45" >Modeling</a><ul class="menu3"><li class="first"><a href="index.php?id=163" >Theory</a></li><li><a href="index.php?id=166" >ANS Engineering</a></li><li><a href="index.php?id=168" >Open Software</a></li><li class="last"><a href="index.php?id=165" >Rule based Modelling</a></li></ul></li><li><a href="index.php?id=46" >Safety</a></li><li class="last"><a href="index.php?id=136" >Open Hardware</a></li></ul></li><li><a href="index.php?id=30" >Policy & Practices</a></li><li><a href="index.php?id=31" >Achievements</a></li><li><a href="index.php?id=32" >Notebook</a></li><li><a href="index.php?id=33" >Team</a></li><li class="last"><a href="index.php?id=34" >Gallery</a></li></ul> |
| </nav> | | </nav> |
| </div> | | </div> |
| | | |
| <div id="wikicontent" class="grid_19"> | | <div id="wikicontent" class="grid_19"> |
- | <!--TYPO3SEARCH_begin--><div id="c321" class="csc-default"><div class="csc-header csc-header-n1"><h1 class="csc-header-alignment-center csc-firstHeader">Grätzel cell / Gel Electrophoresis Chamber</h1></div><div class="csc-textpic csc-textpic-center csc-textpic-above"><div class="csc-textpic-imagewrap" data-csc-images="2" data-csc-cols="2"><div class="csc-textpic-center-outer"><div class="csc-textpic-center-inner"><div class="csc-textpic-imagerow csc-textpic-imagerow-last"><div class="csc-textpic-imagecolumn csc-textpic-firstcol"><figure class="csc-textpic-image csc-textpic-last"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware/Graetzel_Cell_Open_Hardware"><img src="https://static.igem.org/mediawiki/parts/b/b5/Bild-zelle-link2.png" width="295" height="262" alt=""></a></figure></div> | + | <!--TYPO3SEARCH_begin--><div id="c62" class="csc-default"><div class="csc-header csc-header-n1"><h1 class="csc-firstHeader">Modelling</h1></div></div><div id="c451" class="csc-default"><div class="csc-textpic csc-textpic-center csc-textpic-above csc-textpic-equalheight"><div class="csc-textpic-imagewrap" data-csc-images="4" data-csc-cols="2"><div class="csc-textpic-center-outer"><div class="csc-textpic-center-inner"><div class="csc-textpic-imagerow"><div class="csc-textpic-imagecolumn csc-textpic-firstcol"><figure class="csc-textpic-image csc-textpic-last"><a href="index.php?id=163"><img src="fileadmin/_processed_/csm_THEORY_NEW_bedf3f1f46.png" width="295" height="197" alt=""></a></figure></div> |
- | <div class="csc-textpic-imagecolumn csc-textpic-lastcol"><figure class="csc-textpic-image csc-textpic-last"><a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware/Gel_Electrophoresis_Chamber"><img src="https://static.igem.org/mediawiki/parts/3/33/T3.jpg" width="295" height="261" alt=""></a></figure></div></div></div></div></div><div class="csc-textpic-text"></div></div></div><!--TYPO3SEARCH_end--> | + | <div class="csc-textpic-imagecolumn csc-textpic-lastcol"><figure class="csc-textpic-image csc-textpic-last"><a href="index.php?id=166"><img src="fileadmin/_processed_/csm_ENGI_NEW_fdde590688.png" width="295" height="197" alt=""></a></figure></div></div> |
| + | <div class="csc-textpic-imagerow csc-textpic-imagerow-last"><div class="csc-textpic-imagecolumn csc-textpic-firstcol"><figure class="csc-textpic-image csc-textpic-last"><a href="index.php?id=168"><img src="fileadmin/_processed_/csm_OS_NEW_8e1b3a4359.png" width="295" height="197" alt=""></a></figure></div> |
| + | <div class="csc-textpic-imagecolumn csc-textpic-lastcol"><figure class="csc-textpic-image csc-textpic-last"><a href="index.php?id=165"><img src="fileadmin/_processed_/csm_KAPPA_NEW_c68e81fb94.png" width="295" height="197" alt=""></a></figure></div></div></div></div></div></div></div><!--TYPO3SEARCH_end--> |
| </div> | | </div> |
| | | |
Line 4,811: |
Line 59: |
| | | |
| <script type="text/javascript"> | | <script type="text/javascript"> |
- | var banners = new BannerPlacement(136, 0, 9001, '', '3,4,1,2', 'all', 'banners-mtbiyta0n', 'bde5c5210571f3498836b97b0daed3a3b704f13b'); | + | var banners = new BannerPlacement(45, 0, 9001, '', '3,4,1,2', 'all', 'banners-nwexztlkn', '212ccccee2f3d1b8cf48546e5219f652228418bf'); |
| </script> | | </script> |
- | <div id="banners-mtbiyta0n"></div> | + | <div id="banners-nwexztlkn"></div> |
| | | |
| </div></div> | | </div></div> |
| </div> | | </div> |
| </div> <!--ende contentWrap--> | | </div> <!--ende contentWrap--> |
- | </p>
| |
- | <!--
| |
- | NewPP limit report
| |
- | Preprocessor node count: 19/1000000
| |
- | Post-expand include size: 207/2097152 bytes
| |
- | Template argument size: 0/2097152 bytes
| |
- | Expensive parser function count: 0/100
| |
- | -->
| |
- |
| |
- | <!-- Saved in parser cache with key 2014_igem_org:pcache:idhash:34557-0!1!0!!en!2 and timestamp 20141017140747 -->
| |
- | <div class="printfooter">
| |
- | Retrieved from "<a href="https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware">https://2014.igem.org/Team:TU_Darmstadt/Results/Open_Hardware</a>"</div>
| |
- | <div id="catlinks"><div id='catlinks' class='catlinks catlinks-allhidden'></div></div> <!-- end content -->
| |
- | <div class="visualClear"></div>
| |
- | </div>
| |
- | </div>
| |
- | <!-- PAGE FOOTER -- ITEMS FROM COLUMN ! HAVE BEEN MOVED HERE -- RDR -->
| |
- | <div class="visualClear"></div>
| |
- | <div id='footer-box' class='noprint'>
| |
- | <div id="footer">
| |
- | <div id="f-poweredbyico"><a href="http://www.mediawiki.org/"><img src="/wiki/skins/common/images/poweredby_mediawiki_88x31.png" height="31" width="88" alt="Powered by MediaWiki" /></a></div> <div id="f-copyrightico"><a href="http://creativecommons.org/licenses/by/3.0/"><img src="http://i.creativecommons.org/l/by/3.0/88x31.png" alt="Attribution 3.0 Unported" width="88" height="31" /></a></div> <ul id="f-list">
| |
- |
| |
- |
| |
- | <!-- Recentchanges is not handles well DEBUG -->
| |
- | <li id="t-recentchanges"><a href="/Special:RecentChanges"
| |
- | title='Recent changes'>Recent changes</a></li>
| |
- |
| |
- | <li id="t-whatlinkshere"><a href="/Special:WhatLinksHere/Team:TU_Darmstadt/Results/Open_Hardware"
| |
- | title="List of all wiki pages that link here [j]" accesskey="j">What links here</a></li>
| |
- |
| |
- | <li id="t-recentchangeslinked"><a href="/Special:RecentChangesLinked/Team:TU_Darmstadt/Results/Open_Hardware"
| |
- | title="Recent changes in pages linked from this page [k]" accesskey="k">Related changes</a></li>
| |
- |
| |
- |
| |
- |
| |
- | <li id="t-upload"><a href="/Special:Upload"
| |
- | title="Upload files [u]" accesskey="u">Upload file</a>
| |
- | </li>
| |
- | <li id="t-specialpages"><a href="/Special:SpecialPages"
| |
- | title="List of all special pages [q]" accesskey="q">Special pages</a>
| |
- | </li>
| |
- | <li><a href='/Special:Preferences'>My preferences</a></li>
| |
- | </ul>
| |
- | </div> <!-- close footer -->
| |
- | <div id='footer'>
| |
- | <ul id="f-list">
| |
- |
| |
- | <li id="t-print"><a href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&printable=yes"
| |
- | title="Printable version of this page [p]" accesskey="p">Printable version</a>
| |
- | </li>
| |
- |
| |
- | <li id="t-permalink"><a href="/wiki/index.php?title=Team:TU_Darmstadt/Results/Open_Hardware&oldid=285174"
| |
- | title="Permanent link to this revision of the page">Permanent link</a>
| |
- | </li>
| |
- |
| |
- |
| |
- | <li id="privacy"><a href="/2014.igem.org:Privacy_policy" title="2014.igem.org:Privacy policy">Privacy policy</a></li>
| |
- | <li id="disclaimer"><a href="/2014.igem.org:General_disclaimer" title="2014.igem.org:General disclaimer">Disclaimers</a></li>
| |
- | </ul>
| |
- | </div> <!-- close footer -->
| |
- | </div> <!-- close footer-box -->
| |
- |
| |
- | <script>if (window.runOnloadHook) runOnloadHook();</script>
| |
- | </div>
| |
- | <!-- Served in 0.088 secs. --></body>
| |
- |
| |
| </html> | | </html> |